NP-MRD: Showing NP-Card for [(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid (NP0204375)

Jump To Section:

Identification Spectra BioTaxonomy ChemoTaxonomy Physical properties Links References XML

Record Information

Version

2.0

Created at

2022-09-05 00:02:18 UTC

Updated at

2022-09-05 00:02:18 UTC

NP-MRD ID

NP0204375

Secondary Accession Numbers

None

Natural Product Identification

Common Name

[(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid

Description

Fasciculic acid C, also known as fasciculate C, belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Fasciculic acid C is a moderately basic compound (based on its pKa). Outside of the human body, fasciculic acid C has been detected, but not quantified in, mushrooms. [(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid is found in Hypholoma fasciculare. This could make fasciculic acid C a potential biomarker for the consumption of these foods.

Structure

MOL 3D MOL SDF PDB SMILES InChI


  Mrv0541 05061309082D          

 50 53  0  0  0  0            999 V2000
    1.5685    4.3109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5660    3.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0664   -0.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6380    0.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7030    2.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4798    1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1983    3.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0361    1.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6962    0.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3035    3.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5086    4.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8790    0.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7301    2.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0473    3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3323    1.6941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2920    1.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6041    1.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5404    2.5654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7601    0.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8244    1.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0071    1.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5008    2.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5838    3.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0520    2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1041    2.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0404    3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5681   -0.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1444    1.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4162    1.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2919    0.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7283    2.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3844    2.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8526    3.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7509   -0.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0723    1.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7601    2.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3959    2.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6762    2.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9480    0.8185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1353    2.4321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6359    1.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0745   -0.7375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4247    0.7729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6965    2.2251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1041    0.4782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0116   -0.4429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4480    1.6442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8637   -1.0162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4415    1.4029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1965    3.0509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 11 10  1  0  0  0  0
 12  9  1  0  0  0  0
 14 13  1  0  0  0  0
 21  9  1  0  0  0  0
 21 20  1  0  0  0  0
 22 13  1  0  0  0  0
 22 21  1  0  0  0  0
 23 10  1  0  0  0  0
 24 15  1  0  0  0  0
 24 23  2  0  0  0  0
 25 16  1  0  0  0  0
 26 11  1  0  0  0  0
 27 12  1  0  0  0  0
 28 15  1  0  0  0  0
 29 17  1  0  0  0  0
 30 19  1  0  0  0  0
 31 18  1  0  0  0  0
 32 25  1  0  0  0  0
 33  1  1  0  0  0  0
 33  2  1  0  0  0  0
 33 26  1  0  0  0  0
 33 32  1  0  0  0  0
 34  3  1  0  0  0  0
 34  4  1  0  0  0  0
 34 27  1  0  0  0  0
 35  5  1  0  0  0  0
 35 17  1  0  0  0  0
 35 18  1  0  0  0  0
 36  6  1  0  0  0  0
 36 16  1  0  0  0  0
 36 24  1  0  0  0  0
 36 26  1  0  0  0  0
 37  7  1  0  0  0  0
 37 14  1  0  0  0  0
 37 23  1  0  0  0  0
 38  8  1  0  0  0  0
 38 22  1  0  0  0  0
 38 28  1  0  0  0  0
 38 37  1  0  0  0  0
 39 19  1  0  0  0  0
 39 29  2  0  0  0  0
 40 20  1  0  0  0  0
 41 25  1  0  0  0  0
 42 27  1  0  0  0  0
 43 28  1  0  0  0  0
 44 29  1  0  0  0  0
 45 30  2  0  0  0  0
 46 30  1  0  0  0  0
 47 31  2  0  0  0  0
 48 34  1  0  0  0  0
 49 35  1  0  0  0  0
 50 31  1  0  0  0  0
 50 32  1  0  0  0  0
M  END

