NP-MRD: Showing NP-Card for (2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid (NP0326206)

Jump To Section:

Identification Spectra BioTaxonomy ChemoTaxonomy Physical properties Links References XML

Record Information

Version

2.0

Created at

2022-09-12 07:33:49 UTC

Updated at

2022-09-12 07:33:49 UTC

NP-MRD ID

NP0326206

Secondary Accession Numbers

None

Natural Product Identification

Common Name

(2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid

Description

PS(18:2(9Z,12Z)/18:2(9Z,12Z)), also known as phosphatidylserine(18:2/18:2) Or PS(18:2/18:2), Belongs to the class of organic compounds known as phosphatidylserines. These are glycerophosphoserines in which two fatty acids are bonded to the glycerol moiety through ester linkages. As is the case with diacylglycerols, phosphatidylserines can have many different combinations of fatty acids of varying lengths and saturation attached to the C-1 and C-2 positions. Thus, PS(18:2(9Z,12Z)/18:2(9Z,12Z)) is considered to be a glycerophosphoserine lipid molecule. PS(18:2(9Z,12Z)/18:2(9Z,12Z)) is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. Within humans, PS(18:2(9Z,12Z)/18:2(9Z,12Z)) participates in a number of enzymatic reactions. In particular, choline and PS(18:2(9Z,12Z)/18:2(9Z,12Z)) can be biosynthesized from PC(18:2(9Z,12Z)/18:2(9Z,12Z)) and L-serine; which is mediated by the enzyme phosphatidylserine synthase. In addition, PS(18:2(9Z,12Z)/18:2(9Z,12Z)) can be converted into PE(18:2(9Z,12Z)/18:2(9Z,12Z)) through its interaction with the enzyme phosphatidylserine decarboxylase. In humans, PS(18:2(9Z,12Z)/18:2(9Z,12Z)) is involved in phosphatidylethanolamine biosynthesis. It is a glycerophospholipid in which a phosphorylserine moiety occupies a glycerol substitution site. The linoleic acid moiety is derived from seed oils, while the linoleic acid moiety is derived from seed oils. It is usually less than 10% of the total phospholipids, the greatest concentration being in myelin from brain tissue. Therefore phosphatidylseriine may make the largest contribution to interfacial effects in membranes involving non-specific electrostatic interactions. This interaction may be of considerable relevance to the biological function of phosphatidylserine, especially during bone formation for example. PS biosynthesis involves an exchange reaction of serine for ethanolamine in PE. (2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid is found in Aphis gossypii and Trypanosoma brucei. While most phospholipids have a saturated fatty acid on C-1 and an unsaturated fatty acid on C-2 of the glycerol backbone, the fatty acid distribution at the C-1 and C-2 positions of glycerol within phospholipids is continually in flux, owing to phospholipid degradation and the continuous phospholipid remodeling that occurs while these molecules are in membranes.

Structure

MOL 3D MOL SDF PDB SMILES InChI

PS(18:2(9Z,12Z)/18:2(9Z,12Z))
  Mrv1652308101903032D          

 56 55  0  0  1  0            999 V2000
   21.1276   -3.1272    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.2288   -4.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5536   -4.5894    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   16.8784   -4.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9038   -4.5894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2032   -4.5894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0267   -5.3690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5790   -4.1996    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   19.1892   -3.5244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9688   -4.8747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2541   -3.8098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9292   -4.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6043   -3.8098    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   18.1413   -5.3987    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.3005   -3.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0978   -3.6582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3005   -2.3518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1079   -4.4925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4888   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4888   -3.4055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7747   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0605   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3464   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6322   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9181   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2039   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4898   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7757   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9507   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2365   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5224   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6973   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9832   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2691   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5549   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8408   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1267   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3122   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3122   -6.5530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5981   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8839   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1698   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4556   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7415   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0273   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3132   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5991   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7741   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0600   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3458   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5208   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8066   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0925   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3784   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6642   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9501   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0  0  0  0
  3  7  1  0  0  0  0
  3 14  1  1  0  0  0
  4  3  1  0  0  0  0
  5  2  1  0  0  0  0
  6  4  1  0  0  0  0
  6 19  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 11  8  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 13 15  1  0  0  0  0
 13 18  1  0  0  0  0
 13  1  1  6  0  0  0
 15 16  1  0  0  0  0
 15 17  2  0  0  0  0
 19 20  2  0  0  0  0
 19 21  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  2  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  2  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  1  0  0  0  0
 36 37  1  0  0  0  0
 38  7  1  0  0  0  0
 38 39  2  0  0  0  0
 38 40  1  0  0  0  0
 40 41  1  0  0  0  0
 41 42  1  0  0  0  0
 42 43  1  0  0  0  0
 43 44  1  0  0  0  0
 44 45  1  0  0  0  0
 45 46  1  0  0  0  0
 46 47  1  0  0  0  0
 47 48  2  0  0  0  0
 48 49  1  0  0  0  0
 49 50  1  0  0  0  0
 50 51  2  0  0  0  0
 51 52  1  0  0  0  0
 52 53  1  0  0  0  0
 53 54  1  0  0  0  0
 54 55  1  0  0  0  0
 55 56  1  0  0  0  0
M  END

