Showing NP-Card for Triricinolein (NP0337349)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Created at | 2024-09-11 10:26:39 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
Updated at | 2024-09-11 10:26:39 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
NP-MRD ID | NP0337349 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||
Natural Product Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Triricinolein | |||||||||||||||||||||||||||||||||||||||||||||||||||
Description | It was first documented in 2006 (PMID: 19127716). Based on a literature review a small amount of articles have been published on Triricinolein (PMID: 30295712) (PMID: 22319559) (PMID: 16555475). | |||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for NP0337349 (Triricinolein)Mrv2104 05262312582D 66 65 0 0 0 0 999 V2000 23.6814 2.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3217 0.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8733 -8.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.9288 2.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6527 1.4578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7897 -8.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.2599 2.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0999 1.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4587 -7.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.5073 2.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7689 1.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3751 -6.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8279 3.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6190 3.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7165 -1.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7442 4.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3716 3.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3855 -1.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.1589 2.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9500 2.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8001 -2.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.9916 4.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0406 3.4855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3018 -0.3286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2425 2.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1974 3.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1311 -2.9357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3227 4.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7932 3.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9708 0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.8383 1.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5215 1.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0440 -6.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.9951 1.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5284 2.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2147 -3.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5701 4.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4621 3.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8872 0.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.0857 2.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1905 1.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9604 -5.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.6641 2.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6120 1.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5458 -4.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9011 3.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2147 3.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5562 1.4578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7269 4.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3053 3.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4167 1.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9431 1.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6294 -5.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0579 3.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1485 4.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8837 3.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4726 2.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.5003 1.0233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0267 0.5887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3820 -5.3979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0649 5.0305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8001 4.5959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7200 2.6165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.4795 3.7269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6363 3.4372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1415 2.7613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4 1 1 0 0 0 0 5 2 1 0 0 0 0 6 3 1 0 0 0 0 7 4 1 0 0 0 0 8 5 1 0 0 0 0 9 6 1 0 0 0 0 10 7 1 0 0 0 0 11 8 1 0 0 0 0 12 9 1 0 0 0 0 16 13 1 0 0 0 0 17 14 1 0 0 0 0 18 15 1 0 0 0 0 19 13 1 0 0 0 0 20 14 1 0 0 0 0 21 15 1 0 0 0 0 22 16 1 0 0 0 0 23 17 1 0 0 0 0 24 18 1 0 0 0 0 25 19 1 0 0 0 0 26 20 1 0 0 0 0 27 21 1 0 0 0 0 28 22 1 0 0 0 0 29 23 1 0 0 0 0 30 24 1 0 0 0 0 31 10 1 0 0 0 0 32 11 1 0 0 0 0 33 12 1 0 0 0 0 34 25 2 0 0 0 0 35 26 2 0 0 0 0 36 27 2 0 0 0 0 37 28 1 0 0 0 0 38 29 1 0 0 0 0 39 30 1 0 0 0 0 40 31 1 0 0 0 0 41 32 1 0 0 0 0 42 33 1 0 0 0 0 43 34 1 0 0 0 0 44 35 1 0 0 0 0 45 36 1 0 0 0 0 46 37 1 0 0 0 0 47 38 1 0 0 0 0 48 39 1 0 0 0 0 51 40 1 0 0 0 0 51 43 1 0 0 0 0 52 41 1 0 0 0 0 52 44 1 0 0 0 0 53 42 1 0 0 0 0 53 45 1 0 0 0 0 54 49 1 0 0 0 0 54 50 1 0 0 0 0 55 46 1 0 0 0 0 56 47 1 0 0 0 0 57 48 1 0 0 0 0 58 51 1 0 0 0 0 59 52 1 0 0 0 0 60 53 1 0 0 0 0 61 55 2 0 0 0 0 62 56 2 0 0 0 0 63 57 2 0 0 0 0 64 49 1 0 0 0 0 64 55 1 0 0 0 0 65 50 1 0 0 0 0 65 56 1 0 0 0 0 66 54 1 0 0 0 0 66 57 1 0 0 0 0 M END 3D SDF for NP0337349 (Triricinolein)Mrv2104 05262312582D 66 65 0 0 0 0 999 V2000 23.6814 2.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3217 0.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8733 -8.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.9288 2.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6527 1.4578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7897 -8.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.2599 2.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0999 1.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4587 -7.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.5073 2.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7689 1.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3751 -6.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8279 3.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6190 3.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7165 -1.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7442 4.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3716 3.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3855 -1.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.1589 2.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9500 2.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8001 -2.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.9916 4.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0406 3.4855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3018 -0.3286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2425 2.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1974 3.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1311 -2.9357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3227 4.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7932 3.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9708 0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.8383 1.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5215 1.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0440 -6.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.9951 1.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5284 2.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2147 -3.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5701 4.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4621 3.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8872 0.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.0857 2.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1905 1.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9604 -5.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.6641 2.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6120 1.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5458 -4.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9011 3.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2147 3.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5562 1.4578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7269 4.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3053 3.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4167 1.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9431 1.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6294 -5.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0579 3.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1485 4.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8837 3.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4726 2.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.5003 1.0233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0267 0.5887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3820 -5.3979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0649 5.0305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8001 4.5959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7200 2.6165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.4795 3.7269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6363 3.4372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1415 2.7613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4 1 1 0 0 0 0 5 2 1 0 0 0 0 6 3 1 0 0 0 0 7 4 1 0 0 0 0 8 5 1 0 0 0 0 9 6 1 0 0 0 0 10 7 1 0 0 0 0 11 8 1 0 0 0 0 12 9 1 0 0 0 0 16 13 1 0 0 0 0 17 14 1 0 0 0 0 18 15 1 0 0 0 0 19 13 1 0 0 0 0 20 14 1 0 0 0 0 21 15 1 0 0 0 0 22 16 1 0 0 0 0 23 17 1 0 0 0 0 24 18 1 0 0 0 0 25 19 1 0 0 0 0 26 20 1 0 0 0 0 27 21 1 0 0 0 0 28 22 1 0 0 0 0 29 23 1 0 0 0 0 30 24 1 0 0 0 0 31 10 1 0 0 0 0 32 11 1 0 0 0 0 33 12 1 0 0 0 0 34 25 2 0 0 0 0 35 26 2 0 0 0 0 36 27 2 0 0 0 0 37 28 1 0 0 0 0 38 29 1 0 0 0 0 39 30 1 0 0 0 0 40 31 1 0 0 0 0 41 32 1 0 0 0 0 42 33 1 0 0 0 0 43 34 1 0 0 0 0 44 35 1 0 0 0 0 45 36 1 0 0 0 0 46 37 1 0 0 0 0 47 38 1 0 0 0 0 48 39 1 0 0 0 0 51 40 1 0 0 0 0 51 43 1 0 0 0 0 52 41 1 0 0 0 0 52 44 1 0 0 0 0 53 42 1 0 0 0 0 53 45 1 0 0 0 0 54 49 1 0 0 0 0 54 50 1 0 0 0 0 55 46 1 0 0 0 0 56 47 1 0 0 0 0 57 48 1 0 0 0 0 58 51 1 0 0 0 0 59 52 1 0 0 0 0 60 53 1 0 0 0 0 61 55 2 0 0 0 0 62 56 2 0 0 0 0 63 57 2 0 0 0 0 64 49 1 0 0 0 0 64 55 1 0 0 0 0 65 50 1 0 0 0 0 65 56 1 0 0 0 0 66 54 1 0 0 0 0 66 57 1 0 0 0 0 M END > <DATABASE_ID> NP0337349 > <DATABASE_NAME> NP-MRD > <SMILES> CCCCCCC(O)C\C=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCC\C=C/CC(O)CCCCCC)OC(=O)CCCCCCC\C=C\CC(O)CCCCCC > <INCHI_IDENTIFIER> InChI=1/C57H104O9/c1-4-7-10-31-40-51(58)43-34-25-19-13-16-22-28-37-46-55(61)64-49-54(66-57(63)48-39-30-24-18-15-21-27-36-45-53(60)42-33-12-9-6-3)50-65-56(62)47-38-29-23-17-14-20-26-35-44-52(59)41-32-11-8-5-2/h25-27,34-36,51-54,58-60H,4-24,28-33,37-50H2,1-3H3/b34-25-,35-26-,36-27+ > <INCHI_KEY> ZEMPKEQAKRGZGQ-YAFIDQONNA-N > <FORMULA> C57H104O9 > <MOLECULAR_WEIGHT> 933.45 > <EXACT_MASS> 932.768034929 > <JCHEM_ACCEPTOR_COUNT> 6 > <JCHEM_ATOM_COUNT> 170 > <JCHEM_AVERAGE_POLARIZABILITY> 121.03516418372472 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 3 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-{[(9E)-12-hydroxyoctadec-9-enoyl]oxy}-3-{[(9Z)-12-hydroxyoctadec-9-enoyl]oxy}propyl (9Z)-12-hydroxyoctadec-9-enoate > <JCHEM_LOGP> 16.345639123333335 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 0 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 18.401256348683585 > <JCHEM_PKA_STRONGEST_ACIDIC> 18.401256348683585 > <JCHEM_PKA_STRONGEST_BASIC> -0.8339684132006674 > <JCHEM_POLAR_SURFACE_AREA> 139.58999999999997 > <JCHEM_REFRACTIVITY> 277.25459999999987 > <JCHEM_ROTATABLE_BOND_COUNT> 53 > <JCHEM_RULE_OF_FIVE> 0 > <JCHEM_TRADITIONAL_IUPAC> 2-{[(9E)-12-hydroxyoctadec-9-enoyl]oxy}-3-{[(9Z)-12-hydroxyoctadec-9-enoyl]oxy}propyl (9Z)-12-hydroxyoctadec-9-enoate > <JCHEM_VEBER_RULE> 0 $$$$ PDB for NP0337349 (Triricinolein)HEADER PROTEIN 26-MAY-23 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 26-MAY-23 0 HETATM 1 C UNK 0 44.205 4.253 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -2.467 1.820 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 12.830 -16.745 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 42.800 4.884 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -1.218 2.721 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 12.674 -15.213 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 41.552 3.983 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 0.186 2.090 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 13.923 -14.312 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 40.147 4.614 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 1.435 2.992 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 13.767 -12.780 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 33.279 6.236 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 10.489 6.236 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 18.137 -3.047 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 33.123 7.768 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 11.894 5.605 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 19.386 -2.145 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 32.030 5.335 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 9.240 5.335 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 18.294 -4.579 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 31.718 8.399 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 13.142 6.506 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 19.230 -0.613 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 32.186 3.803 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 7.835 5.965 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 17.045 -5.480 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 30.469 7.498 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 14.547 5.876 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 20.479 0.288 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 38.898 3.713 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 2.840 2.361 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 15.015 -11.879 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 33.591 3.172 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 6.586 5.064 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 17.201 -7.012 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 29.064 8.128 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 15.796 6.777 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 20.323 1.820 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 37.493 4.343 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 4.089 3.262 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 14.859 -10.346 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 34.840 4.073 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 6.742 3.532 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 15.952 -7.913 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 27.815 7.227 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 17.201 6.146 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 21.572 2.721 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 23.757 7.588 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 21.103 7.317 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 36.245 3.442 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 5.494 2.631 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 16.108 -9.445 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 22.508 6.687 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 26.411 7.858 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 18.450 7.047 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 21.416 4.253 0.000 0.00 0.00 C+0 HETATM 58 O UNK 0 36.401 1.910 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 5.650 1.099 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 17.513 -10.076 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 26.254 9.390 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 18.294 8.579 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 20.011 4.884 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 25.162 6.957 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 19.854 6.416 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 22.664 5.154 0.000 0.00 0.00 O+0 CONECT 1 4 CONECT 2 5 CONECT 3 6 CONECT 4 1 7 CONECT 5 2 8 CONECT 6 3 9 CONECT 7 4 10 CONECT 8 5 11 CONECT 9 6 12 CONECT 10 7 31 CONECT 11 8 32 CONECT 12 9 33 CONECT 13 16 19 CONECT 14 17 20 CONECT 15 18 21 CONECT 16 13 22 CONECT 17 14 23 CONECT 18 15 24 CONECT 19 13 25 CONECT 20 14 26 CONECT 21 15 27 CONECT 22 16 28 CONECT 23 17 29 CONECT 24 18 30 CONECT 25 19 34 CONECT 26 20 35 CONECT 27 21 36 CONECT 28 22 37 CONECT 29 23 38 CONECT 30 24 39 CONECT 31 10 40 CONECT 32 11 41 CONECT 33 12 42 CONECT 34 25 43 CONECT 35 26 44 CONECT 36 27 45 CONECT 37 28 46 CONECT 38 29 47 CONECT 39 30 48 CONECT 40 31 51 CONECT 41 32 52 CONECT 42 33 53 CONECT 43 34 51 CONECT 44 35 52 CONECT 45 36 53 CONECT 46 37 55 CONECT 47 38 56 CONECT 48 39 57 CONECT 49 54 64 CONECT 50 54 65 CONECT 51 40 43 58 CONECT 52 41 44 59 CONECT 53 42 45 60 CONECT 54 49 50 66 CONECT 55 46 61 64 CONECT 56 47 62 65 CONECT 57 48 63 66 CONECT 58 51 CONECT 59 52 CONECT 60 53 CONECT 61 55 CONECT 62 56 CONECT 63 57 CONECT 64 49 55 CONECT 65 50 56 CONECT 66 54 57 MASTER 0 0 0 0 0 0 0 0 66 0 130 0 END SMILES for NP0337349 (Triricinolein)CCCCCCC(O)C\C=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCC\C=C/CC(O)CCCCCC)OC(=O)CCCCCCC\C=C\CC(O)CCCCCC INCHI for NP0337349 (Triricinolein)InChI=1/C57H104O9/c1-4-7-10-31-40-51(58)43-34-25-19-13-16-22-28-37-46-55(61)64-49-54(66-57(63)48-39-30-24-18-15-21-27-36-45-53(60)42-33-12-9-6-3)50-65-56(62)47-38-29-23-17-14-20-26-35-44-52(59)41-32-11-8-5-2/h25-27,34-36,51-54,58-60H,4-24,28-33,37-50H2,1-3H3/b34-25-,35-26-,36-27+ 3D Structure for NP0337349 (Triricinolein) | |||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C57H104O9 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 933.4500 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 932.76803 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-{[(9E)-12-hydroxyoctadec-9-enoyl]oxy}-3-{[(9Z)-12-hydroxyoctadec-9-enoyl]oxy}propyl (9Z)-12-hydroxyoctadec-9-enoate | |||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-{[(9E)-12-hydroxyoctadec-9-enoyl]oxy}-3-{[(9Z)-12-hydroxyoctadec-9-enoyl]oxy}propyl (9Z)-12-hydroxyoctadec-9-enoate | |||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CCCCCCC(O)C\C=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCC\C=C/CC(O)CCCCCC)OC(=O)CCCCCCC\C=C\CC(O)CCCCCC | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1/C57H104O9/c1-4-7-10-31-40-51(58)43-34-25-19-13-16-22-28-37-46-55(61)64-49-54(66-57(63)48-39-30-24-18-15-21-27-36-45-53(60)42-33-12-9-6-3)50-65-56(62)47-38-29-23-17-14-20-26-35-44-52(59)41-32-11-8-5-2/h25-27,34-36,51-54,58-60H,4-24,28-33,37-50H2,1-3H3/b34-25-,35-26-,36-27+ | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | ZEMPKEQAKRGZGQ-YAFIDQONNA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Shift Submissions | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species of Origin | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
FoodDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Ricinolein | |||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|