| Record Information |
|---|
| Version | 2.0 |
|---|
| Created at | 2024-09-10 19:37:19 UTC |
|---|
| Updated at | 2024-09-10 19:37:19 UTC |
|---|
| NP-MRD ID | NP0334708 |
|---|
| Secondary Accession Numbers | None |
|---|
| Natural Product Identification |
|---|
| Common Name | (R)-3-amino-2-methylpropanoate |
|---|
| Description | (R)-beta-Aminoisobutyric acid, also known as (R)-b-aminoisobutyrate or (R)-3-amino-2-methylpropanoate, belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom (R)-beta-Aminoisobutyric acid is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral (R)-beta-Aminoisobutyric acid exists in all living organisms, ranging from bacteria to humans. Outside of the human body, (R)-beta-Aminoisobutyric acid has been detected, but not quantified in, several different foods, such as wild rices, turmerics, cashew nuts, evergreen huckleberries, and moth beans. This could make (R)-beta-aminoisobutyric acid a potential biomarker for the consumption of these foods. The (R)-enantiomer of 3-aminoisobutyric acid. |
|---|
| Structure | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| (R)-3-Amino-2-methylpropanoate | ChEBI | | D-3-Amino-isobutanoate | ChEBI | | (R)-3-Aminoisobutyrate | Kegg | | D-3-Aminoisobutanoate | Kegg | | (R)-beta-Aminoisobutyrate | Kegg | | (R)-3-Amino-2-methylpropanoic acid | Generator | | D-3-Amino-isobutanoic acid | Generator | | (R)-3-Aminoisobutyric acid | Generator | | D-3-Aminoisobutanoic acid | Generator | | (R)-b-Aminoisobutyrate | Generator | | (R)-b-Aminoisobutyric acid | Generator | | (R)-Β-aminoisobutyrate | Generator | | (R)-Β-aminoisobutyric acid | Generator | | (2R)-3-Amino-2-methylpropanoic acid | HMDB | | (2R)-3-Amino-2-methylpropanoate | HMDB | | (R)-b-Amino-isobutyrate | HMDB | | (-)-b-Aminoisobutyrate | HMDB | | (-)-b-Aminoisobutyric acid | HMDB | | (-)-beta-Aminoisobutyrate | HMDB | | (-)-beta-Aminoisobutyric acid | HMDB | | (2R)-3-Amino-2-methyl-propanoate | HMDB | | (2R)-3-Amino-2-methyl-propanoic acid | HMDB | | (R)-3-Amino-2-methyl-propanoate | HMDB | | (R)-3-Amino-2-methyl-propanoic acid | HMDB | | D-2-Methyl-b-alanine | HMDB | | D-3-Amino-2-methylpropanoate | HMDB | | D-3-Amino-2-methylpropanoic acid | HMDB | | D-3-Amino-2-methylpropionate | HMDB | | D-3-Amino-2-methylpropionic acid | HMDB | | D-b-Aminoisobutyrate | HMDB | | D-b-Aminoisobutyric acid | HMDB | | delta-2-Methyl-beta-alanine | HMDB | | delta-3-Amino-2-methylpropanoate | HMDB | | delta-3-Amino-2-methylpropanoic acid | HMDB | | delta-3-Amino-2-methylpropionate | HMDB | | delta-3-Amino-2-methylpropionic acid | HMDB | | delta-beta-Aminoisobutyrate | HMDB | | delta-beta-Aminoisobutyric acid | HMDB | | R-b-Aminoisobutyrate | HMDB | | R-beta-Aminoisobutyrate | HMDB | | (R)-beta-Aminoisobutyric acid | ChEBI |
|
|---|
| Chemical Formula | C4H9NO2 |
|---|
| Average Mass | 103.1198 Da |
|---|
| Monoisotopic Mass | 103.06333 Da |
|---|
| IUPAC Name | (2R)-3-amino-2-methylpropanoic acid |
|---|
| Traditional Name | (R)-β-aminoisobutyric acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | C[C@H](CN)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1 |
|---|
| InChI Key | QCHPKSFMDHPSNR-GSVOUGTGSA-N |
|---|
| Experimental Spectra |
|---|
|
| Not Available | | Predicted Spectra |
|---|
|
| Not Available | | Chemical Shift Submissions |
|---|
|
| Not Available | | Species |
|---|
| Species of Origin | Not Available |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Carboxylic acids and derivatives |
|---|
| Sub Class | Amino acids, peptides, and analogues |
|---|
| Direct Parent | Beta amino acids and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Beta amino acid or derivatives
- Amino acid
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Amine
- Organic oxide
- Hydrocarbon derivative
- Primary amine
- Organooxygen compound
- Organonitrogen compound
- Organopnictogen compound
- Primary aliphatic amine
- Organic oxygen compound
- Carbonyl group
- Organic nitrogen compound
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|