     RDKit          3D

128127  0  0  0  0  0  0  0  0999 V2000
   -3.6203    0.2007    7.2029 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4592    1.2264    8.3094 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6121    2.6303    7.8645 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7593    3.1453    6.7930 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2894    3.1859    6.9032 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5586    1.9302    7.0368 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2808    1.5146    6.1197 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5524    2.2629    4.8888 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9875    2.5953    4.8428 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8163    2.2637    3.9073 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4657    1.5034    2.7376 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2622    0.2294    2.5934 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1262   -0.7681    3.6642 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7831   -1.3547    3.9081 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2102   -2.0763    2.7096 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1307   -2.6440    3.1071 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7727   -3.3765    1.9316 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9540   -2.3808    0.8663 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8977   -1.5517    0.9508 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0961   -2.3531   -0.2131 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2787   -1.3815   -1.2297 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7623   -1.5193   -2.2795 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.7934   -0.3314   -3.2251 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9733   -0.3977   -3.9713 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1097    0.8620   -5.0609 P   0  0  2  0  0  5  0  0  0  0  0  0
    0.8637    1.7098   -5.0388 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3062    0.2885   -6.6512 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4837    1.7668   -4.6823 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2782    2.3033   -3.3931 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5423    3.1122   -3.1069 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.6019    4.1234   -4.1528 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6909    2.1775   -3.2138 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5202    2.3702   -4.1591 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8739    1.1290   -2.3312 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8069   -2.6991   -3.0021 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8081   -3.6145   -2.9662 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7511   -3.2381   -2.1039 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0462   -4.8726   -3.6617 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5809   -6.0945   -3.0340 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2615   -6.6459   -2.9424 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9780   -6.0062   -2.4837 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4921   -5.0003   -3.4454 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8138   -4.3665   -2.9665 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1753   -3.3780   -4.0894 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4345   -2.6875   -3.8507 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4865   -1.3801   -3.7380 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3303   -0.4415   -3.8271 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5809    0.4691   -4.9716 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6893    1.7641   -4.8270 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5826    2.4550   -3.5409 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3870    3.4154   -3.6235 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2303    4.1674   -2.3270 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0537    5.1115   -2.3663 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9654    5.8517   -1.0332 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9164   -0.7671    7.6886 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4271    0.5022    6.5059 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6792    0.0057    6.6591 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6557    0.9853    8.9905 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4075    1.0189    8.9592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7060    2.7345    7.5420 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5759    3.2868    8.7869 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0459    2.6577    5.8078 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0843    4.2324    6.6167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1235    3.7488    7.9342 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8481    3.9478    6.2268 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6956    1.3099    7.9461 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7977    0.5763    6.2830 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2350    1.5684    4.0710 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0052    3.2136    4.7911 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3562    3.1819    5.6990 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8702    2.5820    4.0064 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7165    2.1530    1.8354 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4273    1.2193    2.5643 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0707   -0.2647    1.6122 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3609    0.4963    2.5335 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8078   -1.6270    3.3906 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5253   -0.4230    4.6462 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9081   -2.1401    4.7093 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0065   -0.6792    4.2781 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0330   -1.3956    1.8500 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8495   -2.9081    2.3429 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8258   -1.8747    3.4740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0177   -3.3984    3.9372 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6923   -3.8642    2.2556 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0035   -4.1325    1.6167 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3291   -1.3631   -1.6027 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1299   -0.3957   -0.7227 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7524   -1.4510   -1.7124 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0699   -0.3140   -3.8974 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8510    0.6350   -2.6686 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4691   -0.2325   -6.8509 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0877    1.5259   -2.6357 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4404    3.0163   -3.4352 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4432    3.5587   -2.1132 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4480    5.0942   -3.7689 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9891    3.8980   -4.9648 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2668    0.3404   -2.2483 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1902   -4.9278   -3.8028 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6970   -4.8177   -4.7434 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2250   -6.9421   -3.5501 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0983   -6.1684   -1.9718 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0362   -7.1035   -4.0134 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3123   -7.6972   -2.3930 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7873   -6.7583   -2.2574 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7389   -5.4659   -1.5136 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8718   -4.2348   -3.8262 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8661   -5.6362   -4.3454 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7090   -3.8721   -2.0001 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6057   -5.1460   -2.8942 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3743   -4.0826   -4.9693 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2876   -2.7907   -4.2566 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3930   -3.2540   -3.7571 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4759   -0.9296   -3.5589 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1679    0.0768   -2.8589 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3602   -0.9479   -4.0242 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6779    0.0123   -5.9899 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8749    2.3614   -5.7496 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5777    1.8735   -2.6358 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4689    3.1805   -3.5105 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4623    2.9063   -3.9170 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6332    4.1529   -4.4100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1539    3.5212   -1.4410 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1348    4.8202   -2.1445 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1089    4.5243   -2.4236 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0766    5.7880   -3.2187 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3456    6.7468   -1.1897 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9763    6.1048   -0.6544 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4098    5.1983   -0.3055 H   0  0  0  0  0  0  0  0  0  0  0  0
 30 31  1  0
 30 29  1  0
 29 28  1  0
 25 28  1  1
 25 27  1  0
 25 26  2  0
 25 24  1  0
 24 23  1  0
 23 22  1  0
 22 21  1  0
 21 20  1  0
 20 18  1  0
 18 19  2  0
 18 17  1  0
 17 16  1  0
 16 15  1  0
 15 14  1  0
 14 13  1  0
 13 12  1  0
 12 11  1  0
 11 10  1  0
 10  9  2  0
  9  8  1  0
  8  7  1  0
  7  6  2  0
  6  5  1  0
  5  4  1  0
  4  3  1  0
  3  2  1  0
  2  1  1  0
 22 35  1  0
 35 36  1  0
 36 37  2  0
 36 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
 44 45  1  0
 45 46  2  0
 46 47  1  0
 47 48  1  0
 48 49  2  0
 49 50  1  0
 50 51  1  0
 51 52  1  0
 52 53  1  0
 53 54  1  0
 30 32  1  0
 32 34  1  0
 32 33  2  0
 30 94  1  1
 31 95  1  0
 31 96  1  0
 29 92  1  0
 29 93  1  0
 27 91  1  0
 23 89  1  0
 23 90  1  0
 22 88  1  1
 21 86  1  0
 21 87  1  0
 17 84  1  0
 17 85  1  0
 16 82  1  0
 16 83  1  0
 15 80  1  0
 15 81  1  0
 14 78  1  0
 14 79  1  0
 13 76  1  0
 13 77  1  0
 12 74  1  0
 12 75  1  0
 11 72  1  0
 11 73  1  0
 10 71  1  0
  9 70  1  0
  8 68  1  0
  8 69  1  0
  7 67  1  0
  6 66  1  0
  5 64  1  0
  5 65  1  0
  4 62  1  0
  4 63  1  0
  3 60  1  0
  3 61  1  0
  2 58  1  0
  2 59  1  0
  1 55  1  0
  1 56  1  0
  1 57  1  0
 38 98  1  0
 38 99  1  0
 39100  1  0
 39101  1  0
 40102  1  0
 40103  1  0
 41104  1  0
 41105  1  0
 42106  1  0
 42107  1  0
 43108  1  0
 43109  1  0
 44110  1  0
 44111  1  0
 45112  1  0
 46113  1  0
 47114  1  0
 47115  1  0
 48116  1  0
 49117  1  0
 50118  1  0
 50119  1  0
 51120  1  0
 51121  1  0
 52122  1  0
 52123  1  0
 53124  1  0
 53125  1  0
 54126  1  0
 54127  1  0
 54128  1  0
 34 97  1  0
M  END

PS(18:2(9Z,12Z)/18:2(9Z,12Z))
  Mrv1652308101903032D          

 56 55  0  0  1  0            999 V2000
   21.1276   -3.1272    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.2288   -4.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5536   -4.5894    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   16.8784   -4.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9038   -4.5894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2032   -4.5894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0267   -5.3690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5790   -4.1996    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   19.1892   -3.5244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9688   -4.8747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2541   -3.8098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9292   -4.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6043   -3.8098    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   18.1413   -5.3987    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.3005   -3.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0978   -3.6582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3005   -2.3518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1079   -4.4925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4888   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4888   -3.4055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7747   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0605   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3464   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6322   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9181   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2039   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4898   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7757   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9507   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2365   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5224   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6973   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9832   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2691   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5549   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8408   -4.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1267   -4.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3122   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3122   -6.5530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5981   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8839   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1698   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4556   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7415   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0273   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3132   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5991   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7741   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0600   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3458   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5208   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8066   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0925   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3784   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6642   -5.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9501   -5.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0  0  0  0
  3  7  1  0  0  0  0
  3 14  1  1  0  0  0
  4  3  1  0  0  0  0
  5  2  1  0  0  0  0
  6  4  1  0  0  0  0
  6 19  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 11  8  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 13 15  1  0  0  0  0
 13 18  1  0  0  0  0
 13  1  1  6  0  0  0
 15 16  1  0  0  0  0
 15 17  2  0  0  0  0
 19 20  2  0  0  0  0
 19 21  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  2  0  0  0  0
 29 30  1  0  0  0  0
 30 31  1  0  0  0  0
 31 32  2  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  1  0  0  0  0
 36 37  1  0  0  0  0
 38  7  1  0  0  0  0
 38 39  2  0  0  0  0
 38 40  1  0  0  0  0
 40 41  1  0  0  0  0
 41 42  1  0  0  0  0
 42 43  1  0  0  0  0
 43 44  1  0  0  0  0
 44 45  1  0  0  0  0
 45 46  1  0  0  0  0
 46 47  1  0  0  0  0
 47 48  2  0  0  0  0
 48 49  1  0  0  0  0
 49 50  1  0  0  0  0
 50 51  2  0  0  0  0
 51 52  1  0  0  0  0
 52 53  1  0  0  0  0
 53 54  1  0  0  0  0
 54 55  1  0  0  0  0
 55 56  1  0  0  0  0
M  END
> <DATABASE_ID>
NP0326206

> <DATABASE_NAME>
NP-MRD

> <SMILES>
[H][C@](N)(COP(O)(=O)OC[C@@]([H])(COC(=O)CCCCCCC\C=C/C\C=C/CCCCC)OC(=O)CCCCCCC\C=C/C\C=C/CCCCC)C(O)=O

> <INCHI_IDENTIFIER>
InChI=1S/C42H74NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(44)50-35-38(36-51-54(48,49)52-37-39(43)42(46)47)53-41(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,38-39H,3-10,15-16,21-37,43H2,1-2H3,(H,46,47)(H,48,49)/b13-11-,14-12-,19-17-,20-18-/t38-,39+/m1/s1

> <INCHI_KEY>
ZTNFQEXYTMNFHG-SOFXVBFTSA-N

> <FORMULA>
C42H74NO10P

> <MOLECULAR_WEIGHT>
784.0114

> <EXACT_MASS>
783.505034105

> <JCHEM_ACCEPTOR_COUNT>
7

> <JCHEM_ATOM_COUNT>
128

> <JCHEM_AVERAGE_POLARIZABILITY>
90.72233272071067

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
3

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
(2S)-2-amino-3-({[(2R)-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoyloxy]propoxy](hydroxy)phosphoryl}oxy)propanoic acid

> <ALOGPS_LOGP>
4.79

> <JCHEM_LOGP>
9.824094798899273

> <ALOGPS_LOGS>
-6.97

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
0

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
2.178396015655446

> <JCHEM_PKA_STRONGEST_ACIDIC>
1.4680339991787523

> <JCHEM_PKA_STRONGEST_BASIC>
9.376604467850063

> <JCHEM_POLAR_SURFACE_AREA>
171.68

> <JCHEM_REFRACTIVITY>
219.70420000000007

> <JCHEM_ROTATABLE_BOND_COUNT>
40

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
8.43e-05 g/l

> <JCHEM_TRADITIONAL_IUPAC>
(2S)-2-amino-3-{[(2R)-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HEADER    PROTEIN                                 10-AUG-19   NONE
TITLE     NULL                                                        
COMPND    MOLECULE: PS(18:2(9Z,12Z)/18:2(9Z,12Z))                     
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   10-AUG-19         0                                  
HETATM    1  H   UNK     0      39.438  -5.837   0.000  0.00  0.00           H+0
HETATM    2  C   UNK     0      34.027  -7.839   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      32.767  -8.567   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      31.506  -7.839   0.000  0.00  0.00           C+0
HETATM    5  O   UNK     0      35.287  -8.567   0.000  0.00  0.00           O+0
HETATM    6  O   UNK     0      30.246  -8.567   0.000  0.00  0.00           O+0
HETATM    7  O   UNK     0      31.783 -10.022   0.000  0.00  0.00           O+0
HETATM    8  P   UNK     0      36.547  -7.839   0.000  0.00  0.00           P+0
HETATM    9  O   UNK     0      35.820  -6.579   0.000  0.00  0.00           O+0
HETATM   10  O   UNK     0      37.275  -9.100   0.000  0.00  0.00           O+0
HETATM   11  O   UNK     0      37.808  -7.112   0.000  0.00  0.00           O+0
HETATM   12  C   UNK     0      39.068  -7.839   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      40.328  -7.112   0.000  0.00  0.00           C+0
HETATM   14  H   UNK     0      33.864 -10.078   0.000  0.00  0.00           H+0
HETATM   15  C   UNK     0      41.628  -5.967   0.000  0.00  0.00           C+0
HETATM   16  O   UNK     0      43.116  -6.829   0.000  0.00  0.00           O+0
HETATM   17  O   UNK     0      41.628  -4.390   0.000  0.00  0.00           O+0
HETATM   18  N   UNK     0      41.268  -8.386   0.000  0.00  0.00           N+0
HETATM   19  C   UNK     0      28.912  -7.797   0.000  0.00  0.00           C+0
HETATM   20  O   UNK     0      28.912  -6.357   0.000  0.00  0.00           O+0
HETATM   21  C   UNK     0      27.579  -8.568   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      26.246  -7.797   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      24.913  -8.568   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      23.580  -7.797   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      22.247  -8.568   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      20.914  -7.797   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      19.581  -8.568   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      18.248  -7.797   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      16.708  -7.797   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      15.375  -8.568   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0      14.042  -7.797   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0      12.502  -7.797   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0      11.169  -8.568   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0       9.836  -7.797   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0       8.503  -8.568   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0       7.169  -7.797   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0       5.836  -8.568   0.000  0.00  0.00           C+0
HETATM   38  C   UNK     0      30.449 -10.792   0.000  0.00  0.00           C+0
HETATM   39  O   UNK     0      30.449 -12.232   0.000  0.00  0.00           O+0
HETATM   40  C   UNK     0      29.116 -10.021   0.000  0.00  0.00           C+0
HETATM   41  C   UNK     0      27.783 -10.792   0.000  0.00  0.00           C+0
HETATM   42  C   UNK     0      26.450 -10.021   0.000  0.00  0.00           C+0
HETATM   43  C   UNK     0      25.117 -10.792   0.000  0.00  0.00           C+0
HETATM   44  C   UNK     0      23.784 -10.021   0.000  0.00  0.00           C+0
HETATM   45  C   UNK     0      22.451 -10.792   0.000  0.00  0.00           C+0
HETATM   46  C   UNK     0      21.118 -10.021   0.000  0.00  0.00           C+0
HETATM   47  C   UNK     0      19.785 -10.792   0.000  0.00  0.00           C+0
HETATM   48  C   UNK     0      18.245 -10.792   0.000  0.00  0.00           C+0
HETATM   49  C   UNK     0      16.912 -10.021   0.000  0.00  0.00           C+0
HETATM   50  C   UNK     0      15.579 -10.792   0.000  0.00  0.00           C+0
HETATM   51  C   UNK     0      14.039 -10.792   0.000  0.00  0.00           C+0
HETATM   52  C   UNK     0      12.706 -10.021   0.000  0.00  0.00           C+0
HETATM   53  C   UNK     0      11.373 -10.792   0.000  0.00  0.00           C+0
HETATM   54  C   UNK     0      10.040 -10.021   0.000  0.00  0.00           C+0
HETATM   55  C   UNK     0       8.707 -10.792   0.000  0.00  0.00           C+0
HETATM   56  C   UNK     0       7.373 -10.021   0.000  0.00  0.00           C+0
CONECT    1   13                                                            
CONECT    2    3    5                                                       
CONECT    3    2    7   14    4                                             
CONECT    4    3    6                                                       
CONECT    5    2    8                                                       
CONECT    6    4   19                                                       
CONECT    7    3   38                                                       
CONECT    8    5    9   10   11                                             
CONECT    9    8                                                            
CONECT   10    8                                                            
CONECT   11    8   12                                                       
CONECT   12   11   13                                                       
CONECT   13   12   15   18    1                                             
CONECT   14    3                                                            
CONECT   15   13   16   17                                                  
CONECT   16   15                                                            
CONECT   17   15                                                            
CONECT   18   13                                                            
CONECT   19    6   20   21                                                  
CONECT   20   19                                                            
CONECT   21   19   22                                                       
CONECT   22   21   23                                                       
CONECT   23   22   24                                                       
CONECT   24   23   25                                                       
CONECT   25   24   26                                                       
CONECT   26   25   27                                                       
CONECT   27   26   28                                                       
CONECT   28   27   29                                                       
CONECT   29   28   30                                                       
CONECT   30   29   31                                                       
CONECT   31   30   32                                                       
CONECT   32   31   33                                                       
CONECT   33   32   34                                                       
CONECT   34   33   35                                                       
CONECT   35   34   36                                                       
CONECT   36   35   37                                                       
CONECT   37   36                                                            
CONECT   38    7   39   40                                                  
CONECT   39   38                                                            
CONECT   40   38   41                                                       
CONECT   41   40   42                                                       
CONECT   42   41   43                                                       
CONECT   43   42   44                                                       
CONECT   44   43   45                                                       
CONECT   45   44   46                                                       
CONECT   46   45   47                                                       
CONECT   47   46   48                                                       
CONECT   48   47   49                                                       
CONECT   49   48   50                                                       
CONECT   50   49   51                                                       
CONECT   51   50   52                                                       
CONECT   52   51   53                                                       
CONECT   53   52   54                                                       
CONECT   54   53   55                                                       
CONECT   55   54   56                                                       
CONECT   56   55                                                            
MASTER        0    0    0    0    0    0    0    0   56    0  110    0
END

View in JSmol

Synonyms

Value	Source
1,2-Dilinoleoyl-rac-glycero-3-phosphoserine	HMDB
Phosphatidylserine(18:2/18:2)	HMDB
Phosphatidylserine(18:2n6/18:2n6)	HMDB
Phosphatidylserine(18:2W6/18:2W6)	HMDB
Phosphatidylserine(36:4)	HMDB
PS(18:2/18:2)	HMDB
PS(18:2N6/18:2N6)	HMDB
PS(18:2W6/18:2W6)	HMDB
PS(36:4)	HMDB
pSer(18:2/18:2)	HMDB
pSer(18:2n6/18:2n6)	HMDB
pSer(18:2W6/18:2W6)	HMDB
pSer(36:4)	HMDB
1,2-Di(9Z,12Z-octadecadienoyl)-rac-glycero-3-phosphoserine	HMDB
PS(18:2(9Z,12Z)/18:2(9Z,12Z))	Lipid Annotator

Chemical Formula

C₄₂H₇₄NO₁₀P

Average Mass

784.0114 Da

Monoisotopic Mass

783.50503 Da

IUPAC Name

(2S)-2-amino-3-({[(2R)-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoyloxy]propoxy](hydroxy)phosphoryl}oxy)propanoic acid

Traditional Name

(2S)-2-amino-3-{[(2R)-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid

CAS Registry Number

Not Available

SMILES

[H][C@](N)(COP(O)(=O)OC[C@@]([H])(COC(=O)CCCCCCC\C=C/C\C=C/CCCCC)OC(=O)CCCCCCC\C=C/C\C=C/CCCCC)C(O)=O

InChI Identifier

InChI=1S/C42H74NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(44)50-35-38(36-51-54(48,49)52-37-39(43)42(46)47)53-41(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,38-39H,3-10,15-16,21-37,43H2,1-2H3,(H,46,47)(H,48,49)/b13-11-,14-12-,19-17-,20-18-/t38-,39+/m1/s1

InChI Key

ZTNFQEXYTMNFHG-SOFXVBFTSA-N

Experimental Spectra

Not Available

Predicted Spectra

Spectrum Type	Description	Depositor ID	Depositor Organization	Depositor	Deposition Date	View
1D NMR	¹³C NMR Spectrum (1D, 25 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 100 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 252 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 1000 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 50 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 200 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 75 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 300 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 101 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 400 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 126 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 500 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 151 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 600 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 176 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 700 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 201 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 800 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 226 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 900 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum

Chemical Shift Submissions

Not Available

Species

Species of Origin

Species Name	Source	Reference
Aphis gossypii	LOTUS Database	35616633
Trypanosoma brucei	LOTUS Database	35616633

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as phosphatidylserines. These are glycerophosphoserines in which two fatty acids are bonded to the glycerol moiety through ester linkages. As is the case with diacylglycerols, phosphatidylserines can have many different combinations of fatty acids of varying lengths and saturation attached to the C-1 and C-2 positions.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Glycerophospholipids

Sub Class

Glycerophosphoserines

Direct Parent

Phosphatidylserines

Alternative Parents

Substituents

Diacyl-glycerol-3-phosphoserine
Alpha-amino acid
Alpha-amino acid or derivatives
L-alpha-amino acid
Tricarboxylic acid or derivatives
Phosphoethanolamine
Fatty acid ester
Dialkyl phosphate
Organic phosphoric acid derivative
Phosphoric acid ester
Alkyl phosphate
Fatty acyl
Amino acid
Amino acid or derivatives
Carboxylic acid ester
Carboxylic acid derivative
Carboxylic acid
Primary aliphatic amine
Organopnictogen compound
Organic oxygen compound
Organic nitrogen compound
Amine
Carbonyl group
Organic oxide
Primary amine
Hydrocarbon derivative
Organonitrogen compound
Organooxygen compound
Aliphatic acyclic compound

Molecular Framework

Aliphatic acyclic compounds

External Descriptors

Diacylglycerophosphoserines (LMGP03010023 )

Physical Properties

State

Not Available

Experimental Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Predicted Properties

Property	Value	Source
logP	4.79	ALOGPS
logP	9.82	ChemAxon
logS	-7	ALOGPS
pKa (Strongest Acidic)	1.47	ChemAxon
pKa (Strongest Basic)	9.38	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	7	ChemAxon
Hydrogen Donor Count	3	ChemAxon
Polar Surface Area	171.68 Å²	ChemAxon
Rotatable Bond Count	40	ChemAxon
Refractivity	219.7 m³·mol⁻¹	ChemAxon
Polarizability	90.72 Å³	ChemAxon
Number of Rings	0	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

External Links

HMDB ID

HMDB0012402

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FoodDB ID

FDB029018

KNApSAcK ID

Not Available

Chemspider ID

7826036

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

9547086

PDB ID

Not Available

ChEBI ID

88488

Good Scents ID

Not Available

References

General References

LOTUS database [Link]

Showing NP-Card for (2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid (NP0326206)

MOL for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)

3D MOL for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)

3D SDF for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)

3D-SDF for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)

PDB for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)

3D PDB for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)

SMILES for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)

INCHI for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)

Structure for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)

3D Structure for NP0326206 ((2s)-2-amino-3-{[(2r)-2,3-bis[(9z,12z)-octadeca-9,12-dienoyloxy]propoxy(hydroxy)phosphoryl]oxy}propanoic acid)