| Record Information |
|---|
| Version | 2.0 |
|---|
| Created at | 2024-09-11 07:18:53 UTC |
|---|
| Updated at | 2024-09-11 07:18:54 UTC |
|---|
| NP-MRD ID | NP0336663 |
|---|
| Secondary Accession Numbers | None |
|---|
| Natural Product Identification |
|---|
| Common Name | Quinacridone |
|---|
| Description | Quinacridone, also known as cinquasia red or monastral red, belongs to the class of organic compounds known as pyridoacridines. Pyridoacridines are compounds containing a pyridoacridine ring system, which consists of a pyridine fused to an acridine. Quinacridone is an extremely weak basic (essentially neutral) compound (based on its pKa). Quinacridone is a red powder. Quinacridone is a fda approved colourant for food-contact paper and board packaging Quinacridone is a red powder. |
|---|
| Structure | O=C1C2=CC=CC=C2NC2=CC3=C(NC4=CC=CC=C4C3=O)C=C12 InChI=1S/C20H12N2O2/c23-19-11-5-1-3-7-15(11)21-17-10-14-18(9-13(17)19)22-16-8-4-2-6-12(16)20(14)24/h1-10H,(H,21,23)(H,22,24) |
|---|
| Synonyms | | Value | Source |
|---|
| 5,12-Dihydro-quino(2,3,b)acridine-7,14-dione | HMDB | | 5,12-Dihydro-quino(2,3-b)acridine-7,14-dione | HMDB | | 5,12-Dihydro-quino[2,3-b]acridine-7,14-dione | HMDB | | 5,12-Dihydroquino(2,3-b)acridine-7,14-dione | HMDB | | 5,12-Dihydroquino[2,3-b]acridine-7,14-dione | HMDB | | C.I. pigment violet 19 | HMDB | | CI pigment red 122 | HMDB | | CI pigment violet 19 | HMDB | | Cinquasia b-RT 796D | HMDB | | Cinquasia red | HMDB | | Cinquasia red b | HMDB | | Cinquasia red y | HMDB | | Cinquasia red y-RT 759D | HMDB | | Cinquasia violet | HMDB | | Cinquasia violet R | HMDB | | Cinquasia violet R-RT 791D | HMDB | | Dark violet | HMDB | | e 3b Red | HMDB | | Fastogen super red BN | HMDB | | Fastogen super red ye | HMDB | | Hostaperm red e 3b | HMDB | | Hostaperm red e 5b | HMDB | | Hostaperm red e5b | HMDB | | Hostaperm red violet er | HMDB | | Hostaperm red violet er 02 | HMDB | | Hostapern red violet er | HMDB | | Lin-trans-quinacridone | HMDB | | Linear quinacridone | HMDB | | Linear trans quinacridone | HMDB | | Monastral red | HMDB | | Monastral red b | HMDB | | Monastral red y | HMDB | | Monastral violet 4R | HMDB | | Monastral violet R | HMDB | | Monastrol red y | HMDB | | Paliogen red BG | HMDB | | Permanent magenta | HMDB | | Permanent red e 3b | HMDB | | Permanent red e 5b | HMDB | | Permanent red e3b | HMDB | | Permanent red e5b | HMDB | | Pigment pink quinacridone S | HMDB | | Pigment quinacridone red | HMDB | | Pigment violet #19 | HMDB | | Pigment violet 19 | HMDB | | Pigment violet quinacridone | HMDB | | PV Fast red e 3b | HMDB | | PV Fast red e 5b | HMDB | | PV Fast red e3b | HMDB | | PV Fast red e5b | HMDB | | PV-Fast red e3b | HMDB | | PV-Fast red e5b | HMDB | | Quinaccridone | HMDB | | Quinacridone red | HMDB | | Quinacridone red MC | HMDB | | Quinacridone violet | HMDB | | Quinacridone violet MC | HMDB | | Red e 3b | HMDB | | Sunfast red 19 | HMDB | | Sunfast violet | HMDB |
|
|---|
| Chemical Formula | C20H12N2O2 |
|---|
| Average Mass | 312.3215 Da |
|---|
| Monoisotopic Mass | 312.08988 Da |
|---|
| IUPAC Name | 5,7,12,14-tetrahydro-5,12-diazapentacene-7,14-dione |
|---|
| Traditional Name | quinacridone |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | O=C1C2=CC=CC=C2NC2=CC3=C(NC4=CC=CC=C4C3=O)C=C12 |
|---|
| InChI Identifier | InChI=1S/C20H12N2O2/c23-19-11-5-1-3-7-15(11)21-17-10-14-18(9-13(17)19)22-16-8-4-2-6-12(16)20(14)24/h1-10H,(H,21,23)(H,22,24) |
|---|
| InChI Key | NRCMAYZCPIVABH-UHFFFAOYSA-N |
|---|
| Experimental Spectra |
|---|
|
| Not Available | | Predicted Spectra |
|---|
|
| Not Available | | Chemical Shift Submissions |
|---|
|
| Not Available | | Species |
|---|
| Species of Origin | Not Available |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as pyridoacridines. Pyridoacridines are compounds containing a pyridoacridine ring system, which consists of a pyridine fused to an acridine. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Quinolines and derivatives |
|---|
| Sub Class | Benzoquinolines |
|---|
| Direct Parent | Pyridoacridines |
|---|
| Alternative Parents | |
|---|
| Substituents | - Pyridoacridine
- Acridone
- Dihydroquinolone
- Dihydroquinoline
- Pyridine
- Benzenoid
- Heteroaromatic compound
- Vinylogous amide
- Azacycle
- Organic nitrogen compound
- Hydrocarbon derivative
- Organic oxide
- Organooxygen compound
- Organonitrogen compound
- Organopnictogen compound
- Organic oxygen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|