Showing NP-Card for (1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate (NP0321604)
Record Information | ||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | |||||||||||||||
Created at | 2022-09-11 23:53:56 UTC | |||||||||||||||
Updated at | 2022-09-11 23:53:57 UTC | |||||||||||||||
NP-MRD ID | NP0321604 | |||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||
Natural Product Identification | ||||||||||||||||
Common Name | (1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate | |||||||||||||||
Description | 23-(10-Methyl)undecanoic acid demalonylazalomycin F4a ester belongs to the class of organic compounds known as macrolides and analogues. These are organic compounds containing a lactone ring of at least twelve members. It was first documented in 2013 (PMID: 23481678). Based on a literature review very few articles have been published on 23-(10-methyl)undecanoic acid demalonylazalomycin F4a ester. | |||||||||||||||
Structure | MOL for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate)Mrv1652309122201532D 83 84 0 0 1 0 999 V2000 -6.4302 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4302 -0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.7158 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0013 -0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.7158 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.0013 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0013 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2868 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5724 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5724 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8579 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 1.2375 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7145 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.8250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -1.2375 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 9.2881 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -1.6500 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0026 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -0.4125 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 11.4315 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 9.2881 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5737 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1460 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8605 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5749 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2894 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0039 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7184 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4328 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7184 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 0.8250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1447 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7158 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 0.8250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2868 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 12.1460 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 12.1460 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 9 8 1 4 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 6 0 0 0 16 14 1 1 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 2 0 0 0 0 18 20 1 0 0 0 0 20 21 1 0 0 0 0 20 22 2 0 0 0 0 22 23 1 4 0 0 0 23 24 2 0 0 0 0 24 25 1 4 0 0 0 25 26 1 0 0 0 0 25 27 1 0 0 0 0 27 28 1 0 0 0 0 27 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 30 32 1 0 0 0 0 32 33 1 0 0 0 0 32 34 1 0 0 0 0 34 35 1 0 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 6 0 0 0 38 40 1 0 0 0 0 40 41 1 6 0 0 0 40 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 6 0 0 0 43 45 1 0 0 0 0 46 45 1 1 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 1 0 0 0 49 50 1 0 0 0 0 50 51 2 0 0 0 0 50 52 1 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 60 62 1 0 0 0 0 48 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 6 0 0 0 64 66 1 0 0 0 0 66 67 1 0 0 0 0 67 68 1 1 0 0 0 67 69 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 6 0 0 0 70 72 1 0 0 0 0 72 73 1 0 0 0 0 72 74 2 0 0 0 0 74 75 1 4 0 0 0 75 76 2 0 0 0 0 76 77 1 4 0 0 0 16 77 1 0 0 0 0 77 78 1 0 0 0 0 46 79 1 0 0 0 0 79 80 1 0 0 0 0 80 81 1 1 0 0 0 80 82 1 0 0 0 0 43 82 1 0 0 0 0 82 83 1 6 0 0 0 M END 3D MOL for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate)3D SDF for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate)Mrv1652309122201532D 83 84 0 0 1 0 999 V2000 -6.4302 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4302 -0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.7158 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0013 -0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.7158 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.0013 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0013 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2868 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5724 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5724 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8579 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 1.2375 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7145 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.8250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -1.2375 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 9.2881 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -1.6500 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0026 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -0.4125 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 11.4315 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 9.2881 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5737 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1460 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8605 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5749 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2894 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0039 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7184 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4328 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7184 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 0.8250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1447 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7158 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 0.8250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2868 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 0.8250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 12.1460 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 12.1460 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 9 8 1 4 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 6 0 0 0 16 14 1 1 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 2 0 0 0 0 18 20 1 0 0 0 0 20 21 1 0 0 0 0 20 22 2 0 0 0 0 22 23 1 4 0 0 0 23 24 2 0 0 0 0 24 25 1 4 0 0 0 25 26 1 0 0 0 0 25 27 1 0 0 0 0 27 28 1 0 0 0 0 27 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 30 32 1 0 0 0 0 32 33 1 0 0 0 0 32 34 1 0 0 0 0 34 35 1 0 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 6 0 0 0 38 40 1 0 0 0 0 40 41 1 6 0 0 0 40 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 6 0 0 0 43 45 1 0 0 0 0 46 45 1 1 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 1 0 0 0 49 50 1 0 0 0 0 50 51 2 0 0 0 0 50 52 1 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 1 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 60 62 1 0 0 0 0 48 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 1 6 0 0 0 64 66 1 0 0 0 0 66 67 1 0 0 0 0 67 68 1 1 0 0 0 67 69 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 6 0 0 0 70 72 1 0 0 0 0 72 73 1 0 0 0 0 72 74 2 0 0 0 0 74 75 1 4 0 0 0 75 76 2 0 0 0 0 76 77 1 4 0 0 0 16 77 1 0 0 0 0 77 78 1 0 0 0 0 46 79 1 0 0 0 0 79 80 1 0 0 0 0 80 81 1 1 0 0 0 80 82 1 0 0 0 0 43 82 1 0 0 0 0 82 83 1 6 0 0 0 M END > <DATABASE_ID> NP0321604 > <DATABASE_NAME> NP-MRD > <SMILES> CNC(=N)NCCCC=CCCC[C@H](C)[C@@H]1OC(=O)C(C)=CC=CC(C)C(O)CC(O)C(C)C(O)CC[C@H](C)[C@@H](O)C[C@@]2(O)O[C@H](C[C@@H](O)[C@@H]2O)C[C@H](C[C@H](O)C[C@@H](O)C[C@H](O)C(C)=CC=CC1C)OC(=O)CCCCCCCCC(C)C > <INCHI_IDENTIFIER> InChI=1S/C65H115N3O15/c1-42(2)25-19-15-11-12-17-21-31-60(77)81-52-36-50(69)35-51(70)37-55(72)43(3)27-23-29-47(7)61(46(6)26-20-16-13-14-18-22-34-68-64(66)67-10)82-63(79)48(8)30-24-28-44(4)56(73)40-57(74)49(9)54(71)33-32-45(5)59(76)41-65(80)62(78)58(75)39-53(38-52)83-65/h13-14,23-24,27-30,42,44-47,49-59,61-62,69-76,78,80H,11-12,15-22,25-26,31-41H2,1-10H3,(H3,66,67,68)/t44?,45-,46-,47?,49?,50+,51+,52-,53-,54?,55-,56?,57?,58+,59-,61-,62-,65+/m0/s1 > <INCHI_KEY> UEVRSRIAXOGKNQ-QEYPXDRPSA-N > <FORMULA> C65H115N3O15 > <MOLECULAR_WEIGHT> 1178.641 > <EXACT_MASS> 1177.832820015 > <JCHEM_ACCEPTOR_COUNT> 16 > <JCHEM_ATOM_COUNT> 198 > <JCHEM_AVERAGE_POLARIZABILITY> 138.06616979961177 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 13 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> (1R,3S,5R,7R,9S,15S,30S,31S,33R,34S,35R)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2S)-10-(N'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate > <JCHEM_LOGP> 6.304126806984601 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 2 > <JCHEM_PHYSIOLOGICAL_CHARGE> 1 > <JCHEM_PKA> 13.182972732621753 > <JCHEM_PKA_STRONGEST_ACIDIC> 10.935527403596044 > <JCHEM_PKA_STRONGEST_BASIC> 12.40979921955758 > <JCHEM_POLAR_SURFACE_AREA> 312.04 > <JCHEM_REFRACTIVITY> 341.2596999999997 > <JCHEM_ROTATABLE_BOND_COUNT> 20 > <JCHEM_RULE_OF_FIVE> 0 > <JCHEM_TRADITIONAL_IUPAC> (1R,3S,5R,7R,9S,15S,30S,31S,33R,34S,35R)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2S)-10-(N'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate)PDB for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate)HEADER PROTEIN 12-SEP-22 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 12-SEP-22 0 HETATM 1 C UNK 0 -12.003 -2.310 0.000 0.00 0.00 C+0 HETATM 2 N UNK 0 -12.003 -0.770 0.000 0.00 0.00 N+0 HETATM 3 C UNK 0 -10.669 -0.000 0.000 0.00 0.00 C+0 HETATM 4 N UNK 0 -9.336 -0.770 0.000 0.00 0.00 N+0 HETATM 5 N UNK 0 -10.669 1.540 0.000 0.00 0.00 N+0 HETATM 6 C UNK 0 -9.336 2.310 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 -9.336 3.850 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -8.002 4.620 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -6.668 3.850 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -6.668 2.310 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -5.335 1.540 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -4.001 2.310 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -2.667 1.540 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -1.334 2.310 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 -1.334 3.850 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 0.000 1.540 0.000 0.00 0.00 C+0 HETATM 17 O UNK 0 0.000 -0.000 0.000 0.00 0.00 O+0 HETATM 18 C UNK 0 1.334 -0.770 0.000 0.00 0.00 C+0 HETATM 19 O UNK 0 2.667 -0.000 0.000 0.00 0.00 O+0 HETATM 20 C UNK 0 1.334 -2.310 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -0.000 -3.080 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 2.667 -3.080 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 4.001 -2.310 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 5.335 -3.080 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 6.668 -2.310 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 6.668 -0.770 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 8.002 -3.080 0.000 0.00 0.00 C+0 HETATM 28 O UNK 0 8.002 -4.620 0.000 0.00 0.00 O+0 HETATM 29 C UNK 0 9.336 -2.310 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 10.669 -3.080 0.000 0.00 0.00 C+0 HETATM 31 O UNK 0 10.669 -4.620 0.000 0.00 0.00 O+0 HETATM 32 C UNK 0 12.003 -2.310 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 12.003 -0.770 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 13.337 -3.080 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 13.337 -4.620 0.000 0.00 0.00 O+0 HETATM 36 C UNK 0 14.670 -2.310 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 16.004 -3.080 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 17.338 -2.310 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 17.338 -0.770 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 18.672 -3.080 0.000 0.00 0.00 C+0 HETATM 41 O UNK 0 18.672 -4.620 0.000 0.00 0.00 O+0 HETATM 42 C UNK 0 20.005 -2.310 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 20.005 -0.770 0.000 0.00 0.00 C+0 HETATM 44 O UNK 0 21.339 -1.540 0.000 0.00 0.00 O+0 HETATM 45 O UNK 0 18.672 0.000 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 18.672 1.540 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 17.338 2.310 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 16.004 1.540 0.000 0.00 0.00 C+0 HETATM 49 O UNK 0 16.004 3.080 0.000 0.00 0.00 O+0 HETATM 50 C UNK 0 17.338 3.850 0.000 0.00 0.00 C+0 HETATM 51 O UNK 0 17.338 5.390 0.000 0.00 0.00 O+0 HETATM 52 C UNK 0 18.672 3.080 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 20.005 3.850 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 21.339 3.080 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 22.673 3.850 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 24.006 3.080 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 25.340 3.850 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 26.674 3.080 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 28.007 3.850 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 29.341 3.080 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 30.675 3.850 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 29.341 1.540 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 14.670 2.310 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 13.337 1.540 0.000 0.00 0.00 C+0 HETATM 65 O UNK 0 13.337 -0.000 0.000 0.00 0.00 O+0 HETATM 66 C UNK 0 12.003 2.310 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 10.669 1.540 0.000 0.00 0.00 C+0 HETATM 68 O UNK 0 10.669 -0.000 0.000 0.00 0.00 O+0 HETATM 69 C UNK 0 9.336 2.310 0.000 0.00 0.00 C+0 HETATM 70 C UNK 0 8.002 1.540 0.000 0.00 0.00 C+0 HETATM 71 O UNK 0 8.002 -0.000 0.000 0.00 0.00 O+0 HETATM 72 C UNK 0 6.668 2.310 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 6.668 3.850 0.000 0.00 0.00 C+0 HETATM 74 C UNK 0 5.335 1.540 0.000 0.00 0.00 C+0 HETATM 75 C UNK 0 4.001 2.310 0.000 0.00 0.00 C+0 HETATM 76 C UNK 0 2.667 1.540 0.000 0.00 0.00 C+0 HETATM 77 C UNK 0 1.334 2.310 0.000 0.00 0.00 C+0 HETATM 78 C UNK 0 1.334 3.850 0.000 0.00 0.00 C+0 HETATM 79 C UNK 0 20.005 2.310 0.000 0.00 0.00 C+0 HETATM 80 C UNK 0 21.339 1.540 0.000 0.00 0.00 C+0 HETATM 81 O UNK 0 22.673 2.310 0.000 0.00 0.00 O+0 HETATM 82 C UNK 0 21.339 -0.000 0.000 0.00 0.00 C+0 HETATM 83 O UNK 0 22.673 -0.770 0.000 0.00 0.00 O+0 CONECT 1 2 CONECT 2 1 3 CONECT 3 2 4 5 CONECT 4 3 CONECT 5 3 6 CONECT 6 5 7 CONECT 7 6 8 CONECT 8 7 9 CONECT 9 8 10 CONECT 10 9 11 CONECT 11 10 12 CONECT 12 11 13 CONECT 13 12 14 CONECT 14 13 15 16 CONECT 15 14 CONECT 16 14 17 77 CONECT 17 16 18 CONECT 18 17 19 20 CONECT 19 18 CONECT 20 18 21 22 CONECT 21 20 CONECT 22 20 23 CONECT 23 22 24 CONECT 24 23 25 CONECT 25 24 26 27 CONECT 26 25 CONECT 27 25 28 29 CONECT 28 27 CONECT 29 27 30 CONECT 30 29 31 32 CONECT 31 30 CONECT 32 30 33 34 CONECT 33 32 CONECT 34 32 35 36 CONECT 35 34 CONECT 36 34 37 CONECT 37 36 38 CONECT 38 37 39 40 CONECT 39 38 CONECT 40 38 41 42 CONECT 41 40 CONECT 42 40 43 CONECT 43 42 44 45 82 CONECT 44 43 CONECT 45 43 46 CONECT 46 45 47 79 CONECT 47 46 48 CONECT 48 47 49 63 CONECT 49 48 50 CONECT 50 49 51 52 CONECT 51 50 CONECT 52 50 53 CONECT 53 52 54 CONECT 54 53 55 CONECT 55 54 56 CONECT 56 55 57 CONECT 57 56 58 CONECT 58 57 59 CONECT 59 58 60 CONECT 60 59 61 62 CONECT 61 60 CONECT 62 60 CONECT 63 48 64 CONECT 64 63 65 66 CONECT 65 64 CONECT 66 64 67 CONECT 67 66 68 69 CONECT 68 67 CONECT 69 67 70 CONECT 70 69 71 72 CONECT 71 70 CONECT 72 70 73 74 CONECT 73 72 CONECT 74 72 75 CONECT 75 74 76 CONECT 76 75 77 CONECT 77 76 16 78 CONECT 78 77 CONECT 79 46 80 CONECT 80 79 81 82 CONECT 81 80 CONECT 82 80 43 83 CONECT 83 82 MASTER 0 0 0 0 0 0 0 0 83 0 168 0 END 3D PDB for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate)SMILES for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate)CNC(=N)NCCCC=CCCC[C@H](C)[C@@H]1OC(=O)C(C)=CC=CC(C)C(O)CC(O)C(C)C(O)CC[C@H](C)[C@@H](O)C[C@@]2(O)O[C@H](C[C@@H](O)[C@@H]2O)C[C@H](C[C@H](O)C[C@@H](O)C[C@H](O)C(C)=CC=CC1C)OC(=O)CCCCCCCCC(C)C INCHI for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate)InChI=1S/C65H115N3O15/c1-42(2)25-19-15-11-12-17-21-31-60(77)81-52-36-50(69)35-51(70)37-55(72)43(3)27-23-29-47(7)61(46(6)26-20-16-13-14-18-22-34-68-64(66)67-10)82-63(79)48(8)30-24-28-44(4)56(73)40-57(74)49(9)54(71)33-32-45(5)59(76)41-65(80)62(78)58(75)39-53(38-52)83-65/h13-14,23-24,27-30,42,44-47,49-59,61-62,69-76,78,80H,11-12,15-22,25-26,31-41H2,1-10H3,(H3,66,67,68)/t44?,45-,46-,47?,49?,50+,51+,52-,53-,54?,55-,56?,57?,58+,59-,61-,62-,65+/m0/s1 Structure for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate)3D Structure for NP0321604 ((1r,3s,5r,7r,9s,15s,30s,31s,33r,34s,35r)-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(2s)-10-(n'-methylcarbamimidamido)dec-6-en-2-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl 10-methylundecanoate) | |||||||||||||||
Synonyms |
| |||||||||||||||
Chemical Formula | C65H115N3O15 | |||||||||||||||
Average Mass | 1178.6410 Da | |||||||||||||||
Monoisotopic Mass | 1177.83282 Da | |||||||||||||||
IUPAC Name | Not Available | |||||||||||||||
Traditional Name | Not Available | |||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||
SMILES | CNC(=N)NCCCC=CCCC[C@H](C)[C@@H]1OC(=O)C(C)=CC=CC(C)C(O)CC(O)C(C)C(O)CC[C@H](C)[C@@H](O)C[C@@]2(O)O[C@H](C[C@@H](O)[C@@H]2O)C[C@H](C[C@H](O)C[C@@H](O)C[C@H](O)C(C)=CC=CC1C)OC(=O)CCCCCCCCC(C)C | |||||||||||||||
InChI Identifier | InChI=1S/C65H115N3O15/c1-42(2)25-19-15-11-12-17-21-31-60(77)81-52-36-50(69)35-51(70)37-55(72)43(3)27-23-29-47(7)61(46(6)26-20-16-13-14-18-22-34-68-64(66)67-10)82-63(79)48(8)30-24-28-44(4)56(73)40-57(74)49(9)54(71)33-32-45(5)59(76)41-65(80)62(78)58(75)39-53(38-52)83-65/h13-14,23-24,27-30,42,44-47,49-59,61-62,69-76,78,80H,11-12,15-22,25-26,31-41H2,1-10H3,(H3,66,67,68)/t44?,45-,46-,47?,49?,50+,51+,52-,53-,54?,55-,56?,57?,58+,59-,61-,62-,65+/m0/s1 | |||||||||||||||
InChI Key | UEVRSRIAXOGKNQ-QEYPXDRPSA-N | |||||||||||||||
Experimental Spectra | ||||||||||||||||
Not Available | ||||||||||||||||
Predicted Spectra | ||||||||||||||||
Not Available | ||||||||||||||||
Chemical Shift Submissions | ||||||||||||||||
Not Available | ||||||||||||||||
Species | ||||||||||||||||
Species of Origin | Not Available | |||||||||||||||
Chemical Taxonomy | ||||||||||||||||
Description | Belongs to the class of organic compounds known as macrolides and analogues. These are organic compounds containing a lactone ring of at least twelve members. | |||||||||||||||
Kingdom | Organic compounds | |||||||||||||||
Super Class | Phenylpropanoids and polyketides | |||||||||||||||
Class | Macrolides and analogues | |||||||||||||||
Sub Class | Not Available | |||||||||||||||
Direct Parent | Macrolides and analogues | |||||||||||||||
Alternative Parents |
| |||||||||||||||
Substituents |
| |||||||||||||||
Molecular Framework | Aliphatic heteropolycyclic compounds | |||||||||||||||
External Descriptors | Not Available | |||||||||||||||
Physical Properties | ||||||||||||||||
State | Not Available | |||||||||||||||
Experimental Properties |
| |||||||||||||||
Predicted Properties |
| |||||||||||||||
External Links | ||||||||||||||||
HMDB ID | Not Available | |||||||||||||||
DrugBank ID | Not Available | |||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||
FoodDB ID | Not Available | |||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||
Chemspider ID | Not Available | |||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||
BioCyc ID | Not Available | |||||||||||||||
BiGG ID | Not Available | |||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||
METLIN ID | Not Available | |||||||||||||||
PubChem Compound | 139583938 | |||||||||||||||
PDB ID | Not Available | |||||||||||||||
ChEBI ID | Not Available | |||||||||||||||
Good Scents ID | Not Available | |||||||||||||||
References | ||||||||||||||||
General References |
|