Description | Eicosapentaenoic acid, also known as icosapent or cis-5,8,11,14,17-epa, belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Eicosapentaenoic acid is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. Within humans, eicosapentaenoic acid participates in a number of enzymatic reactions. In particular, eicosapentaenoic acid can be biosynthesized from cis-8,11,14,17-eicosatetraenoic acid through its interaction with the enzyme fatty acid desaturase 1. In addition, eicosapentaenoic acid can be converted into docosapentaenoic acid (22N-3); which is catalyzed by the enzyme elongation OF very long chain fatty acids protein 5. In humans, eicosapentaenoic acid is involved in alpha linolenic acid and linoleic acid metabolism. Outside of the human body, Eicosapentaenoic acid has been detected, but not quantified in, several different foods, such as common hazelnuts, rowanberries, irish moss, wax apples, and tamarinds. This could make eicosapentaenoic acid a potential biomarker for the consumption of these foods. Eicosapentaenoic acid, with regard to humans, has been found to be associated with several diseases such as hypertension, essential hypertension, colorectal cancer, and major depressive disorder; eicosapentaenoic acid has also been linked to the inborn metabolic disorder isovaleric acidemia. It was first documented in 1996 (PMID: 8635279). An icosapentaenoic acid having five cis-double bonds at positions 5, 8, 11, 14 and 17 (PMID: 8704924) (PMID: 15930517) (PMID: 12384078) (PMID: 16872308). |
---|
Structure | CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,16-15- |
---|
Synonyms | Value | Source |
---|
(5Z,8Z,11Z,14Z,17Z)-5,8,11,14,17-Eicosapentaenoic acid | ChEBI | (5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoate | ChEBI | (5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoic acid | ChEBI | (5Z,8Z,11Z,14Z,17Z)-Icosapentaenoic acid | ChEBI | (all-Z)-5,8,11,14,17-Eicosapentaenoic acid | ChEBI | 5,8,11,14,17-EICOSAPENTAENOIC ACID | ChEBI | 5,8,11,14,17-Icosapentaenoic acid | ChEBI | all-cis-5,8,11,14,17-Eicosapentaenoic acid | ChEBI | all-cis-Icosa-5,8,11,14,17-pentaenoic acid | ChEBI | cis, cis, cis, cis, cis-Eicosa-5,8,11,14,17-pentaenoic acid | ChEBI | cis-5,8,11,14,17-Eicosapentaenoic acid | ChEBI | cis-5,8,11,14,17-EPA | ChEBI | cis-Delta(5,8,11,14,17)-Eicosapentaenoic acid | ChEBI | EPA | ChEBI | Icosapent | ChEBI | Icosapentaenoic acid | ChEBI | Icosapento | ChEBI | Icosapentum | ChEBI | Timnodonic acid | ChEBI | (5Z,8Z,11Z,14Z,17Z)-Icosapentaenoate | Kegg | 5Z,8Z,11Z,14Z,17Z-Eicosapentaenoic acid | Kegg | (5Z,8Z,11Z,14Z,17Z)-Icosa-5,8,11,14,17-pentaenoic acid | Kegg | (5Z,8Z,11Z,14Z,17Z)-5,8,11,14,17-Eicosapentaenoate | Generator | (all-Z)-5,8,11,14,17-Eicosapentaenoate | Generator | 5,8,11,14,17-EICOSAPENTAENOate | Generator | 5,8,11,14,17-Icosapentaenoate | Generator | all-cis-5,8,11,14,17-Eicosapentaenoate | Generator | all-cis-Icosa-5,8,11,14,17-pentaenoate | Generator | cis, cis, cis, cis, cis-Eicosa-5,8,11,14,17-pentaenoate | Generator | cis-5,8,11,14,17-Eicosapentaenoate | Generator | cis-delta(5,8,11,14,17)-Eicosapentaenoate | Generator | cis-Δ(5,8,11,14,17)-eicosapentaenoate | Generator | cis-Δ(5,8,11,14,17)-eicosapentaenoic acid | Generator | Icosapentaenoate | Generator | Timnodonate | Generator | 5Z,8Z,11Z,14Z,17Z-Eicosapentaenoate | Generator | (5Z,8Z,11Z,14Z,17Z)-Icosa-5,8,11,14,17-pentaenoate | Generator | Eicosapentaenoate | Generator | Omega-3-eicosapentaenoic acid | HMDB | Acid, eicosapentanoic | HMDB | Eicosapentanoic acid | HMDB | Omega 3 eicosapentaenoic acid | HMDB | all-cis-Icosapentaenoate | HMDB | all-cis-Icosapentaenoic acid | HMDB | (5Z,8Z,11Z,14Z,17Z)-Eicosa-5,8,11,14,17-pentaenoic acid | HMDB | (all-Z)-delta5,8,11,14,17-Eicosapentaenoic acid | HMDB | (all-Z)-Δ5,8,11,14,17-eicosapentaenoic acid | HMDB | (all-cis)-5,8,11,14,17-Eicosapentaenoic acid | HMDB | FA(20:5(5Z,8Z,11Z,14Z,17Z)) | HMDB | FA(20:5n3) | HMDB | Eicosapentaenoic acid | HMDB |
|
---|