Showing NP-Card for Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside) (NP0335653)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Created at | 2024-09-11 02:36:08 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
Updated at | 2024-09-11 02:36:09 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
NP-MRD ID | NP0335653 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||
Natural Product Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside) | |||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Based on a literature review very few articles have been published on Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside). | |||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside))Mrv2104 05262305082D 72 78 0 0 0 0 999 V2000 2.1429 -2.6806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4279 -3.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 -2.6820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 -3.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 -3.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -4.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -1.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -2.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4293 -3.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4293 -3.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1443 -4.3306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 -4.3306 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0 1.4279 -3.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 -4.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -3.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5717 -4.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 -5.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -5.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5717 -5.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2867 -5.5682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 -1.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4293 -1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1443 -1.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8580 -1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8580 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1443 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4293 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1443 0.6195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5730 -0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5730 -1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2866 -1.4430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4279 -1.4444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4279 -0.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 -0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -0.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -1.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5717 -1.8570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5717 -0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 0.6181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 -0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 0.6181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 0.6181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 2.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 3.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 3.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 4.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 4.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4293 4.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4279 3.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 5.5682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2867 -1.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2867 -0.6194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0018 -0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0018 -1.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0018 -2.6820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4304 -1.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4304 -0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0018 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 1.0320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0016 -1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7167 -1.4430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0016 -2.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7167 -3.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7167 -3.9181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4304 -2.6806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 4.7432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 5.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 21 1 0 0 0 0 2 3 2 0 0 0 0 2 13 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 8 2 0 0 0 0 5 6 2 0 0 0 0 5 12 1 0 0 0 0 6 10 1 0 0 0 0 7 8 1 0 0 0 0 7 22 1 0 0 0 0 8 9 1 0 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 12 13 2 0 0 0 0 13 14 1 0 0 0 0 14 15 2 0 0 0 0 14 17 1 0 0 0 0 15 16 1 0 0 0 0 16 19 2 0 0 0 0 17 18 2 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 21 33 1 0 0 0 0 21 37 1 0 0 0 0 22 23 1 0 0 0 0 22 27 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 24 31 1 0 0 0 0 25 26 1 0 0 0 0 25 30 1 0 0 0 0 26 27 1 0 0 0 0 26 29 1 0 0 0 0 27 28 1 0 0 0 0 31 32 1 0 0 0 0 32 65 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 34 41 1 0 0 0 0 35 36 1 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 36 39 1 0 0 0 0 37 38 1 0 0 0 0 38 54 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 43 45 2 0 0 0 0 44 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 47 52 1 0 0 0 0 48 49 1 0 0 0 0 49 50 2 0 0 0 0 50 51 1 0 0 0 0 50 53 1 0 0 0 0 51 52 2 0 0 0 0 51 71 1 0 0 0 0 54 55 1 0 0 0 0 54 59 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 56 63 1 0 0 0 0 57 58 1 0 0 0 0 57 62 1 0 0 0 0 58 59 1 0 0 0 0 58 61 1 0 0 0 0 59 60 1 0 0 0 0 63 64 1 0 0 0 0 65 66 2 0 0 0 0 65 67 1 0 0 0 0 67 68 1 0 0 0 0 68 69 2 0 0 0 0 68 70 1 0 0 0 0 71 72 1 0 0 0 0 M CHG 1 12 1 M END 3D MOL for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside))3D SDF for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside))Mrv2104 05262305082D 72 78 0 0 0 0 999 V2000 2.1429 -2.6806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4279 -3.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 -2.6820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 -3.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 -3.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -4.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -1.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -2.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4293 -3.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4293 -3.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1443 -4.3306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 -4.3306 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0 1.4279 -3.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 -4.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -3.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5717 -4.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 -5.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -5.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5717 -5.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2867 -5.5682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 -1.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4293 -1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1443 -1.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8580 -1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8580 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1443 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4293 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1443 0.6195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5730 -0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5730 -1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2866 -1.4430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4279 -1.4444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4279 -0.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 -0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -0.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -1.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5717 -1.8570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5717 -0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 0.6181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 -0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 0.6181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 0.6181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 2.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 3.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 3.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0007 4.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 4.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4293 4.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4279 3.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7143 5.5682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2867 -1.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2867 -0.6194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0018 -0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 -1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0018 -1.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0018 -2.6820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4304 -1.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4304 -0.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0018 0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7154 1.0320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0016 -1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7167 -1.4430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0016 -2.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7167 -3.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7167 -3.9181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4304 -2.6806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 4.7432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1429 5.