Showing NP-Card for Pseudodesmin B (NP0333718)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | ||||||||||||||||||||||||||||||||||||||||||||||||
Created at | 2024-08-11 15:45:12 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||
Updated at | 2024-09-16 10:47:00 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||
NP-MRD ID | NP0333718 | ||||||||||||||||||||||||||||||||||||||||||||||||
Natural Product DOI | https://doi.org/10.57994/3197 | ||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | ||||||||||||||||||||||||||||||||||||||||||||||||
Natural Product Identification | |||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Pseudodesmin B | ||||||||||||||||||||||||||||||||||||||||||||||||
Description | Based on a literature review very few articles have been published on Pseudodesmin B. | ||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for NP0333718 (Pseudodesmin B)Mrv2104 04252318182D 78 78 0 0 1 0 999 V2000 -1.3357 3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1069 2.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3060 2.1636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.2660 2.7580 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5348 2.9562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7637 3.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.1916 4.3433 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4204 5.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1516 5.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2213 5.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6092 4.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1813 4.7396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.9821 4.5415 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7533 5.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9524 5.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3804 4.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7236 6.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5541 5.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3550 4.9378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9270 5.5323 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6982 6.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2702 6.9194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7279 5.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9567 4.5415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.7575 4.3433 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3296 4.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1304 4.7396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3592 3.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7024 5.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9863 3.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4143 2.9562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6135 3.1544 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8423 2.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6431 2.1636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0414 2.5599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2406 2.7580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.6685 2.1636 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8974 1.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3253 0.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6982 1.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8677 2.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2957 1.7672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4948 1.9654 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0772 1.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6389 3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2702 1.7672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7872 3.3525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2999 5.9286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3253 5.9286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8380 3.3525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3471 2.8115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6789 1.7672 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4798 1.9654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.0518 1.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8526 1.5691 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4247 0.9746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.2255 1.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7976 0.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5984 0.7765 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8272 1.5691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1704 0.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9713 0.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5433 -0.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3442 -0.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9162 -0.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7171 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2891 -1.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4543 1.9654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0815 2.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5094 2.9562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7382 3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7086 2.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8230 0.5783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4501 0.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0221 0.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7933 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9925 -0.6107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3654 -1.0070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 4 3 1 6 0 0 0 4 5 1 1 0 0 0 5 6 1 0 0 0 0 7 6 1 0 0 0 0 7 8 1 6 0 0 0 8 9 1 0 0 0 0 8 10 1 0 0 0 0 7 11 1 0 0 0 0 11 12 1 0 0 0 0 13 12 1 6 0 0 0 13 14 1 1 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 15 17 1 0 0 0 0 13 18 1 0 0 0 0 18 19 1 0 0 0 0 20 19 1 0 0 0 0 20 21 1 6 0 0 0 21 22 1 0 0 0 0 20 23 1 0 0 0 0 23 24 1 0 0 0 0 25 24 1 0 0 0 0 25 26 1 1 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 27 29 1 0 0 0 0 25 30 1 0 0 0 0 30 31 1 0 0 0 0 32 31 1 6 0 0 0 32 33 1 1 0 0 0 33 34 1 0 0 0 0 32 35 1 0 0 0 0 35 36 1 0 0 0 0 37 36 1 0 0 0 0 37 38 1 1 0 0 0 38 39 1 0 0 0 0 38 40 1 0 0 0 0 37 41 1 0 0 0 0 41 42 1 0 0 0 0 43 42 1 0 0 0 0 4 43 1 0 0 0 0 43 44 1 6 0 0 0 41 45 2 0 0 0 0 35 46 2 0 0 0 0 30 47 2 0 0 0 0 23 48 2 0 0 0 0 18 49 2 0 0 0 0 11 50 2 0 0 0 0 5 51 2 0 0 0 0 52 2 1 0 0 0 0 52 53 1 1 0 0 0 53 54 1 0 0 0 0 55 54 1 0 0 0 0 55 56 1 1 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 59 58 1 0 0 0 0 59 60 1 1 0 0 0 59 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 65 66 1 0 0 0 0 66 67 1 0 0 0 0 57 68 2 0 0 0 0 55 69 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 70 72 1 0 0 0 0 54 73 2 0 0 0 0 52 74 1 0 0 0 0 74 75 1 0 0 0 0 75 76 1 0 0 0 0 76 77 1 0 0 0 0 76 78 2 0 0 0 0 M END 3D SDF for NP0333718 (Pseudodesmin B)Mrv2104 04252318182D 78 78 0 0 1 0 999 V2000 -1.3357 3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1069 2.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3060 2.1636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.2660 2.7580 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5348 2.9562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7637 3.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.1916 4.3433 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4204 5.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1516 5.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2213 5.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6092 4.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1813 4.7396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.9821 4.5415 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7533 5.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9524 5.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3804 4.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7236 6.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5541 5.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3550 4.9378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9270 5.5323 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6982 6.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2702 6.9194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7279 5.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9567 4.5415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.7575 4.3433 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3296 4.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1304 4.7396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3592 3.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7024 5.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9863 3.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4143 2.9562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6135 3.1544 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8423 2.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6431 2.1636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0414 2.5599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2406 2.7580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.6685 2.1636 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8974 1.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3253 0.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6982 1.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8677 2.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2957 1.7672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4948 1.9654 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0772 1.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6389 3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2702 1.7672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7872 3.3525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2999 5.9286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3253 5.9286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8380 3.3525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3471 2.8115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6789 1.7672 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4798 1.9654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.0518 1.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8526 1.5691 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4247 0.9746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.2255 1.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7976 0.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5984 0.7765 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8272 1.5691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1704 0.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9713 0.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5433 -0.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3442 -0.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9162 -0.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7171 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.2891 -1.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4543 1.9654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0815 2.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5094 2.9562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7382 3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7086 2.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8230 0.5783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4501 0.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0221 0.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7933 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9925 -0.6107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3654 -1.0070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 2 3 1 0 0 0 0 4 3 1 6 0 0 0 4 5 1 1 0 0 0 5 6 1 0 0 0 0 7 6 1 0 0 0 0 7 8 1 6 0 0 0 8 9 1 0 0 0 0 8 10 1 0 0 0 0 7 11 1 0 0 0 0 11 12 1 0 0 0 0 13 12 1 6 0 0 0 13 14 1 1 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 15 17 1 0 0 0 0 13 18 1 0 0 0 0 18 19 1 0 0 0 0 20 19 1 0 0 0 0 20 21 1 6 0 0 0 21 22 1 0 0 0 0 20 23 1 0 0 0 0 23 24 1 0 0 0 0 25 24 1 0 0 0 0 25 26 1 1 0 0 0 26 27 1 0 0 0 0 27 28 1 0 0 0 0 27 29 1 0 0 0 0 25 30 1 0 0 0 0 30 31 1 0 0 0 0 32 31 1 6 0 0 0 32 33 1 1 0 0 0 33 34 1 0 0 0 0 32 35 1 0 0 0 0 35 36 1 0 0 0 0 37 36 1 0 0 0 0 37 38 1 1 0 0 0 38 39 1 0 0 0 0 38 40 1 0 0 0 0 37 41 1 0 0 0 0 41 42 1 0 0 0 0 43 42 1 0 0 0 0 4 43 1 0 0 0 0 43 44 1 6 0 0 0 41 45 2 0 0 0 0 35 46 2 0 0 0 0 30 47 2 0 0 0 0 23 48 2 0 0 0 0 18 49 2 0 0 0 0 11 50 2 0 0 0 0 5 51 2 0 0 0 0 52 2 1 0 0 0 0 52 53 1 1 0 0 0 53 54 1 0 0 0 0 55 54 1 0 0 0 0 55 56 1 1 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 59 58 1 0 0 0 0 59 60 1 1 0 0 0 59 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 65 66 1 0 0 0 0 66 67 1 0 0 0 0 57 68 2 0 0 0 0 55 69 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 70 72 1 0 0 0 0 54 73 2 0 0 0 0 52 74 1 0 0 0 0 74 75 1 0 0 0 0 75 76 1 0 0 0 0 76 77 1 0 0 0 0 76 78 2 0 0 0 0 M END > <DATABASE_ID> NP0333718 > <DATABASE_NAME> NP-MRD > <SMILES> CCCCCCC[C@@H](O)CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@@H]1[C@@H](C)OC(=O)[C@@H](NC(=O)[C@@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](NC1=O)C(C)C)C(C)C > <INCHI_IDENTIFIER> InChI=1S/C53H94N10O15/c1-13-14-15-16-17-18-33(66)24-41(68)55-35(21-27(2)3)46(70)56-34(19-20-40(54)67)45(69)63-44-32(12)78-53(77)43(31(10)11)62-50(74)39(26-65)60-47(71)36(22-28(4)5)57-49(73)38(25-64)59-48(72)37(23-29(6)7)58-51(75)42(30(8)9)61-52(44)76/h27-39,42-44,64-66H,13-26H2,1-12H3,(H2,54,67)(H,55,68)(H,56,70)(H,57,73)(H,58,75)(H,59,72)(H,60,71)(H,61,76)(H,62,74)(H,63,69)/t32-,33-,34-,35+,36+,37?,38-,39?,42-,43+,44?/m1/s1 > <INCHI_KEY> QMZPYQGXHUSNRN-NXASQNSBSA-N > <FORMULA> C53H94N10O15 > <MOLECULAR_WEIGHT> 1111.39 > <EXACT_MASS> 1110.690012367 > <JCHEM_ACCEPTOR_COUNT> 14 > <JCHEM_ATOM_COUNT> 172 > <JCHEM_AVERAGE_POLARIZABILITY> 119.4851513963601 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 13 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> (2R)-N-[(3S,6R,9S,12R,15R,18R,21R,22R)-6,12-bis(hydroxymethyl)-22-methyl-9,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-3,18-bis(propan-2-yl)-1-oxa-4,7,10,13,16,19-hexaazacyclodocosan-21-yl]-2-[(2S)-2-[(3R)-3-hydroxydecanamido]-4-methylpentanamido]pentanediamide > <JCHEM_LOGP> -0.15276741299999747 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 1 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 11.561588104398368 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.175889843182999 > <JCHEM_POLAR_SURFACE_AREA> 391.9799999999999 > <JCHEM_REFRACTIVITY> 283.8520000000002 > <JCHEM_ROTATABLE_BOND_COUNT> 26 > <JCHEM_RULE_OF_FIVE> 0 > <JCHEM_TRADITIONAL_IUPAC> (2R)-N-[(3S,6R,9S,12R,15R,18R,21R,22R)-6,12-bis(hydroxymethyl)-3,18-diisopropyl-22-methyl-9,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1-oxa-4,7,10,13,16,19-hexaazacyclodocosan-21-yl]-2-[(2S)-2-[(3R)-3-hydroxydecanamido]-4-methylpentanamido]pentanediamide > <JCHEM_VEBER_RULE> 0 $$$$ PDB for NP0333718 (Pseudodesmin B)HEADER PROTEIN 25-APR-23 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 25-APR-23 0 HETATM 1 O UNK 0 -2.493 5.888 0.000 0.00 0.00 O+0 HETATM 2 C UNK 0 -2.066 4.409 0.000 0.00 0.00 C+0 HETATM 3 N UNK 0 -0.571 4.039 0.000 0.00 0.00 N+0 HETATM 4 C UNK 0 0.497 5.148 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -0.998 5.518 0.000 0.00 0.00 C+0 HETATM 6 N UNK 0 -1.426 6.998 0.000 0.00 0.00 N+0 HETATM 7 C UNK 0 -0.358 8.108 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -0.785 9.587 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 0.283 10.697 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -2.280 9.957 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 1.137 7.738 0.000 0.00 0.00 C+0 HETATM 12 N UNK 0 2.205 8.847 0.000 0.00 0.00 N+0 HETATM 13 C UNK 0 3.700 8.477 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 3.273 9.957 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 1.778 10.327 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 0.710 9.217 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 1.351 11.806 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 4.768 9.587 0.000 0.00 0.00 C+0 HETATM 19 N UNK 0 6.263 9.217 0.000 0.00 0.00 N+0 HETATM 20 C UNK 0 7.330 10.327 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 6.903 11.806 0.000 0.00 0.00 C+0 HETATM 22 O UNK 0 7.971 12.916 0.000 0.00 0.00 O+0 HETATM 23 C UNK 0 8.825 9.957 0.000 0.00 0.00 C+0 HETATM 24 N UNK 0 9.252 8.477 0.000 0.00 0.00 N+0 HETATM 25 C UNK 0 10.747 8.108 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 11.815 9.217 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 13.310 8.847 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 13.737 7.368 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 14.378 9.957 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 11.175 6.628 0.000 0.00 0.00 C+0 HETATM 31 N UNK 0 10.107 5.518 0.000 0.00 0.00 N+0 HETATM 32 C UNK 0 8.612 5.888 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 9.039 4.409 0.000 0.00 0.00 C+0 HETATM 34 O UNK 0 10.534 4.039 0.000 0.00 0.00 O+0 HETATM 35 C UNK 0 7.544 4.778 0.000 0.00 0.00 C+0 HETATM 36 N UNK 0 6.049 5.148 0.000 0.00 0.00 N+0 HETATM 37 C UNK 0 4.981 4.039 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 5.408 2.559 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 4.341 1.449 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 6.903 2.189 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 3.486 4.409 0.000 0.00 0.00 C+0 HETATM 42 O UNK 0 2.419 3.299 0.000 0.00 0.00 O+0 HETATM 43 C UNK 0 0.924 3.669 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 -0.144 2.559 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 3.059 5.888 0.000 0.00 0.00 O+0 HETATM 46 O UNK 0 7.971 3.299 0.000 0.00 0.00 O+0 HETATM 47 O UNK 0 12.669 6.258 0.000 0.00 0.00 O+0 HETATM 48 O UNK 0 9.893 11.067 0.000 0.00 0.00 O+0 HETATM 49 O UNK 0 4.341 11.067 0.000 0.00 0.00 O+0 HETATM 50 O UNK 0 1.564 6.258 0.000 0.00 0.00 O+0 HETATM 51 O UNK 0 -2.515 5.248 0.000 0.00 0.00 O+0 HETATM 52 C UNK 0 -3.134 3.299 0.000 0.00 0.00 C+0 HETATM 53 N UNK 0 -4.629 3.669 0.000 0.00 0.00 N+0 HETATM 54 C UNK 0 -5.697 2.559 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 -7.192 2.929 0.000 0.00 0.00 C+0 HETATM 56 N UNK 0 -8.259 1.819 0.000 0.00 0.00 N+0 HETATM 57 C UNK 0 -9.754 2.189 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 -10.822 1.079 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 -12.317 1.449 0.000 0.00 0.00 C+0 HETATM 60 O UNK 0 -12.744 2.929 0.000 0.00 0.00 O+0 HETATM 61 C UNK 0 -13.385 0.340 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 -14.880 0.710 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 -15.948 -0.400 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 -17.442 -0.030 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 -18.510 -1.140 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 -20.005 -0.770 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 -21.073 -1.880 0.000 0.00 0.00 C+0 HETATM 68 O UNK 0 -10.181 3.669 0.000 0.00 0.00 O+0 HETATM 69 C UNK 0 -7.619 4.409 0.000 0.00 0.00 C+0 HETATM 70 C UNK 0 -6.551 5.518 0.000 0.00 0.00 C+0 HETATM 71 C UNK 0 -6.978 6.998 0.000 0.00 0.00 C+0 HETATM 72 C UNK 0 -5.056 5.148 0.000 0.00 0.00 C+0 HETATM 73 O UNK 0 -5.270 1.079 0.000 0.00 0.00 O+0 HETATM 74 C UNK 0 -2.707 1.819 0.000 0.00 0.00 C+0 HETATM 75 C UNK 0 -3.775 0.710 0.000 0.00 0.00 C+0 HETATM 76 C UNK 0 -3.348 -0.770 0.000 0.00 0.00 C+0 HETATM 77 N UNK 0 -1.853 -1.140 0.000 0.00 0.00 N+0 HETATM 78 O UNK 0 -4.415 -1.880 0.000 0.00 0.00 O+0 CONECT 1 2 CONECT 2 1 3 52 CONECT 3 2 4 CONECT 4 3 5 43 CONECT 5 4 6 51 CONECT 6 5 7 CONECT 7 6 8 11 CONECT 8 7 9 10 CONECT 9 8 CONECT 10 8 CONECT 11 7 12 50 CONECT 12 11 13 CONECT 13 12 14 18 CONECT 14 13 15 CONECT 15 14 16 17 CONECT 16 15 CONECT 17 15 CONECT 18 13 19 49 CONECT 19 18 20 CONECT 20 19 21 23 CONECT 21 20 22 CONECT 22 21 CONECT 23 20 24 48 CONECT 24 23 25 CONECT 25 24 26 30 CONECT 26 25 27 CONECT 27 26 28 29 CONECT 28 27 CONECT 29 27 CONECT 30 25 31 47 CONECT 31 30 32 CONECT 32 31 33 35 CONECT 33 32 34 CONECT 34 33 CONECT 35 32 36 46 CONECT 36 35 37 CONECT 37 36 38 41 CONECT 38 37 39 40 CONECT 39 38 CONECT 40 38 CONECT 41 37 42 45 CONECT 42 41 43 CONECT 43 42 4 44 CONECT 44 43 CONECT 45 41 CONECT 46 35 CONECT 47 30 CONECT 48 23 CONECT 49 18 CONECT 50 11 CONECT 51 5 CONECT 52 2 53 74 CONECT 53 52 54 CONECT 54 53 55 73 CONECT 55 54 56 69 CONECT 56 55 57 CONECT 57 56 58 68 CONECT 58 57 59 CONECT 59 58 60 61 CONECT 60 59 CONECT 61 59 62 CONECT 62 61 63 CONECT 63 62 64 CONECT 64 63 65 CONECT 65 64 66 CONECT 66 65 67 CONECT 67 66 CONECT 68 57 CONECT 69 55 70 CONECT 70 69 71 72 CONECT 71 70 CONECT 72 70 CONECT 73 54 CONECT 74 52 75 CONECT 75 74 76 CONECT 76 75 77 78 CONECT 77 76 CONECT 78 76 MASTER 0 0 0 0 0 0 0 0 78 0 156 0 END SMILES for NP0333718 (Pseudodesmin B)CCCCCCC[C@@H](O)CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@@H]1[C@@H](C)OC(=O)[C@@H](NC(=O)[C@@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](NC1=O)C(C)C)C(C)C INCHI for NP0333718 (Pseudodesmin B)InChI=1S/C53H94N10O15/c1-13-14-15-16-17-18-33(66)24-41(68)55-35(21-27(2)3)46(70)56-34(19-20-40(54)67)45(69)63-44-32(12)78-53(77)43(31(10)11)62-50(74)39(26-65)60-47(71)36(22-28(4)5)57-49(73)38(25-64)59-48(72)37(23-29(6)7)58-51(75)42(30(8)9)61-52(44)76/h27-39,42-44,64-66H,13-26H2,1-12H3,(H2,54,67)(H,55,68)(H,56,70)(H,57,73)(H,58,75)(H,59,72)(H,60,71)(H,61,76)(H,62,74)(H,63,69)/t32-,33-,34-,35+,36+,37?,38-,39?,42-,43+,44?/m1/s1 3D Structure for NP0333718 (Pseudodesmin B) | ||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C53H94N10O15 | ||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 1111.3900 Da | ||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 1110.69001 Da | ||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | (2R)-N-[(3S,6R,9S,12R,15R,18R,21R,22R)-6,12-bis(hydroxymethyl)-22-methyl-9,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-3,18-bis(propan-2-yl)-1-oxa-4,7,10,13,16,19-hexaazacyclodocosan-21-yl]-2-[(2S)-2-[(3R)-3-hydroxydecanamido]-4-methylpentanamido]pentanediamide | ||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | (2R)-N-[(3S,6R,9S,12R,15R,18R,21R,22R)-6,12-bis(hydroxymethyl)-3,18-diisopropyl-22-methyl-9,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1-oxa-4,7,10,13,16,19-hexaazacyclodocosan-21-yl]-2-[(2S)-2-[(3R)-3-hydroxydecanamido]-4-methylpentanamido]pentanediamide | ||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CCCCCCC[C@@H](O)CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@@H]1[C@@H](C)OC(=O)[C@@H](NC(=O)[C@@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](NC1=O)C(C)C)C(C)C | ||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C53H94N10O15/c1-13-14-15-16-17-18-33(66)24-41(68)55-35(21-27(2)3)46(70)56-34(19-20-40(54)67)45(69)63-44-32(12)78-53(77)43(31(10)11)62-50(74)39(26-65)60-47(71)36(22-28(4)5)57-49(73)38(25-64)59-48(72)37(23-29(6)7)58-51(75)42(30(8)9)61-52(44)76/h27-39,42-44,64-66H,13-26H2,1-12H3,(H2,54,67)(H,55,68)(H,56,70)(H,57,73)(H,58,75)(H,59,72)(H,60,71)(H,61,76)(H,62,74)(H,63,69)/t32-,33-,34-,35+,36+,37?,38-,39?,42-,43+,44?/m1/s1 | ||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | QMZPYQGXHUSNRN-NXASQNSBSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Shift Submissions | |||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||
Species | |||||||||||||||||||||||||||||||||||||||||||||||||
Species of Origin |
| ||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | ||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
FoodDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |