Showing NP-Card for (2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide (NP0335847)
Record Information | ||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | |||||||||||||||
Created at | 2024-09-11 03:31:24 UTC | |||||||||||||||
Updated at | 2024-09-11 03:31:24 UTC | |||||||||||||||
NP-MRD ID | NP0335847 | |||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||
Natural Product Identification | ||||||||||||||||
Common Name | (2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide | |||||||||||||||
Description | Based on a literature review very few articles have been published on (2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide. | |||||||||||||||
Structure | MOL for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide)Mrv2104 05262306032D 58 64 0 0 0 0 999 V2000 1.6052 6.8294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9672 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1762 2.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1515 1.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5383 4.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2528 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3196 5.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2528 1.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5383 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3196 4.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8907 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6051 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8907 5.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6817 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4630 1.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6051 6.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1762 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8907 4.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3962 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4630 2.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2527 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9672 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1775 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1775 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2540 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2540 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4630 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5396 1.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5396 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3962 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5396 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7485 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8251 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2120 1.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3196 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9672 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1762 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5383 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6817 1.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6052 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1775 1.4669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1106 3.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8920 2.7044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8920 4.3544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9685 1.8794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9685 3.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4630 5.1794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5396 1.0544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8251 4.7669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2541 4.7669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0245 1.3907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9299 0.4721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3196 3.1169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7486 3.1169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8251 3.1169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1106 1.8794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0341 4.3544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5383 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6 5 1 0 0 0 0 9 8 1 0 0 0 0 10 7 1 0 0 0 0 12 11 1 0 0 0 0 16 1 2 0 0 0 0 16 7 1 0 0 0 0 16 13 1 0 0 0 0 17 5 2 0 0 0 0 18 13 1 0 0 0 0 18 17 1 0 0 0 0 19 14 1 0 0 0 0 20 15 1 0 0 0 0 21 6 1 0 0 0 0 22 8 1 0 0 0 0 23 20 1 0 0 0 0 24 23 1 0 0 0 0 26 25 1 0 0 0 0 27 24 1 0 0 0 0 28 25 1 0 0 0 0 29 26 1 0 0 0 0 30 19 1 0 0 0 0 31 29 1 0 0 0 0 32 27 1 0 0 0 0 33 28 1 0 0 0 0 36 2 1 0 0 0 0 36 14 1 0 0 0 0 36 21 1 0 0 0 0 36 22 1 0 0 0 0 37 3 1 0 0 0 0 37 11 1 0 0 0 0 37 17 1 0 0 0 0 38 9 1 0 0 0 0 38 21 1 0 0 0 0 38 37 1 0 0 0 0 39 4 1 0 0 0 0 39 22 1 0 0 0 0 39 30 1 0 0 0 0 39 34 1 0 0 0 0 40 10 1 0 0 0 0 40 12 1 0 0 0 0 40 18 1 0 0 0 0 40 35 1 0 0 0 0 41 15 1 0 0 0 0 42 19 1 0 0 0 0 43 23 1 0 0 0 0 44 24 1 0 0 0 0 45 25 1 0 0 0 0 46 26 1 0 0 0 0 47 27 1 0 0 0 0 48 28 1 0 0 0 0 49 31 2 0 0 0 0 50 31 1 0 0 0 0 51 34 2 0 0 0 0 52 34 1 0 0 0 0 53 35 2 0 0 0 0 54 20 1 0 0 0 0 54 32 1 0 0 0 0 55 29 1 0 0 0 0 55 33 1 0 0 0 0 56 30 1 0 0 0 0 56 33 1 0 0 0 0 57 32 1 0 0 0 0 57 35 1 0 0 0 0 38 58 1 0 0 0 0 M END 3D MOL for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide)3D SDF for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide)Mrv2104 05262306032D 58 64 0 0 0 0 999 V2000 1.6052 6.8294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9672 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1762 2.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1515 1.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5383 4.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2528 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3196 5.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2528 1.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5383 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3196 4.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8907 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6051 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8907 5.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6817 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4630 1.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6051 6.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1762 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8907 4.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3962 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4630 2.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2527 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9672 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1775 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1775 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2540 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2540 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4630 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5396 1.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5396 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3962 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5396 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7485 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8251 2.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2120 1.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3196 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9672 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1762 3.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5383 3.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6817 1.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6052 4.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1775 1.4669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1106 3.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8920 2.7044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8920 4.3544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9685 1.8794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9685 3.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4630 5.1794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5396 1.0544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8251 4.7669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2541 4.7669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0245 1.3907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9299 0.4721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3196 3.1169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7486 3.1169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8251 3.1169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1106 1.8794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0341 4.3544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5383 3.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6 5 1 0 0 0 0 9 8 1 0 0 0 0 10 7 1 0 0 0 0 12 11 1 0 0 0 0 16 1 2 0 0 0 0 16 7 1 0 0 0 0 16 13 1 0 0 0 0 17 5 2 0 0 0 0 18 13 1 0 0 0 0 18 17 1 0 0 0 0 19 14 1 0 0 0 0 20 15 1 0 0 0 0 21 6 1 0 0 0 0 22 8 1 0 0 0 0 23 20 1 0 0 0 0 24 23 1 0 0 0 0 26 25 1 0 0 0 0 27 24 1 0 0 0 0 28 25 1 0 0 0 0 29 26 1 0 0 0 0 30 19 1 0 0 0 0 31 29 1 0 0 0 0 32 27 1 0 0 0 0 33 28 1 0 0 0 0 36 2 1 0 0 0 0 36 14 1 0 0 0 0 36 21 1 0 0 0 0 36 22 1 0 0 0 0 37 3 1 0 0 0 0 37 11 1 0 0 0 0 37 17 1 0 0 0 0 38 9 1 0 0 0 0 38 21 1 0 0 0 0 38 37 1 0 0 0 0 39 4 1 0 0 0 0 39 22 1 0 0 0 0 39 30 1 0 0 0 0 39 34 1 0 0 0 0 40 10 1 0 0 0 0 40 12 1 0 0 0 0 40 18 1 0 0 0 0 40 35 1 0 0 0 0 41 15 1 0 0 0 0 42 19 1 0 0 0 0 43 23 1 0 0 0 0 44 24 1 0 0 0 0 45 25 1 0 0 0 0 46 26 1 0 0 0 0 47 27 1 0 0 0 0 48 28 1 0 0 0 0 49 31 2 0 0 0 0 50 31 1 0 0 0 0 51 34 2 0 0 0 0 52 34 1 0 0 0 0 53 35 2 0 0 0 0 54 20 1 0 0 0 0 54 32 1 0 0 0 0 55 29 1 0 0 0 0 55 33 1 0 0 0 0 56 30 1 0 0 0 0 56 33 1 0 0 0 0 57 32 1 0 0 0 0 57 35 1 0 0 0 0 38 58 1 0 0 0 0 M END > <DATABASE_ID> NP0335847 > <DATABASE_NAME> NP-MRD > <SMILES> CC12CC(O)C(OC3OC(C(O)C(O)C3O)C(O)=O)C(C)(C1CCC1(C)C2CC=C2C3CC(=C)CCC3(CCC12C)C(=O)OC1OC(CO)C(O)C(O)C1O)C(O)=O > <INCHI_IDENTIFIER> InChI=1/C41H60O17/c1-17-8-11-41(36(54)58-33-28(48)25(45)24(44)21(16-42)55-33)13-12-38(3)18(19(41)14-17)6-7-22-37(2)15-20(43)31(40(5,35(52)53)23(37)9-10-39(22,38)4)57-34-29(49)26(46)27(47)30(56-34)32(50)51/h6,19-31,33-34,42-49H,1,7-16H2,2-5H3,(H,50,51)(H,52,53) > <INCHI_KEY> UDJQXYVUQBGNDM-UHFFFAOYNA-N > <FORMULA> C41H60O17 > <MOLECULAR_WEIGHT> 824.914 > <EXACT_MASS> 824.383050472 > <JCHEM_ACCEPTOR_COUNT> 16 > <JCHEM_ATOM_COUNT> 118 > <JCHEM_AVERAGE_POLARIZABILITY> 86.1053297124915 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 10 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 6-{[4-carboxy-2-hydroxy-4,6a,6b,14b-tetramethyl-11-methylidene-8a-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}carbonyl)-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid > <JCHEM_LOGP> 0.34530029333333434 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 7 > <JCHEM_PHYSIOLOGICAL_CHARGE> -2 > <JCHEM_PKA> 4.224303357784965 > <JCHEM_PKA_STRONGEST_ACIDIC> 3.253998946850897 > <JCHEM_PKA_STRONGEST_BASIC> -3.6790186048825926 > <JCHEM_POLAR_SURFACE_AREA> 290.43 > <JCHEM_REFRACTIVITY> 196.71750000000011 > <JCHEM_ROTATABLE_BOND_COUNT> 8 > <JCHEM_RULE_OF_FIVE> 0 > <JCHEM_TRADITIONAL_IUPAC> 6-{[4-carboxy-2-hydroxy-4,6a,6b,14b-tetramethyl-11-methylidene-8a-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}carbonyl)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide)PDB for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide)HEADER PROTEIN 26-MAY-23 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 26-MAY-23 0 HETATM 1 C UNK 0 2.996 12.748 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -3.672 7.358 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 0.329 5.048 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -4.016 2.328 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -1.005 8.898 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -2.339 8.128 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 4.330 10.438 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -2.339 3.508 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -1.005 4.278 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 4.330 8.898 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 1.663 5.818 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 2.996 6.588 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 1.663 10.438 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -5.006 6.588 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 8.331 3.508 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 2.996 11.208 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 0.329 8.128 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 1.663 8.898 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 -6.340 5.818 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 8.331 5.048 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -2.338 6.588 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 -3.672 4.278 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 9.665 5.818 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 9.665 7.358 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 -11.674 4.278 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -11.674 5.818 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 8.331 8.128 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 -10.341 3.508 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -10.341 6.588 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 -6.340 4.278 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -10.341 8.128 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 6.997 7.358 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 -9.007 4.278 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 -5.996 2.328 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 4.330 7.358 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -3.672 5.818 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 0.329 6.588 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 -1.005 5.818 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 -5.006 3.508 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 2.996 8.128 0.000 0.00 0.00 C+0 HETATM 41 O UNK 0 9.665 2.738 0.000 0.00 0.00 O+0 HETATM 42 O UNK 0 -7.673 6.588 0.000 0.00 0.00 O+0 HETATM 43 O UNK 0 10.998 5.048 0.000 0.00 0.00 O+0 HETATM 44 O UNK 0 10.998 8.128 0.000 0.00 0.00 O+0 HETATM 45 O UNK 0 -13.008 3.508 0.000 0.00 0.00 O+0 HETATM 46 O UNK 0 -13.008 6.588 0.000 0.00 0.00 O+0 HETATM 47 O UNK 0 8.331 9.668 0.000 0.00 0.00 O+0 HETATM 48 O UNK 0 -10.341 1.968 0.000 0.00 0.00 O+0 HETATM 49 O UNK 0 -9.007 8.898 0.000 0.00 0.00 O+0 HETATM 50 O UNK 0 -11.674 8.898 0.000 0.00 0.00 O+0 HETATM 51 O UNK 0 -7.512 2.596 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 -5.469 0.881 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 4.330 5.818 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 6.997 5.818 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 -9.007 5.818 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 -7.673 3.508 0.000 0.00 0.00 O+0 HETATM 57 O UNK 0 5.664 8.128 0.000 0.00 0.00 O+0 HETATM 58 C UNK 0 -1.005 7.358 0.000 0.00 0.00 C+0 CONECT 1 16 CONECT 2 36 CONECT 3 37 CONECT 4 39 CONECT 5 6 17 CONECT 6 5 21 CONECT 7 10 16 CONECT 8 9 22 CONECT 9 8 38 CONECT 10 7 40 CONECT 11 12 37 CONECT 12 11 40 CONECT 13 16 18 CONECT 14 19 36 CONECT 15 20 41 CONECT 16 1 7 13 CONECT 17 5 18 37 CONECT 18 13 17 40 CONECT 19 14 30 42 CONECT 20 15 23 54 CONECT 21 6 36 38 CONECT 22 8 36 39 CONECT 23 20 24 43 CONECT 24 23 27 44 CONECT 25 26 28 45 CONECT 26 25 29 46 CONECT 27 24 32 47 CONECT 28 25 33 48 CONECT 29 26 31 55 CONECT 30 19 39 56 CONECT 31 29 49 50 CONECT 32 27 54 57 CONECT 33 28 55 56 CONECT 34 39 51 52 CONECT 35 40 53 57 CONECT 36 2 14 21 22 CONECT 37 3 11 17 38 CONECT 38 9 21 37 58 CONECT 39 4 22 30 34 CONECT 40 10 12 18 35 CONECT 41 15 CONECT 42 19 CONECT 43 23 CONECT 44 24 CONECT 45 25 CONECT 46 26 CONECT 47 27 CONECT 48 28 CONECT 49 31 CONECT 50 31 CONECT 51 34 CONECT 52 34 CONECT 53 35 CONECT 54 20 32 CONECT 55 29 33 CONECT 56 30 33 CONECT 57 32 35 CONECT 58 38 MASTER 0 0 0 0 0 0 0 0 58 0 128 0 END 3D PDB for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide)SMILES for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide)CC12CC(O)C(OC3OC(C(O)C(O)C3O)C(O)=O)C(C)(C1CCC1(C)C2CC=C2C3CC(=C)CCC3(CCC12C)C(=O)OC1OC(CO)C(O)C(O)C1O)C(O)=O INCHI for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide)InChI=1/C41H60O17/c1-17-8-11-41(36(54)58-33-28(48)25(45)24(44)21(16-42)55-33)13-12-38(3)18(19(41)14-17)6-7-22-37(2)15-20(43)31(40(5,35(52)53)23(37)9-10-39(22,38)4)57-34-29(49)26(46)27(47)30(56-34)32(50)51/h6,19-31,33-34,42-49H,1,7-16H2,2-5H3,(H,50,51)(H,52,53) Structure for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide)3D Structure for NP0335847 ((2b,3b)-Dihydroxy-30-nor-12,20(29)-oleanadiene-28-glucopyranosyloxy-23-oic acid 3-glucuronide) | |||||||||||||||
Synonyms |
| |||||||||||||||
Chemical Formula | C41H60O17 | |||||||||||||||
Average Mass | 824.9140 Da | |||||||||||||||
Monoisotopic Mass | 824.38305 Da | |||||||||||||||
IUPAC Name | Not Available | |||||||||||||||
Traditional Name | Not Available | |||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||
SMILES | CC12CC(O)C(OC3OC(C(O)C(O)C3O)C(O)=O)C(C)(C1CCC1(C)C2CC=C2C3CC(=C)CCC3(CCC12C)C(=O)OC1OC(CO)C(O)C(O)C1O)C(O)=O | |||||||||||||||
InChI Identifier | InChI=1/C41H60O17/c1-17-8-11-41(36(54)58-33-28(48)25(45)24(44)21(16-42)55-33)13-12-38(3)18(19(41)14-17)6-7-22-37(2)15-20(43)31(40(5,35(52)53)23(37)9-10-39(22,38)4)57-34-29(49)26(46)27(47)30(56-34)32(50)51/h6,19-31,33-34,42-49H,1,7-16H2,2-5H3,(H,50,51)(H,52,53) | |||||||||||||||
InChI Key | UDJQXYVUQBGNDM-UHFFFAOYNA-N | |||||||||||||||
Experimental Spectra | ||||||||||||||||
Not Available | ||||||||||||||||
Predicted Spectra | ||||||||||||||||
Not Available | ||||||||||||||||
Chemical Shift Submissions | ||||||||||||||||
Not Available | ||||||||||||||||
Species | ||||||||||||||||
Species of Origin | Not Available | |||||||||||||||
Chemical Taxonomy | ||||||||||||||||
Classification | Not classified | |||||||||||||||
Physical Properties | ||||||||||||||||
State | Not Available | |||||||||||||||
Experimental Properties |
| |||||||||||||||
Predicted Properties |
| |||||||||||||||
External Links | ||||||||||||||||
HMDB ID | Not Available | |||||||||||||||
DrugBank ID | Not Available | |||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||
FoodDB ID | Not Available | |||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||
Chemspider ID | Not Available | |||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||
BioCyc ID | Not Available | |||||||||||||||
BiGG ID | Not Available | |||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||
METLIN ID | Not Available | |||||||||||||||
PubChem Compound | Not Available | |||||||||||||||
PDB ID | Not Available | |||||||||||||||
ChEBI ID | Not Available | |||||||||||||||
Good Scents ID | Not Available | |||||||||||||||
References | ||||||||||||||||
General References | Not Available |