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 21 1 0 0 0 0 2 3 2 0 0 0 0 2 13 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 4 8 2 0 0 0 0 5 6 2 0 0 0 0 5 12 1 0 0 0 0 6 10 1 0 0 0 0 7 8 1 0 0 0 0 7 22 1 0 0 0 0 8 9 1 0 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 12 13 2 0 0 0 0 13 14 1 0 0 0 0 14 15 2 0 0 0 0 14 17 1 0 0 0 0 15 16 1 0 0 0 0 16 19 2 0 0 0 0 17 18 2 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 21 33 1 0 0 0 0 21 37 1 0 0 0 0 22 23 1 0 0 0 0 22 27 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 24 31 1 0 0 0 0 25 26 1 0 0 0 0 25 30 1 0 0 0 0 26 27 1 0 0 0 0 26 29 1 0 0 0 0 27 28 1 0 0 0 0 31 32 1 0 0 0 0 32 65 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 34 41 1 0 0 0 0 35 36 1 0 0 0 0 35 40 1 0 0 0 0 36 37 1 0 0 0 0 36 39 1 0 0 0 0 37 38 1 0 0 0 0 38 54 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 43 45 2 0 0 0 0 44 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 47 52 1 0 0 0 0 48 49 1 0 0 0 0 49 50 2 0 0 0 0 50 51 1 0 0 0 0 50 53 1 0 0 0 0 51 52 2 0 0 0 0 51 71 1 0 0 0 0 54 55 1 0 0 0 0 54 59 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 56 63 1 0 0 0 0 57 58 1 0 0 0 0 57 62 1 0 0 0 0 58 59 1 0 0 0 0 58 61 1 0 0 0 0 59 60 1 0 0 0 0 63 64 1 0 0 0 0 65 66 2 0 0 0 0 65 67 1 0 0 0 0 67 68 1 0 0 0 0 68 69 2 0 0 0 0 68 70 1 0 0 0 0 71 72 1 0 0 0 0 M CHG 1 12 1 M END > <DATABASE_ID> NP0335653 > <DATABASE_NAME> NP-MRD > <SMILES> COC1=CC(\C=C\C(=O)OCC2OC(OC3=CC4=C(OC5OC(COC(=O)CC(O)=O)C(O)C(O)C5O)C=C(O)C=C4[O+]=C3C3=CC=C(O)C=C3)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)=CC=C1O > <INCHI_IDENTIFIER> InChI=1/C46H50O26/c1-63-26-10-18(2-8-23(26)50)3-9-32(53)64-16-30-36(57)39(60)43(72-45-41(62)37(58)34(55)28(15-47)69-45)46(71-30)68-27-13-22-24(66-42(27)19-4-6-20(48)7-5-19)11-21(49)12-25(22)67-44-40(61)38(59)35(56)29(70-44)17-65-33(54)14-31(51)52/h2-13,28-30,34-41,43-47,55-62H,14-17H2,1H3,(H3-,48,49,50,51,52,53)/p+1 > <INCHI_KEY> XGPCPGROCKPKCA-UHFFFAOYNA-O > <FORMULA> C46H51O26 > <MOLECULAR_WEIGHT> 1019.887 > <EXACT_MASS> 1019.266308182 > <JCHEM_ACCEPTOR_COUNT> 24 > <JCHEM_ATOM_COUNT> 123 > <JCHEM_AVERAGE_POLARIZABILITY> 97.33910977071992 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 13 > <JCHEM_FORMAL_CHARGE> 1 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 5-[(6-{[(2-carboxyacetyl)oxy]methyl}-3,4,5-trihydroxyoxan-2-yl)oxy]-3-{[4,5-dihydroxy-6-({[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}methyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-7-hydroxy-2-(4-hydroxyphenyl)-1lambda4-chromen-1-ylium > <JCHEM_LOGP> -0.6591000000000027 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 7 > <JCHEM_PHYSIOLOGICAL_CHARGE> -1 > <JCHEM_PKA> 6.659928422169025 > <JCHEM_PKA_STRONGEST_ACIDIC> 3.3242250173354897 > <JCHEM_PKA_STRONGEST_BASIC> -3.6789660047085033 > <JCHEM_POLAR_SURFACE_AREA> 410.4100000000001 > <JCHEM_REFRACTIVITY> 242.3417000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 19 > <JCHEM_RULE_OF_FIVE> 0 > <JCHEM_TRADITIONAL_IUPAC> 5-[(6-{[(2-carboxyacetyl)oxy]methyl}-3,4,5-trihydroxyoxan-2-yl)oxy]-3-{[4,5-dihydroxy-6-({[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}methyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-7-hydroxy-2-(4-hydroxyphenyl)-1lambda4-chromen-1-ylium > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside))PDB for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside))HEADER PROTEIN 26-MAY-23 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 26-MAY-23 0 HETATM 1 O UNK 0 4.000 -5.004 0.000 0.00 0.00 O+0 HETATM 2 C UNK 0 2.665 -5.776 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 1.333 -5.006 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -0.001 -5.774 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -0.001 -7.314 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -1.333 -8.084 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 -1.333 -3.464 0.000 0.00 0.00 O+0 HETATM 8 C UNK 0 -1.333 -5.004 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -2.668 -5.774 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -2.668 -7.314 0.000 0.00 0.00 C+0 HETATM 11 O UNK 0 -4.003 -8.084 0.000 0.00 0.00 O+0 HETATM 12 O UNK 0 1.333 -8.084 0.000 0.00 0.00 O+1 HETATM 13 C UNK 0 2.665 -7.314 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 4.000 -8.084 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 5.335 -7.314 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 6.667 -8.084 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 4.000 -9.624 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 5.335 -10.394 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 6.667 -9.624 0.000 0.00 0.00 C+0 HETATM 20 O UNK 0 8.002 -10.394 0.000 0.00 0.00 O+0 HETATM 21 C UNK 0 4.000 -3.466 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 -2.668 -2.694 0.000 0.00 0.00 C+0 HETATM 23 O UNK 0 -4.003 -3.464 0.000 0.00 0.00 O+0 HETATM 24 C UNK 0 -5.335 -2.694 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 -5.335 -1.154 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 -4.003 -0.384 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -2.668 -1.154 0.000 0.00 0.00 C+0 HETATM 28 O UNK 0 -1.333 -0.384 0.000 0.00 0.00 O+0 HETATM 29 O UNK 0 -4.003 1.156 0.000 0.00 0.00 O+0 HETATM 30 O UNK 0 -6.670 -0.384 0.000 0.00 0.00 O+0 HETATM 31 C UNK 0 -6.670 -3.464 0.000 0.00 0.00 C+0 HETATM 32 O UNK 0 -8.002 -2.694 0.000 0.00 0.00 O+0 HETATM 33 O UNK 0 2.665 -2.696 0.000 0.00 0.00 O+0 HETATM 34 C UNK 0 2.665 -1.156 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 4.000 -0.386 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 5.335 -1.156 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 5.335 -2.696 0.000 0.00 0.00 C+0 HETATM 38 O UNK 0 6.667 -3.466 0.000 0.00 0.00 O+0 HETATM 39 O UNK 0 6.667 -0.384 0.000 0.00 0.00 O+0 HETATM 40 O UNK 0 4.000 1.154 0.000 0.00 0.00 O+0 HETATM 41 C UNK 0 1.333 -0.386 0.000 0.00 0.00 C+0 HETATM 42 O UNK 0 1.333 1.154 0.000 0.00 0.00 O+0 HETATM 43 C UNK 0 -0.001 1.924 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 -0.001 3.464 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 -1.333 1.154 