Showing NP-Card for Quinquenoside IV (NP0335676)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Created at | 2024-09-11 02:42:12 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
Updated at | 2024-09-11 02:42:12 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
NP-MRD ID | NP0335676 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||
Natural Product Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Quinquenoside IV | |||||||||||||||||||||||||||||||||||||||||||||||||||
Description | It was first documented in 2015 (PMID: 25737370). Based on a literature review very few articles have been published on Quinquenoside IV. | |||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for NP0335676 (Quinquenoside IV)Mrv2104 05262305142D 78 85 0 0 0 0 999 V2000 -3.5763 -1.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5761 -1.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8615 -2.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1472 -1.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1474 -1.0882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8620 -0.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4326 -2.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7182 -1.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7185 -1.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4331 -0.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0041 -0.6751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0044 0.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7189 0.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4333 0.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7806 -0.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2653 -0.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7802 0.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2486 -3.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4740 -3.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0349 1.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8196 0.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9914 0.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7761 -0.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9478 -0.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7325 -1.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3349 -1.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1476 -0.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7110 -0.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0036 -2.3251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2904 -2.3264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7192 1.3872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2896 1.9745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0060 -1.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2502 1.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0965 2.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3512 2.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1582 3.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7104 2.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4557 1.7051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6487 1.5333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0079 1.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8148 1.2639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5173 2.6615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4129 3.8874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7990 3.5439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0050 -1.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7194 -2.3268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4340 -1.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4342 -1.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7199 -0.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0053 -1.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1483 -2.3272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8629 -1.9149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1488 -0.6772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2909 -0.6764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7201 0.1482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2912 0.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0058 0.5609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0060 1.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2917 1.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5771 1.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5768 0.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7206 1.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7209 2.6232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8622 0.1491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8627 1.7991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2919 2.6236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3670 0.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1739 0.8227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7261 0.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4714 -0.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6645 -0.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1123 -0.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3054 -0.3055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4098 -1.5314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0237 -1.1878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5331 0.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0853 -0.2314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 1 0 0 0 0 2 3 1 0 0 0 0 2 30 1 0 0 0 0 3 4 1 0 0 0 0 3 18 1 0 0 0 0 3 19 1 0 0 0 0 4 5 1 0 0 0 0 4 7 2 0 0 0 0 5 6 1 0 0 0 0 5 10 1 0 0 0 0 5 27 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 8 29 1 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 9 28 1 0 0 0 0 10 14 1 0 0 0 0 11 12 1 0 0 0 0 11 15 1 0 0 0 0 11 33 1 0 0 0 0 12 13 1 0 0 0 0 12 17 1 0 0 0 0 13 14 1 0 0 0 0 13 31 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 20 1 0 0 0 0 20 21 1 0 0 0 0 20 32 1 0 0 0 0 20 34 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 24 25 1 0 0 0 0 24 26 1 0 0 0 0 30 46 1 0 0 0 0 32 35 1 0 0 0 0 35 36 1 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 36 45 1 0 0 0 0 37 38 1 0 0 0 0 37 44 1 0 0 0 0 38 39 1 0 0 0 0 38 43 1 0 0 0 0 39 40 1 0 0 0 0 39 41 1 0 0 0 0 41 42 1 0 0 0 0 42 68 1 0 0 0 0 46 47 1 0 0 0 0 46 51 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 48 52 1 0 0 0 0 49 50 1 0 0 0 0 49 54 1 0 0 0 0 50 51 1 0 0 0 0 50 56 1 0 0 0 0 51 55 1 0 0 0 0 52 53 1 0 0 0 0 55 57 1 0 0 0 0 57 58 1 0 0 0 0 57 62 1 0 0 0 0 58 59 1 0 0 0 0 59 60 1 0 0 0 0 59 63 1 0 0 0 0 60 61 1 0 0 0 0 60 67 1 0 0 0 0 61 62 1 0 0 0 0 61 66 1 0 0 0 0 62 65 1 0 0 0 0 63 64 1 0 0 0 0 68 69 1 0 0 0 0 68 73 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 70 77 1 0 0 0 0 71 72 1 0 0 0 0 71 76 1 0 0 0 0 72 73 1 0 0 0 0 72 75 1 0 0 0 0 73 74 1 0 0 0 0 77 78 1 0 0 0 0 M END 3D SDF for NP0335676 (Quinquenoside IV)Mrv2104 05262305142D 78 85 0 0 0 0 999 V2000 -3.5763 -1.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5761 -1.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8615 -2.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1472 -1.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1474 -1.0882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8620 -0.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4326 -2.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7182 -1.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7185 -1.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4331 -0.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0041 -0.6751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0044 0.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7189 0.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4333 0.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7806 -0.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2653 -0.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7802 0.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2486 -3.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4740 -3.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0349 1.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8196 0.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9914 0.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7761 -0.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9478 -0.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7325 -1.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3349 -1.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1476 -0.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7110 -0.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0036 -2.3251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2904 -2.3264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7192 1.3872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2896 1.9745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0060 -1.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2502 1.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0965 2.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3512 2.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1582 3.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7104 2.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4557 1.7051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6487 1.5333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0079 1.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8148 1.2639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5173 2.6615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4129 3.8874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7990 3.5439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0050 -1.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7194 -2.3268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4340 -1.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4342 -1.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7199 -0.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0053 -1.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1483 -2.3272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8629 -1.9149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1488 -0.6772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2909 -0.6764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7201 0.1482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2912 0.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0058 0.5609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0060 1.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2917 1.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5771 1.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5768 0.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7206 1.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7209 2.6232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8622 0.1491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8627 1.7991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2919 2.6236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3670 0.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1739 0.8227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7261 0.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4714 -0.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6645 -0.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1123 -0.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3054 -0.3055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4098 -1.5314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0237 -1.1878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5331 0.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0853 -0.2314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 1 0 0 0 0 2 3 1 0 0 0 0 2 30 1 0 0 0 0 3 4 1 0 0 0 0 3 18 1 0 0 0 0 3 19 1 0 0 0 0 4 5 1 0 0 0 0 4 7 2 0 0 0 0 5 6 1 0 0 0 0 5 10 1 0 0 0 0 5 27 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 8 29 1 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 9 28 1 0 0 0 0 10 14 1 0 0 0 0 11 12 1 0 0 0 0 11 15 1 0 0 0 0 11 33 1 0 0 0 0 12 13 1 0 0 0 0 12 17 1 0 0 0 0 13 14 1 0 0 0 0 13 31 1 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 20 1 0 0 0 0 20 21 1 0 0 0 0 20 32 1 0 0 0 0 20 34 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 24 25 1 0 0 0 0 24 26 1 0 0 0 0 30 46 1 0 0 0 0 32 35 1 0 0 0 0 35 36 1 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 36 45 1 0 0 0 0 37 38 1 0 0 0 0 37 44 1 0 0 0 0 38 39 1 0 0 0 0 38 43 1 0 0 0 0 39 40 1 0 0 0 0 39 41 1 0 0 0 0 41 42 1 0 0 0 0 42 68 1 0 0 0 0 46 47 1 0 0 0 0 46 51 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 48 52 1 0 0 0 0 49 50 1 0 0 0 0 49 54 1 0 0 0 0 50 51 1 0 0 0 0 50 56 1 0 0 0 0 51 55 1 0 0 0 0 52 53 1 0 0 0 0 55 57 1 0 0 0 0 57 58 1 0 0 0 0 57 62 1 0 0 0 0 58 59 1 0 0 0 0 59 60 1 0 0 0 0 59 63 1 0 0 0 0 60 61 1 0 0 0 0 60 67 1 0 0 0 0 61 62 1 0 0 0 0 61 66 1 0 0 0 0 62 65 1 0 0 0 0 63 64 1 0 0 0 0 68 69 1 0 0 0 0 68 73 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 70 77 1 0 0 0 0 71 72 1 0 0 0 0 71 76 1 0 0 0 0 72 73 1 0 0 0 0 72 75 1 0 0 0 0 73 74 1 0 0 0 0 77 78 1 0 0 0 0 M END > <DATABASE_ID> NP0335676 > <DATABASE_NAME> NP-MRD > <SMILES> CC(C)=CCCC(C)(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C(C)(C)C3=CC(O)C21C > <INCHI_IDENTIFIER> InChI=1/C54H90O24/c1-22(2)10-9-13-53(7,78-48-44(70)40(66)37(63)28(75-48)21-71-46-42(68)38(64)34(60)25(18-55)72-46)23-11-15-52(6)33(23)24(58)16-30-51(5)14-12-32(50(3,4)29(51)17-31(59)54(30,52)8)76-49-45(41(67)36(62)27(20-57)74-49)77-47-43(69)39(65)35(61)26(19-56)73-47/h10,17,23-28,30-49,55-70H,9,11-16,18-21H2,1-8H3 > <INCHI_KEY> SKOMPTIDEDWVJD-UHFFFAOYNA-N > <FORMULA> C54H90O24 > <MOLECULAR_WEIGHT> 1123.29 > <EXACT_MASS> 1122.582203778 > <JCHEM_ACCEPTOR_COUNT> 24 > <JCHEM_ATOM_COUNT> 168 > <JCHEM_AVERAGE_POLARIZABILITY> 120.00405984722923 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 16 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-{[2-(7-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-4,11-dihydroxy-3a,3b,6,6,9a-pentamethyl-1H,2H,3H,3aH,3bH,4H,6H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-1-yl)-6-methylhept-5-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol > <JCHEM_LOGP> -3.031887865999999 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 8 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 12.185134392681638 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.751605934101548 > <JCHEM_PKA_STRONGEST_BASIC> -3.6486743743922125 > <JCHEM_POLAR_SURFACE_AREA> 397.5200000000001 > <JCHEM_REFRACTIVITY> 269.1006 > <JCHEM_ROTATABLE_BOND_COUNT> 16 > <JCHEM_RULE_OF_FIVE> 0 > <JCHEM_TRADITIONAL_IUPAC> 2-{[2-(7-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-4,11-dihydroxy-3a,3b,6,6,9a-pentamethyl-1H,2H,3H,4H,7H,8H,9H,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-1-yl)-6-methylhept-5-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol > <JCHEM_VEBER_RULE> 0 $$$$ PDB for NP0335676 (Quinquenoside IV)HEADER PROTEIN 26-MAY-23 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 26-MAY-23 0 HETATM 1 C UNK 0 -6.676 -2.032 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -6.675 -3.572 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -5.341 -4.342 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -4.008 -3.571 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -4.008 -2.031 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -5.342 -1.262 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 -2.674 -4.341 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -1.341 -3.571 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -1.341 -2.031 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -2.675 -1.261 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -0.008 -1.260 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -0.008 0.280 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -1.342 1.049 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -2.675 0.279 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 1.457 -1.736 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 2.362 -0.489 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 1.456 0.756 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 -6.064 -5.702 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 -4.618 -5.701 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 1.932 2.221 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 3.397 1.746 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 3.717 0.239 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 5.182 -0.236 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 5.503 -1.743 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 6.967 -2.218 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 4.358 -2.773 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -4.009 -0.491 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 -1.327 -0.490 0.000 0.00 0.00 C+0 HETATM 29 O UNK 0 -0.007 -4.340 0.000 0.00 0.00 O+0 HETATM 30 O UNK 0 -8.009 -4.343 0.000 0.00 0.00 O+0 HETATM 31 O UNK 0 -1.343 2.589 0.000 0.00 0.00 O+0 HETATM 32 O UNK 0 2.407 3.686 0.000 0.00 0.00 O+0 HETATM 33 C UNK 0 -0.011 -2.792 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 0.467 2.696 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 3.913 4.006 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 4.389 5.471 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 5.895 5.792 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 6.926 4.648 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 6.451 3.183 0.000 0.00 0.00 C+0 HETATM 40 O UNK 0 4.944 2.862 0.000 0.00 0.00 O+0 HETATM 41 C UNK 0 7.481 2.039 0.000 0.00 0.00 C+0 HETATM 42 O UNK 0 8.988 2.359 0.000 0.00 0.00 O+0 HETATM 43 O UNK 0 8.432 4.968 0.000 0.00 0.00 O+0 HETATM 44 O UNK 0 6.371 7.256 0.000 0.00 0.00 O+0 HETATM 45 O UNK 0 3.358 6.615 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 -9.343 -3.573 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 -10.676 -4.343 0.000 0.00 0.00 O+0 HETATM 48 C UNK 0 -12.010 -3.574 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 -12.011 -2.034 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -10.677 -1.263 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -9.343 -2.033 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 -13.343 -4.344 0.000 0.00 0.00 C+0 HETATM 53 O UNK 0 -14.677 -3.574 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 -13.344 -1.264 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 -8.010 -1.263 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 -10.678 0.277 0.000 0.00 0.00 O+0 HETATM 57 C UNK 0 -8.010 0.277 0.000 0.00 0.00 C+0 HETATM 58 O UNK 0 -9.344 1.047 0.000 0.00 0.00 O+0 HETATM 59 C UNK 0 -9.345 2.587 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 -8.011 3.357 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 -6.677 2.588 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 -6.677 1.048 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 -10.678 3.357 0.000 0.00 0.00 C+0 HETATM 64 O UNK 0 -10.679 4.897 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 -5.343 0.278 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 -5.344 3.358 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 -8.012 4.897 0.000 0.00 0.00 O+0 HETATM 68 C UNK 0 10.018 1.215 0.000 0.00 0.00 C+0 HETATM 69 O UNK 0 11.525 1.536 0.000 0.00 0.00 O+0 HETATM 70 C UNK 0 12.555 0.392 0.000 0.00 0.00 C+0 HETATM 71 C UNK 0 12.080 -1.073 0.000 0.00 0.00 C+0 HETATM 72 C UNK 0 10.574 -1.394 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 9.543 -0.250 0.000 0.00 0.00 C+0 HETATM 74 O UNK 0 8.037 -0.570 0.000 0.00 0.00 O+0 HETATM 75 O UNK 0 10.098 -2.859 0.000 0.00 0.00 O+0 HETATM 76 O UNK 0 13.111 -2.217 0.000 0.00 0.00 O+0 HETATM 77 C UNK 0 14.062 0.712 0.000 0.00 0.00 C+0 HETATM 78 O UNK 0 15.093 -0.432 0.000 0.00 0.00 O+0 CONECT 1 2 6 CONECT 2 1 3 30 CONECT 3 2 4 18 19 CONECT 4 3 5 7 CONECT 5 4 6 10 27 CONECT 6 1 5 CONECT 7 4 8 CONECT 8 7 9 29 CONECT 9 8 10 11 28 CONECT 10 5 9 14 CONECT 11 9 12 15 33 CONECT 12 11 13 17 CONECT 13 12 14 31 CONECT 14 10 13 CONECT 15 11 16 CONECT 16 15 17 CONECT 17 12 16 20 CONECT 18 3 CONECT 19 3 CONECT 20 17 21 32 34 CONECT 21 20 22 CONECT 22 21 23 CONECT 23 22 24 CONECT 24 23 25 26 CONECT 25 24 CONECT 26 24 CONECT 27 5 CONECT 28 9 CONECT 29 8 CONECT 30 2 46 CONECT 31 13 CONECT 32 20 35 CONECT 33 11 CONECT 34 20 CONECT 35 32 36 40 CONECT 36 35 37 45 CONECT 37 36 38 44 CONECT 38 37 39 43 CONECT 39 38 40 41 CONECT 40 35 39 CONECT 41 39 42 CONECT 42 41 68 CONECT 43 38 CONECT 44 37 CONECT 45 36 CONECT 46 30 47 51 CONECT 47 46 48 CONECT 48 47 49 52 CONECT 49 48 50 54 CONECT 50 49 51 56 CONECT 51 46 50 55 CONECT 52 48 53 CONECT 53 52 CONECT 54 49 CONECT 55 51 57 CONECT 56 50 CONECT 57 55 58 62 CONECT 58 57 59 CONECT 59 58 60 63 CONECT 60 59 61 67 CONECT 61 60 62 66 CONECT 62 57 61 65 CONECT 63 59 64 CONECT 64 63 CONECT 65 62 CONECT 66 61 CONECT 67 60 CONECT 68 42 69 73 CONECT 69 68 70 CONECT 70 69 71 77 CONECT 71 70 72 76 CONECT 72 71 73 75 CONECT 73 68 72 74 CONECT 74 73 CONECT 75 72 CONECT 76 71 CONECT 77 70 78 CONECT 78 77 MASTER 0 0 0 0 0 0 0 0 78 0 170 0 END SMILES for NP0335676 (Quinquenoside IV)CC(C)=CCCC(C)(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C(C)(C)C3=CC(O)C21C INCHI for NP0335676 (Quinquenoside IV)InChI=1/C54H90O24/c1-22(2)10-9-13-53(7,78-48-44(70)40(66)37(63)28(75-48)21-71-46-42(68)38(64)34(60)25(18-55)72-46)23-11-15-52(6)33(23)24(58)16-30-51(5)14-12-32(50(3,4)29(51)17-31(59)54(30,52)8)76-49-45(41(67)36(62)27(20-57)74-49)77-47-43(69)39(65)35(61)26(19-56)73-47/h10,17,23-28,30-49,55-70H,9,11-16,18-21H2,1-8H3 3D Structure for NP0335676 (Quinquenoside IV) | |||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C54H90O24 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 1123.2900 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 1122.58220 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-{[2-(7-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-4,11-dihydroxy-3a,3b,6,6,9a-pentamethyl-1H,2H,3H,3aH,3bH,4H,6H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-1-yl)-6-methylhept-5-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-{[2-(7-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-4,11-dihydroxy-3a,3b,6,6,9a-pentamethyl-1H,2H,3H,4H,7H,8H,9H,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-1-yl)-6-methylhept-5-en-2-yl]oxy}-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol | |||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(C)=CCCC(C)(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)C(C)(C)C3=CC(O)C21C | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1/C54H90O24/c1-22(2)10-9-13-53(7,78-48-44(70)40(66)37(63)28(75-48)21-71-46-42(68)38(64)34(60)25(18-55)72-46)23-11-15-52(6)33(23)24(58)16-30-51(5)14-12-32(50(3,4)29(51)17-31(59)54(30,52)8)76-49-45(41(67)36(62)27(20-57)74-49)77-47-43(69)39(65)35(61)26(19-56)73-47/h10,17,23-28,30-49,55-70H,9,11-16,18-21H2,1-8H3 | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | SKOMPTIDEDWVJD-UHFFFAOYNA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Shift Submissions | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species of Origin | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
FoodDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|