     RDKit          3D

113116  0  0  0  0  0  0  0  0999 V2000
   -8.3677    0.3008    1.5828 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9817    0.4017    0.2095 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7824    1.7560   -0.4214 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4174    0.3949    0.4661 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7557   -0.7299   -0.6812 C   0  0  1  0  0  0  0  0  0  0  0  0
   -9.4648   -0.5949   -1.8916 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4986   -1.4692   -0.7756 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4195   -1.0741   -1.6973 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7025    0.2129   -1.5704 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.9169    0.5048   -2.8377 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8371    0.2387   -3.8932 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9824    0.4169   -0.2889 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.7705    1.9320   -0.1765 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3697    2.0759    0.2993 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0329    0.7307    0.9580 C   0  0  2  0  0  0  0  0  0  0  0  0
   -3.5075    0.8308    2.3678 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5821    0.6041    0.9067 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8891    0.1354   -0.1357 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7046   -0.3122   -1.2926 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9208   -1.0524   -0.7469 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.3135   -2.0995    0.0245 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8045   -0.2941    0.1307 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.2578   -1.3304    1.2176 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5924    0.0578   -0.1921 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.0172    1.3522   -0.9181 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9700   -1.0531   -1.0985 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4245   -1.4241   -1.1233 C   0  0  2  0  0  0  0  0  0  0  0  0
    2.4929   -2.8180   -1.1992 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1572   -0.8605    0.0559 C   0  0  2  0  0  0  0  0  0  0  0  0
    4.4858   -1.2434    0.1657 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6059   -0.4745    0.0333 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3259    0.7295   -0.2230 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9911   -0.9916    0.1734 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0164    0.0947   -0.0510 C   0  0  1  0  0  0  0  0  0  0  0  0
    7.9322    0.7050   -1.4112 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9073    1.0421    0.9658 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3866   -0.5615    0.0966 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4809    0.4266   -0.0609 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6125    1.1339   -1.2437 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3306    0.6564    0.8792 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3979    1.6365    0.6927 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5809    0.9809    0.0389 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5652   -0.2459   -0.2674 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7274    1.7001   -0.2495 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3442   -0.9887    1.3021 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7600   -2.3250    1.5638 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2603   -0.5729    2.4434 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2068    0.0061    1.1754 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.2319   -0.0786    2.3094 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7914    1.0267    2.0887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9332   -0.6860    1.7875 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1390    0.4756    2.3841 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6303    1.1236    1.6980 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5868    2.4598   -0.0928 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7685    1.6745   -1.5099 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8264    2.2292   -0.0958 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7120   -0.5541    0.5163 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5135   -1.5593   -0.1679 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4433   -0.4895   -1.7132 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7673   -2.5808   -0.9553 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9932   -1.5736    0.2487 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7185   -1.9569   -1.7626 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8498   -1.0768   -2.7718 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4871    1.0002   -1.6031 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0198   -0.0358   -3.0132 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6973    1.5968   -2.9615 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5517   -0.5797   -4.3342 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7798    0.2334    0.5026 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9131    2.4530   -1.1346 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4856    2.3965    0.5280 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6448    2.3634   -0.4710 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3303    2.8912    1.0808 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6250    0.8596    2.4496 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0649    0.1073    3.0768 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2069    1.8483    2.7606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0449    0.5492   -1.9089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2092   -1.0571   -1.9433 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3561   -1.6209   -1.5793 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5385   -1.7741    0.5271 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4388   -1.5160    1.9340 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4237   -2.3143    0.7004 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1268   -0.9657    1.7510 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1745    1.9335   -1.2849 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5422    1.9836   -0.1661 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6948    1.1567   -1.7516 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7448   -0.7019   -2.1535 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3083   -1.9336   -0.9622 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9365   -1.0474   -2.0327 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9013   -3.1515   -2.0130 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2341    0.2365   -0.1606 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1310   -1.7835   -0.5798 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1722   -1.4079    1.1859 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6454    0.1461   -2.0807 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9529    0.6806   -1.8882 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3533    1.7330   -1.3469 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3806    0.7276    1.7374 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4865   -1.4067   -0.6296 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4605   -1.0308    1.1135 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.0748    0.7626   -2.0636 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.0025    2.4300    0.0281 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.7266    2.0525    1.6719 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.3406    1.4384   -1.0104 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2602   -3.1782    1.0951 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8392   -2.5133    2.6764 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6781   -2.4327    1.3431 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6889    0.4380    2.2356 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7483   -0.5075    3.4078 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0568   -1.3341    2.5286 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7198    1.0070    1.3308 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2933   -1.0152    2.4311 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7406    0.1730    3.2625 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3383    1.1422    3.0153 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2707    1.9925    1.8928 H   0  0  0  0  0  0  0  0  0  0  0  0
 35 34  1  0
 34 36  1  1
 34 33  1  0
 33 31  1  0
 31 32  2  0
 31 30  1  0
 30 29  1  0
 29 27  1  0
 27 28  1  0
 27 26  1  0
 26 24  1  0
 24 25  1  6
 24 48  1  0
 48 49  1  0
 49 50  1  0
 50 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  1
 22 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  1
 12  9  1  0
  9 10  1  0
 10 11  1  0
  9  8  1  0
  8  7  1  0
  7  5  1  0
  5  6  1  0
  5  2  1  0
  2  1  1  0
  2  3  1  0
  2  4  1  0
 48 45  1  0
 45 46  1  0
 45 47  1  0
 34 37  1  0
 37 38  1  0
 38 39  1  0
 38 40  2  0
 40 41  1  0
 41 42  1  0
 42 44  1  0
 42 43  2  0
 45 29  1  0
 18 24  1  0
 15 22  1  0
 15 17  1  0
 35 93  1  0
 35 94  1  0
 35 95  1  0
 36 96  1  0
 33 91  1  0
 33 92  1  0
 29 90  1  6
 27 88  1  6
 28 89  1  0
 26 86  1  0
 26 87  1  0
 25 83  1  0
 25 84  1  0
 25 85  1  0
 48109  1  1
 49110  1  0
 49111  1  0
 50112  1  0
 50113  1  0
 19 76  1  0
 19 77  1  0
 20 78  1  6
 21 79  1  0
 23 80  1  0
 23 81  1  0
 23 82  1  0
 12 68  1  1
 13 69  1  0
 13 70  1  0
 14 71  1  0
 14 72  1  0
 16 73  1  0
 16 74  1  0
 16 75  1  0
  9 64  1  1
 10 65  1  0
 10 66  1  0
 11 67  1  0
  8 62  1  0
  8 63  1  0
  7 60  1  0
  7 61  1  0
  5 58  1  1
  6 59  1  0
  1 51  1  0
  1 52  1  0
  1 53  1  0
  3 54  1  0
  3 55  1  0
  3 56  1  0
  4 57  1  0
 46103  1  0
 46104  1  0
 46105  1  0
 47106  1  0
 47107  1  0
 47108  1  0
 37 97  1  0
 37 98  1  0
 39 99  1  0
 41100  1  0
 41101  1  0
 44102  1  0
M  END


  Mrv0541 05061309082D          

 50 53  0  0  0  0            999 V2000
    1.5685    4.3109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5660    3.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0664   -0.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6380    0.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7030    2.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4798    1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1983    3.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0361    1.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6962    0.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3035    3.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5086    4.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8790    0.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7301    2.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0473    3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3323    1.6941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2920    1.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6041    1.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5404    2.5654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7601    0.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8244    1.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0071    1.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5008    2.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5838    3.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0520    2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1041    2.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0404    3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5681   -0.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1444    1.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4162    1.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2919    0.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7283    2.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3844    2.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8526    3.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7509   -0.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0723    1.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7601    2.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3959    2.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6762    2.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9480    0.8185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1353    2.4321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6359    1.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0745   -0.7375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4247    0.7729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6965    2.2251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1041    0.4782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0116   -0.4429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4480    1.6442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8637   -1.0162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4415    1.4029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1965    3.0509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 11 10  1  0  0  0  0
 12  9  1  0  0  0  0
 14 13  1  0  0  0  0
 21  9  1  0  0  0  0
 21 20  1  0  0  0  0
 22 13  1  0  0  0  0
 22 21  1  0  0  0  0
 23 10  1  0  0  0  0
 24 15  1  0  0  0  0
 24 23  2  0  0  0  0
 25 16  1  0  0  0  0
 26 11  1  0  0  0  0
 27 12  1  0  0  0  0
 28 15  1  0  0  0  0
 29 17  1  0  0  0  0
 30 19  1  0  0  0  0
 31 18  1  0  0  0  0
 32 25  1  0  0  0  0
 33  1  1  0  0  0  0
 33  2  1  0  0  0  0
 33 26  1  0  0  0  0
 33 32  1  0  0  0  0
 34  3  1  0  0  0  0
 34  4  1  0  0  0  0
 34 27  1  0  0  0  0
 35  5  1  0  0  0  0
 35 17  1  0  0  0  0
 35 18  1  0  0  0  0
 36  6  1  0  0  0  0
 36 16  1  0  0  0  0
 36 24  1  0  0  0  0
 36 26  1  0  0  0  0
 37  7  1  0  0  0  0
 37 14  1  0  0  0  0
 37 23  1  0  0  0  0
 38  8  1  0  0  0  0
 38 22  1  0  0  0  0
 38 28  1  0  0  0  0
 38 37  1  0  0  0  0
 39 19  1  0  0  0  0
 39 29  2  0  0  0  0
 40 20  1  0  0  0  0
 41 25  1  0  0  0  0
 42 27  1  0  0  0  0
 43 28  1  0  0  0  0
 44 29  1  0  0  0  0
 45 30  2  0  0  0  0
 46 30  1  0  0  0  0
 47 31  2  0  0  0  0
 48 34  1  0  0  0  0
 49 35  1  0  0  0  0
 50 31  1  0  0  0  0
 50 32  1  0  0  0  0
M  END
> <DATABASE_ID>
NP0204375

> <DATABASE_NAME>
NP-MRD

> <SMILES>
CC(O)(CC(=O)OC1C(O)CC2(C)C(CCC3=C2CC(O)C2(C)C(CCC32C)C(CO)CCC(O)C(C)(C)O)C1(C)C)C\C(O)=N\CC(O)=O

> <INCHI_IDENTIFIER>
InChI=1S/C38H63NO11/c1-33(2)26-11-10-23-24(15-28(43)38(8)22(13-14-37(23,38)7)21(20-40)9-12-27(42)34(3,4)48)36(26,6)16-25(41)32(33)50-31(47)18-35(5,49)17-29(44)39-19-30(45)46/h21-22,25-28,32,40-43,48-49H,9-20H2,1-8H3,(H,39,44)(H,45,46)

> <INCHI_KEY>
IOMBMOCSWVAYQU-UHFFFAOYSA-N

> <FORMULA>
C38H63NO11

> <MOLECULAR_WEIGHT>
709.9069

> <EXACT_MASS>
709.440111863

> <JCHEM_ACCEPTOR_COUNT>
11

> <JCHEM_AVERAGE_POLARIZABILITY>
79.02038340032352

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-[(Z)-(5-{[4,16-dihydroxy-2,6,6,11,15-pentamethyl-14-(1,5,6-trihydroxy-6-methylheptan-2-yl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-5-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid

> <ALOGPS_LOGP>
2.50

> <JCHEM_LOGP>
1.5323449206666662

> <ALOGPS_LOGS>
-4.52

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
6.848805905165401

> <JCHEM_PKA_STRONGEST_ACIDIC>
3.5298559069251016

> <JCHEM_PKA_STRONGEST_BASIC>
1.5288873847652686

> <JCHEM_POLAR_SURFACE_AREA>
217.56999999999996

> <JCHEM_REFRACTIVITY>
185.5917000000001

> <JCHEM_ROTATABLE_BOND_COUNT>
14

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
2.13e-02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
[(Z)-(5-{[4,16-dihydroxy-2,6,6,11,15-pentamethyl-14-(1,5,6-trihydroxy-6-methylheptan-2-yl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-5-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       2.928   8.047   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       4.790   7.374   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       0.124  -0.582   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -1.191   1.154   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      10.646   4.604   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       0.896   3.433   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -2.237   7.012   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -3.801   2.683   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -5.033   1.476   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -0.567   7.236   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       0.949   7.508   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -3.507   1.266   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -5.096   5.598   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -3.822   6.462   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -0.620   3.162   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       2.412   3.704   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      10.461   2.434   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       8.475   4.789   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      14.486   1.799   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      -7.139   3.113   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      -5.613   2.903   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      -4.668   4.119   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -1.090   5.788   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      -0.097   4.611   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       3.928   3.975   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       1.942   6.330   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      -2.927  -0.161   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      -2.136   2.891   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      11.977   2.705   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      15.478   0.622   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0       6.959   4.518   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0       4.451   5.424   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0       3.458   6.601   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0      -1.402  -0.371   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0       9.468   3.611   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0       1.419   4.882   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0      -2.606   5.517   0.000  0.00  0.00           C+0
HETATM   38  C   UNK     0      -3.129   4.069   0.000  0.00  0.00           C+0
HETATM   39  N   UNK     0      12.970   1.528   0.000  0.00  0.00           N+0
HETATM   40  O   UNK     0      -7.719   4.540   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       4.920   2.798   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0      -3.872  -1.377   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0      -2.659   1.443   0.000  0.00  0.00           O+0
HETATM   44  O   UNK     0      12.500   4.154   0.000  0.00  0.00           O+0
HETATM   45  O   UNK     0      16.994   0.893   0.000  0.00  0.00           O+0
HETATM   46  O   UNK     0      14.955  -0.827   0.000  0.00  0.00           O+0
HETATM   47  O   UNK     0       6.436   3.069   0.000  0.00  0.00           O+0
HETATM   48  O   UNK     0      -1.612  -1.897   0.000  0.00  0.00           O+0
HETATM   49  O   UNK     0       8.291   2.619   0.000  0.00  0.00           O+0
HETATM   50  O   UNK     0       5.967   5.695   0.000  0.00  0.00           O+0
CONECT    1   33                                                            
CONECT    2   33                                                            
CONECT    3   34                                                            
CONECT    4   34                                                            
CONECT    5   35                                                            
CONECT    6   36                                                            
CONECT    7   37                                                            
CONECT    8   38                                                            
CONECT    9   12   21                                                       
CONECT   10   11   23                                                       
CONECT   11   10   26                                                       
CONECT   12    9   27                                                       
CONECT   13   14   22                                                       
CONECT   14   13   37                                                       
CONECT   15   24   28                                                       
CONECT   16   25   36                                                       
CONECT   17   29   35                                                       
CONECT   18   31   35                                                       
CONECT   19   30   39                                                       
CONECT   20   21   40                                                       
CONECT   21    9   20   22                                                  
CONECT   22   13   21   38                                                  
CONECT   23   10   24   37                                                  
CONECT   24   15   23   36                                                  
CONECT   25   16   32   41                                                  
CONECT   26   11   33   36                                                  
CONECT   27   12   34   42                                                  
CONECT   28   15   38   43                                                  
CONECT   29   17   39   44                                                  
CONECT   30   19   45   46                                                  
CONECT   31   18   47   50                                                  
CONECT   32   25   33   50                                                  
CONECT   33    1    2   26   32                                             
CONECT   34    3    4   27   48                                             
CONECT   35    5   17   18   49                                             
CONECT   36    6   16   24   26                                             
CONECT   37    7   14   23   38                                             
CONECT   38    8   22   28   37                                             
CONECT   39   19   29                                                       
CONECT   40   20                                                            
CONECT   41   25                                                            
CONECT   42   27                                                            
CONECT   43   28                                                            
CONECT   44   29                                                            
CONECT   45   30                                                            
CONECT   46   30                                                            
CONECT   47   31                                                            
CONECT   48   34                                                            
CONECT   49   35                                                            
CONECT   50   31   32                                                       
MASTER        0    0    0    0    0    0    0    0   50    0  106    0
END

View in JSmol

Synonyms

Value	Source
Fasciculate C	Generator
(+)-Fasciculic acid C	HMDB
3-O-(N-Glycyl-3-hydroxy-3-methylglutaryl)fasciculol C	HMDB
2-[(5-{[4,16-dihydroxy-2,6,6,11,15-pentamethyl-14-(1,5,6-trihydroxy-6-methylheptan-2-yl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-5-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetate	Generator
Fasciculic acid C	MeSH

Chemical Formula

C₃₈H₆₃NO₁₁

Average Mass

709.9069 Da

Monoisotopic Mass

709.44011 Da

IUPAC Name

2-[(Z)-(5-{[4,16-dihydroxy-2,6,6,11,15-pentamethyl-14-(1,5,6-trihydroxy-6-methylheptan-2-yl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-5-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid

Traditional Name

[(Z)-(5-{[4,16-dihydroxy-2,6,6,11,15-pentamethyl-14-(1,5,6-trihydroxy-6-methylheptan-2-yl)tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-5-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid

CAS Registry Number

Not Available

SMILES

CC(O)(CC(=O)OC1C(O)CC2(C)C(CCC3=C2CC(O)C2(C)C(CCC32C)C(CO)CCC(O)C(C)(C)O)C1(C)C)C\C(O)=N\CC(O)=O

InChI Identifier

InChI=1S/C38H63NO11/c1-33(2)26-11-10-23-24(15-28(43)38(8)22(13-14-37(23,38)7)21(20-40)9-12-27(42)34(3,4)48)36(26,6)16-25(41)32(33)50-31(47)18-35(5,49)17-29(44)39-19-30(45)46/h21-22,25-28,32,40-43,48-49H,9-20H2,1-8H3,(H,39,44)(H,45,46)

InChI Key

IOMBMOCSWVAYQU-UHFFFAOYSA-N

Experimental Spectra

Not Available

Predicted Spectra

Spectrum Type	Description	Depositor ID	Depositor Organization	Depositor	Deposition Date	View
1D NMR	¹³C NMR Spectrum (1D, 25 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 100 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 252 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 1000 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 50 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 200 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 75 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 300 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 101 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 400 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 126 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 500 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 151 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 600 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 176 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 700 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 201 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 800 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹³C NMR Spectrum (1D, 226 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum
1D NMR	¹H NMR Spectrum (1D, 900 MHz, H₂O, predicted)	Wishart Lab	Wishart Lab	David Wishart	2021-06-20	View Spectrum

Chemical Shift Submissions

Not Available

Species

Species of Origin

Species Name	Source	Reference
Hypholoma fasciculare	LOTUS Database	35616633

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Prenol lipids

Sub Class

Triterpenoids

Direct Parent

Triterpenoids

Alternative Parents

Substituents

Triterpenoid
Pentahydroxy bile acid, alcohol, or derivatives
25-hydroxysteroid
24-hydroxysteroid
Hydroxy bile acid, alcohol, or derivatives
Bile acid, alcohol, or derivatives
21-hydroxysteroid
Steroid ester
2-hydroxysteroid
Hydroxysteroid
12-hydroxysteroid
Steroid
N-acyl-alpha-amino acid
N-acyl-alpha amino acid or derivatives
Alpha-amino acid or derivatives
Fatty acyl
Fatty amide
Dicarboxylic acid or derivatives
N-acyl-amine
Cyclic alcohol
Tertiary alcohol
Carboxamide group
Secondary alcohol
Secondary carboxylic acid amide
Carboxylic acid ester
Polyol
Carboxylic acid derivative
Carboxylic acid
Organonitrogen compound
Organopnictogen compound
Alcohol
Organic oxide
Hydrocarbon derivative
Primary alcohol
Carbonyl group
Organic oxygen compound
Organic nitrogen compound
Organooxygen compound
Aliphatic homopolycyclic compound

Molecular Framework

Aliphatic homopolycyclic compounds

External Descriptors

Not Available

Physical Properties

State

Not Available

Experimental Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Predicted Properties

Property	Value	Source
logP	2.5	ALOGPS
logP	1.53	ChemAxon
logS	-4.5	ALOGPS
pKa (Strongest Acidic)	3.53	ChemAxon
pKa (Strongest Basic)	1.53	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	11	ChemAxon
Hydrogen Donor Count	8	ChemAxon
Polar Surface Area	217.57 Å²	ChemAxon
Rotatable Bond Count	14	ChemAxon
Refractivity	185.59 m³·mol⁻¹	ChemAxon
Polarizability	79.02 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

External Links

HMDB ID

HMDB0036440

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FoodDB ID

FDB015327

KNApSAcK ID

C00034511

Chemspider ID

22936645

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

45783123

PDB ID

Not Available

ChEBI ID

Not Available

Good Scents ID

Not Available

References

General References

LOTUS database [Link]

Showing NP-Card for [(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid (NP0204375)

MOL for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)

3D MOL for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)

3D SDF for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)

3D-SDF for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)

PDB for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)

3D PDB for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)

SMILES for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)

INCHI for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)

Structure for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)

3D Structure for NP0204375 ([(5-{[8,11-dihydroxy-3a,6,6,9a,11a-pentamethyl-1-(1,5,6-trihydroxy-6-methylheptan-2-yl)-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-7-yl]oxy}-1,3-dihydroxy-3-methyl-5-oxopentylidene)amino]acetic acid)