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 1.333 4.234 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 1.333 5.774 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 -0.001 6.544 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 -0.001 8.086 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 1.333 8.857 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 2.668 8.086 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 2.665 6.544 0.000 0.00 0.00 C+0 HETATM 53 O UNK 0 1.333 10.394 0.000 0.00 0.00 O+0 HETATM 54 C UNK 0 8.002 -2.696 0.000 0.00 0.00 C+0 HETATM 55 O UNK 0 8.002 -1.156 0.000 0.00 0.00 O+0 HETATM 56 C UNK 0 9.337 -0.386 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 10.669 -1.154 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 10.669 -2.694 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 9.337 -3.466 0.000 0.00 0.00 C+0 HETATM 60 O UNK 0 9.337 -5.006 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 12.003 -3.464 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 12.003 -0.384 0.000 0.00 0.00 O+0 HETATM 63 C UNK 0 9.337 1.156 0.000 0.00 0.00 C+0 HETATM 64 O UNK 0 10.669 1.926 0.000 0.00 0.00 O+0 HETATM 65 C UNK 0 -9.336 -3.464 0.000 0.00 0.00 C+0 HETATM 66 O UNK 0 -10.671 -2.694 0.000 0.00 0.00 O+0 HETATM 67 C UNK 0 -9.336 -5.004 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 -10.671 -5.774 0.000 0.00 0.00 C+0 HETATM 69 O UNK 0 -10.671 -7.314 0.000 0.00 0.00 O+0 HETATM 70 O UNK 0 -12.003 -5.004 0.000 0.00 0.00 O+0 HETATM 71 O UNK 0 4.000 8.854 0.000 0.00 0.00 O+0 HETATM 72 C UNK 0 4.000 10.394 0.000 0.00 0.00 C+0 CONECT 1 2 21 CONECT 2 1 3 13 CONECT 3 2 4 CONECT 4 3 5 8 CONECT 5 4 6 12 CONECT 6 5 10 CONECT 7 8 22 CONECT 8 4 7 9 CONECT 9 8 10 CONECT 10 6 9 11 CONECT 11 10 CONECT 12 5 13 CONECT 13 2 12 14 CONECT 14 13 15 17 CONECT 15 14 16 CONECT 16 15 19 CONECT 17 14 18 CONECT 18 17 19 CONECT 19 16 18 20 CONECT 20 19 CONECT 21 1 33 37 CONECT 22 7 23 27 CONECT 23 22 24 CONECT 24 23 25 31 CONECT 25 24 26 30 CONECT 26 25 27 29 CONECT 27 22 26 28 CONECT 28 27 CONECT 29 26 CONECT 30 25 CONECT 31 24 32 CONECT 32 31 65 CONECT 33 21 34 CONECT 34 33 35 41 CONECT 35 34 36 40 CONECT 36 35 37 39 CONECT 37 21 36 38 CONECT 38 37 54 CONECT 39 36 CONECT 40 35 CONECT 41 34 42 CONECT 42 41 43 CONECT 43 42 44 45 CONECT 44 43 46 CONECT 45 43 CONECT 46 44 47 CONECT 47 46 48 52 CONECT 48 47 49 CONECT 49 48 50 CONECT 50 49 51 53 CONECT 51 50 52 71 CONECT 52 47 51 CONECT 53 50 CONECT 54 38 55 59 CONECT 55 54 56 CONECT 56 55 57 63 CONECT 57 56 58 62 CONECT 58 57 59 61 CONECT 59 54 58 60 CONECT 60 59 CONECT 61 58 CONECT 62 57 CONECT 63 56 64 CONECT 64 63 CONECT 65 32 66 67 CONECT 66 65 CONECT 67 65 68 CONECT 68 67 69 70 CONECT 69 68 CONECT 70 68 CONECT 71 51 72 CONECT 72 71 MASTER 0 0 0 0 0 0 0 0 72 0 156 0 END 3D PDB for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside))SMILES for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside))COC1=CC(\C=C\C(=O)OCC2OC(OC3=CC4=C(OC5OC(COC(=O)CC(O)=O)C(O)C(O)C5O)C=C(O)C=C4[O+]=C3C3=CC=C(O)C=C3)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)=CC=C1O INCHI for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside))InChI=1/C46H50O26/c1-63-26-10-18(2-8-23(26)50)3-9-32(53)64-16-30-36(57)39(60)43(72-45-41(62)37(58)34(55)28(15-47)69-45)46(71-30)68-27-13-22-24(66-42(27)19-4-6-20(48)7-5-19)11-21(49)12-25(22)67-44-40(61)38(59)35(56)29(70-44)17-65-33(54)14-31(51)52/h2-13,28-30,34-41,43-47,55-62H,14-17H2,1H3,(H3-,48,49,50,51,52,53)/p+1 Structure for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside))3D Structure for NP0335653 (Pelargonidin 3-O-[b-D-Glucopyranosyl-(1->2)-[4-hydroxy-3-methoxy-(E)-cinnamoyl-(->6)]-b-D-glucopyranoside] 5-O-(6-O-malonyl-b-D-glucopyranoside)) | |||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C46H51O26 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 1019.8870 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 1019.26631 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 5-[(6-{[(2-carboxyacetyl)oxy]methyl}-3,4,5-trihydroxyoxan-2-yl)oxy]-3-{[4,5-dihydroxy-6-({[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}methyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-7-hydroxy-2-(4-hydroxyphenyl)-1lambda4-chromen-1-ylium | |||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 5-[(6-{[(2-carboxyacetyl)oxy]methyl}-3,4,5-trihydroxyoxan-2-yl)oxy]-3-{[4,5-dihydroxy-6-({[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}methyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-7-hydroxy-2-(4-hydroxyphenyl)-1lambda4-chromen-1-ylium | |||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | COC1=CC(\C=C\C(=O)OCC2OC(OC3=CC4=C(OC5OC(COC(=O)CC(O)=O)C(O)C(O)C5O)C=C(O)C=C4[O+]=C3C3=CC=C(O)C=C3)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)=CC=C1O | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1/C46H50O26/c1-63-26-10-18(2-8-23(26)50)3-9-32(53)64-16-30-36(57)39(60)43(72-45-41(62)37(58)34(55)28(15-47)69-45)46(71-30)68-27-13-22-24(66-42(27)19-4-6-20(48)7-5-19)11-21(49)12-25(22)67-44-40(61)38(59)35(56)29(70-44)17-65-33(54)14-31(51)52/h2-13,28-30,34-41,43-47,55-62H,14-17H2,1H3,(H3-,48,49,50,51,52,53)/p+1 | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | XGPCPGROCKPKCA-UHFFFAOYNA-O | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Shift Submissions | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species of Origin | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
FoodDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |