Showing NP-Card for 2-Hydroxypropyl starch (NP0333939)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Created at | 2024-09-09 21:21:09 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
Updated at | 2024-09-09 21:21:09 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
NP-MRD ID | NP0333939 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||
Natural Product Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | 2-Hydroxypropyl starch | |||||||||||||||||||||||||||||||||||||||||||||||||||
Description | It is used in food processing including stabiliser, thickener, moisture control agent, flavour modifier, release agent, handling and firming agent. | |||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for NP0333939 (2-Hydroxypropyl starch)Mrv2104 05242323532D 53 56 0 0 0 0 999 V2000 3.5724 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1612 -1.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -6.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -6.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9862 -3.1895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -6.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 11 1 0 0 0 0 2 31 1 0 0 0 0 3 44 1 0 0 0 0 4 45 1 0 0 0 0 5 12 1 0 0 0 0 5 32 1 0 0 0 0 6 13 1 0 0 0 0 6 33 1 0 0 0 0 7 14 1 0 0 0 0 7 34 1 0 0 0 0 8 15 1 0 0 0 0 8 46 1 0 0 0 0 9 31 1 0 0 0 0 9 35 1 0 0 0 0 10 31 1 0 0 0 0 10 47 1 0 0 0 0 11 16 1 0 0 0 0 11 48 1 0 0 0 0 12 23 1 0 0 0 0 12 49 1 0 0 0 0 13 24 1 0 0 0 0 13 50 1 0 0 0 0 14 25 1 0 0 0 0 14 48 1 0 0 0 0 15 26 1 0 0 0 0 15 51 1 0 0 0 0 16 17 1 0 0 0 0 16 36 1 0 0 0 0 17 25 1 0 0 0 0 17 37 1 0 0 0 0 18 20 1 0 0 0 0 18 23 1 0 0 0 0 18 38 1 0 0 0 0 19 21 1 0 0 0 0 19 26 1 0 0 0 0 19 39 1 0 0 0 0 20 28 1 0 0 0 0 20 40 1 0 0 0 0 21 29 1 0 0 0 0 21 41 1 0 0 0 0 22 24 1 0 0 0 0 22 27 1 0 0 0 0 22 42 1 0 0 0 0 23 44 1 0 0 0 0 24 45 1 0 0 0 0 25 52 1 0 0 0 0 26 53 1 0 0 0 0 27 30 1 0 0 0 0 27 47 1 0 0 0 0 28 46 1 0 0 0 0 28 49 1 0 0 0 0 29 51 1 0 0 0 0 29 52 1 0 0 0 0 30 50 1 0 0 0 0 30 53 1 0 0 0 0 31 43 1 0 0 0 0 M END 3D SDF for NP0333939 (2-Hydroxypropyl starch)Mrv2104 05242323532D 53 56 0 0 0 0 999 V2000 3.5724 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1612 -1.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -6.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -6.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9862 -3.1895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -6.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 11 1 0 0 0 0 2 31 1 0 0 0 0 3 44 1 0 0 0 0 4 45 1 0 0 0 0 5 12 1 0 0 0 0 5 32 1 0 0 0 0 6 13 1 0 0 0 0 6 33 1 0 0 0 0 7 14 1 0 0 0 0 7 34 1 0 0 0 0 8 15 1 0 0 0 0 8 46 1 0 0 0 0 9 31 1 0 0 0 0 9 35 1 0 0 0 0 10 31 1 0 0 0 0 10 47 1 0 0 0 0 11 16 1 0 0 0 0 11 48 1 0 0 0 0 12 23 1 0 0 0 0 12 49 1 0 0 0 0 13 24 1 0 0 0 0 13 50 1 0 0 0 0 14 25 1 0 0 0 0 14 48 1 0 0 0 0 15 26 1 0 0 0 0 15 51 1 0 0 0 0 16 17 1 0 0 0 0 16 36 1 0 0 0 0 17 25 1 0 0 0 0 17 37 1 0 0 0 0 18 20 1 0 0 0 0 18 23 1 0 0 0 0 18 38 1 0 0 0 0 19 21 1 0 0 0 0 19 26 1 0 0 0 0 19 39 1 0 0 0 0 20 28 1 0 0 0 0 20 40 1 0 0 0 0 21 29 1 0 0 0 0 21 41 1 0 0 0 0 22 24 1 0 0 0 0 22 27 1 0 0 0 0 22 42 1 0 0 0 0 23 44 1 0 0 0 0 24 45 1 0 0 0 0 25 52 1 0 0 0 0 26 53 1 0 0 0 0 27 30 1 0 0 0 0 27 47 1 0 0 0 0 28 46 1 0 0 0 0 28 49 1 0 0 0 0 29 51 1 0 0 0 0 29 52 1 0 0 0 0 30 50 1 0 0 0 0 30 53 1 0 0 0 0 31 43 1 0 0 0 0 M END > <DATABASE_ID> NP0333939 > <DATABASE_NAME> NP-MRD > <SMILES> COC1C(O)C(O)C(OCC2OC(OC3C(O)C(O)C(C)OC3CO)C(O)C(O)C2OC2OC(CO)C(OC)C(O)C2OCC(C)(O)CO)OC1CO > <INCHI_IDENTIFIER> InChI=1/C31H56O22/c1-11-16(36)17(37)25(14(7-34)48-11)52-29-21(41)19(39)26(15(51-29)8-46-28-20(40)18(38)23(44-3)12(5-32)49-28)53-30-27(47-10-31(2,43)9-35)22(42)24(45-4)13(6-33)50-30/h11-30,32-43H,5-10H2,1-4H3 > <INCHI_KEY> VYIPQJQYDCRXMM-UHFFFAOYNA-N > <FORMULA> C31H56O22 > <MOLECULAR_WEIGHT> 780.767 > <EXACT_MASS> 780.326323443 > <JCHEM_ACCEPTOR_COUNT> 22 > <JCHEM_ATOM_COUNT> 109 > <JCHEM_AVERAGE_POLARIZABILITY> 78.15441299015117 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 12 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 5-[(5-{[3-(2,3-dihydroxy-2-methylpropoxy)-4-hydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy}-6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy}methyl)-3,4-dihydroxyoxan-2-yl)oxy]-6-(hydroxymethyl)-2-methyloxane-3,4-diol > <JCHEM_LOGP> -6.574727963333334 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 4 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 12.330511100317587 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.868232664872542 > <JCHEM_PKA_STRONGEST_BASIC> -3.442521778608573 > <JCHEM_POLAR_SURFACE_AREA> 335.0600000000001 > <JCHEM_REFRACTIVITY> 167.69880000000003 > <JCHEM_ROTATABLE_BOND_COUNT> 16 > <JCHEM_RULE_OF_FIVE> 0 > <JCHEM_TRADITIONAL_IUPAC> 5-[(5-{[3-(2,3-dihydroxy-2-methylpropoxy)-4-hydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy}-6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy}methyl)-3,4-dihydroxyoxan-2-yl)oxy]-6-(hydroxymethyl)-2-methyloxane-3,4-diol > <JCHEM_VEBER_RULE> 0 $$$$ PDB for NP0333939 (2-Hydroxypropyl starch)HEADER PROTEIN 24-MAY-23 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 24-MAY-23 0 HETATM 1 C UNK 0 6.668 3.850 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 15.234 -3.286 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 18.672 1.540 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 10.669 -12.320 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 17.338 -0.770 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 9.336 -10.010 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 4.001 -0.770 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 12.003 -2.310 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 17.338 -3.850 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 14.670 -5.390 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 6.668 2.310 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 16.004 -0.000 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 10.669 -9.240 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 5.335 -0.000 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 10.669 -3.080 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 8.002 1.540 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 8.002 -0.000 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 14.670 2.310 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 9.336 -5.390 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 13.337 1.540 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 8.002 -4.620 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 13.337 -9.240 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 16.004 1.540 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 12.003 -10.010 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 6.668 -0.770 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 10.669 -4.620 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 13.337 -7.700 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 13.337 -0.000 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 8.002 -3.080 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 12.003 -6.930 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 16.004 -4.620 0.000 0.00 0.00 C+0 HETATM 32 O UNK 0 18.672 -0.000 0.000 0.00 0.00 O+0 HETATM 33 O UNK 0 9.336 -11.550 0.000 0.00 0.00 O+0 HETATM 34 O UNK 0 2.667 -0.000 0.000 0.00 0.00 O+0 HETATM 35 O UNK 0 17.338 -2.310 0.000 0.00 0.00 O+0 HETATM 36 O UNK 0 9.336 2.310 0.000 0.00 0.00 O+0 HETATM 37 O UNK 0 9.336 -0.770 0.000 0.00 0.00 O+0 HETATM 38 O UNK 0 14.670 3.850 0.000 0.00 0.00 O+0 HETATM 39 O UNK 0 9.336 -6.930 0.000 0.00 0.00 O+0 HETATM 40 O UNK 0 12.003 2.310 0.000 0.00 0.00 O+0 HETATM 41 O UNK 0 6.668 -5.390 0.000 0.00 0.00 O+0 HETATM 42 O UNK 0 14.670 -10.010 0.000 0.00 0.00 O+0 HETATM 43 O UNK 0 16.774 -5.954 0.000 0.00 0.00 O+0 HETATM 44 O UNK 0 17.338 2.310 0.000 0.00 0.00 O+0 HETATM 45 O UNK 0 12.003 -11.550 0.000 0.00 0.00 O+0 HETATM 46 O UNK 0 12.003 -0.770 0.000 0.00 0.00 O+0 HETATM 47 O UNK 0 14.670 -6.930 0.000 0.00 0.00 O+0 HETATM 48 O UNK 0 5.335 1.540 0.000 0.00 0.00 O+0 HETATM 49 O UNK 0 14.670 -0.770 0.000 0.00 0.00 O+0 HETATM 50 O UNK 0 10.669 -7.700 0.000 0.00 0.00 O+0 HETATM 51 O UNK 0 9.336 -2.310 0.000 0.00 0.00 O+0 HETATM 52 O UNK 0 6.668 -2.310 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 12.003 -5.390 0.000 0.00 0.00 O+0 CONECT 1 11 CONECT 2 31 CONECT 3 44 CONECT 4 45 CONECT 5 12 32 CONECT 6 13 33 CONECT 7 14 34 CONECT 8 15 46 CONECT 9 31 35 CONECT 10 31 47 CONECT 11 1 16 48 CONECT 12 5 23 49 CONECT 13 6 24 50 CONECT 14 7 25 48 CONECT 15 8 26 51 CONECT 16 11 17 36 CONECT 17 16 25 37 CONECT 18 20 23 38 CONECT 19 21 26 39 CONECT 20 18 28 40 CONECT 21 19 29 41 CONECT 22 24 27 42 CONECT 23 12 18 44 CONECT 24 13 22 45 CONECT 25 14 17 52 CONECT 26 15 19 53 CONECT 27 22 30 47 CONECT 28 20 46 49 CONECT 29 21 51 52 CONECT 30 27 50 53 CONECT 31 2 9 10 43 CONECT 32 5 CONECT 33 6 CONECT 34 7 CONECT 35 9 CONECT 36 16 CONECT 37 17 CONECT 38 18 CONECT 39 19 CONECT 40 20 CONECT 41 21 CONECT 42 22 CONECT 43 31 CONECT 44 3 23 CONECT 45 4 24 CONECT 46 8 28 CONECT 47 10 27 CONECT 48 11 14 CONECT 49 12 28 CONECT 50 13 30 CONECT 51 15 29 CONECT 52 25 29 CONECT 53 26 30 MASTER 0 0 0 0 0 0 0 0 53 0 112 0 END SMILES for NP0333939 (2-Hydroxypropyl starch)COC1C(O)C(O)C(OCC2OC(OC3C(O)C(O)C(C)OC3CO)C(O)C(O)C2OC2OC(CO)C(OC)C(O)C2OCC(C)(O)CO)OC1CO INCHI for NP0333939 (2-Hydroxypropyl starch)InChI=1/C31H56O22/c1-11-16(36)17(37)25(14(7-34)48-11)52-29-21(41)19(39)26(15(51-29)8-46-28-20(40)18(38)23(44-3)12(5-32)49-28)53-30-27(47-10-31(2,43)9-35)22(42)24(45-4)13(6-33)50-30/h11-30,32-43H,5-10H2,1-4H3 3D Structure for NP0333939 (2-Hydroxypropyl starch) | |||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C31H56O22 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 780.7670 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 780.32632 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 5-[(5-{[3-(2,3-dihydroxy-2-methylpropoxy)-4-hydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy}-6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy}methyl)-3,4-dihydroxyoxan-2-yl)oxy]-6-(hydroxymethyl)-2-methyloxane-3,4-diol | |||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 5-[(5-{[3-(2,3-dihydroxy-2-methylpropoxy)-4-hydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy}-6-({[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy}methyl)-3,4-dihydroxyoxan-2-yl)oxy]-6-(hydroxymethyl)-2-methyloxane-3,4-diol | |||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | COC1C(O)C(O)C(OCC2OC(OC3C(O)C(O)C(C)OC3CO)C(O)C(O)C2OC2OC(CO)C(OC)C(O)C2OCC(C)(O)CO)OC1CO | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1/C31H56O22/c1-11-16(36)17(37)25(14(7-34)48-11)52-29-21(41)19(39)26(15(51-29)8-46-28-20(40)18(38)23(44-3)12(5-32)49-28)53-30-27(47-10-31(2,43)9-35)22(42)24(45-4)13(6-33)50-30/h11-30,32-43H,5-10H2,1-4H3 | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | VYIPQJQYDCRXMM-UHFFFAOYNA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Shift Submissions | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species of Origin | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |