Showing NP-Card for Aquacobalamin (NP0087058)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Created at | 2022-05-11 16:38:46 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Updated at | 2022-05-11 16:38:46 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
NP-MRD ID | NP0087058 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Natural Product Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Aquacobalamin | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Aquacobalamin belongs to the class of organic compounds known as lineolic acids and derivatives. These are derivatives of lineolic acid. Lineolic acid is a polyunsaturated omega-6 18 carbon long fatty acid, with two CC double bonds at the 9- and 12-positions. Aquacobalamin is possibly neutral. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for NP0087058 (Aquacobalamin)Mrv0541 02251206292D 101112 0 0 1 0 999 V2000 2.8139 -2.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1460 -1.5847 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6391 -0.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8221 -1.0475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.3152 -0.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6401 0.3848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4982 -0.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0087 0.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8256 0.0271 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4705 0.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3978 0.6213 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2514 1.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8825 2.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6654 1.7728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7161 2.8404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1399 0.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0263 -0.5563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.2141 -0.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9070 -1.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0523 -1.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1355 -2.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9600 -2.5388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.1887 -3.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2332 -3.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9975 -3.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9387 -2.3974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.7031 -2.0873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7917 -1.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6051 -0.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4034 -0.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5913 -0.4444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.2029 0.2834 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6560 0.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7750 0.8776 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3680 1.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2401 1.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8785 2.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3522 3.0699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.0568 2.4672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5169 0.5171 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2836 0.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0048 0.4868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7227 0.8932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7296 1.7181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.4335 0.4747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5438 -2.0641 0.0000 Co 0 3 0 0 0 0 0 0 0 0 0 0 -0.2577 -2.8309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7971 -4.3837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.9726 -4.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6917 -3.6357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.8991 -3.4072 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2483 -3.9140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5651 -3.4517 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7686 -3.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6354 -4.6004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7936 -2.6591 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2869 -2.0083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4698 -2.1219 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 4.5122 -1.3687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8348 -1.3098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9629 -1.4711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6182 -2.6315 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0870 -1.8895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3424 -3.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0256 -3.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7675 -3.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8264 -2.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6222 -2.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1432 -1.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1968 -1.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4013 -2.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2343 -2.7184 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8510 -2.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9433 -3.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7318 -2.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3848 -3.4219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.8416 -2.1005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7982 -3.4186 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1328 -4.1941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5738 -4.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8754 -5.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3613 -6.3079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.6911 -5.7856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5054 -3.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0009 -4.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0422 -4.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8546 -3.2869 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0207 -3.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2583 -4.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0669 -4.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6121 -3.9358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.3306 -5.3366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1376 -0.6946 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7886 1.5227 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9861 -0.2345 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0762 -2.4941 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8884 -3.0563 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4814 -2.1288 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3335 -3.0866 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4904 -4.1526 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6146 -2.5174 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 1 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 2 0 0 0 0 5 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 6 0 0 0 9 11 1 0 0 0 0 11 12 1 6 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 13 15 2 0 0 0 0 11 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 9 18 1 0 0 0 0 18 19 2 0 0 0 0 19 20 1 0 0 0 0 19 21 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 24 25 1 0 0 0 0 25 26 2 0 0 0 0 26 27 1 0 0 0 0 27 28 2 0 0 0 0 28 29 1 0 0 0 0 28 30 1 0 0 0 0 30 31 2 0 0 0 0 31 32 1 0 0 0 0 16 32 1 0 0 0 0 32 33 1 1 0 0 0 32 34 1 0 0 0 0 34 35 1 1 0 0 0 34 36 1 6 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 39 2 0 0 0 0 34 40 1 0 0 0 0 30 40 1 0 0 0 0 40 41 1 1 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 43 45 2 0 0 0 0 31 46 1 0 0 0 0 17 46 1 0 0 0 0 22 46 1 0 0 0 0 26 46 1 0 0 0 0 46 47 1 0 0 0 0 46 48 1 0 0 0 0 48 49 2 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 6 0 0 0 52 53 1 0 0 0 0 53 54 1 6 0 0 0 54 55 1 0 0 0 0 53 56 1 0 0 0 0 56 57 1 1 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 58 60 2 0 0 0 0 58 61 1 0 0 0 0 2 61 1 0 0 0 0 56 62 1 0 0 0 0 51 62 1 0 0 0 0 62 63 1 1 0 0 0 50 64 1 0 0 0 0 64 65 2 0 0 0 0 48 65 1 0 0 0 0 65 66 1 0 0 0 0 66 67 2 0 0 0 0 67 68 1 0 0 0 0 67 69 1 0 0 0 0 69 70 1 0 0 0 0 69 71 2 0 0 0 0 64 71 1 0 0 0 0 27 72 1 0 0 0 0 72 73 1 1 0 0 0 72 74 1 6 0 0 0 74 75 1 0 0 0 0 75 76 1 0 0 0 0 75 77 2 0 0 0 0 72 78 1 0 0 0 0 25 78 1 0 0 0 0 78 79 1 1 0 0 0 79 80 1 0 0 0 0 80 81 1 0 0 0 0 81 82 1 0 0 0 0 81 83 2 0 0 0 0 23 84 1 0 0 0 0 84 85 1 0 0 0 0 84 86 1 0 0 0 0 84 87 1 0 0 0 0 21 87 1 0 0 0 0 87 88 1 1 0 0 0 88 89 1 0 0 0 0 89 90 1 0 0 0 0 90 91 1 0 0 0 0 90 92 2 0 0 0 0 2 93 1 1 0 0 0 11 94 1 1 0 0 0 40 95 1 6 0 0 0 51 96 1 6 0 0 0 53 97 1 1 0 0 0 56 98 1 6 0 0 0 62 99 1 6 0 0 0 78100 1 6 0 0 0 87101 1 6 0 0 0 M CHG 1 46 1 M RAD 4 22 2 26 2 31 2 48 2 M END 3D SDF for NP0087058 (Aquacobalamin)Mrv0541 02251206292D 101112 0 0 1 0 999 V2000 2.8139 -2.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1460 -1.5847 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6391 -0.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8221 -1.0475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.3152 -0.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6401 0.3848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4982 -0.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0087 0.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8256 0.0271 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4705 0.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3978 0.6213 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2514 1.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8825 2.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6654 1.7728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7161 2.8404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1399 0.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0263 -0.5563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.2141 -0.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9070 -1.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0523 -1.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1355 -2.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9600 -2.5388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.1887 -3.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2332 -3.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9975 -3.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9387 -2.3974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.7031 -2.0873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7917 -1.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6051 -0.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4034 -0.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5913 -0.4444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.2029 0.2834 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6560 0.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7750 0.8776 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3680 1.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2401 1.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8785 2.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3522 3.0699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.0568 2.4672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5169 0.5171 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2836 0.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0048 0.4868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7227 0.8932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7296 1.7181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.4335 0.4747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5438 -2.0641 0.0000 Co 0 3 0 0 0 0 0 0 0 0 0 0 -0.2577 -2.8309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7971 -4.3837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.9726 -4.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6917 -3.6357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.8991 -3.4072 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2483 -3.9140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5651 -3.4517 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.7686 -3.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6354 -4.6004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7936 -2.6591 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2869 -2.0083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4698 -2.1219 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 4.5122 -1.3687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8348 -1.3098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9629 -1.4711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6182 -2.6315 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0870 -1.8895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3424 -3.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0256 -3.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7675 -3.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8264 -2.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6222 -2.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1432 -1.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1968 -1.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4013 -2.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2343 -2.7184 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8510 -2.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9433 -3.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7318 -2.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3848 -3.4219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.8416 -2.1005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7982 -3.4186 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1328 -4.1941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5738 -4.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8754 -5.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3613 -6.3079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.6911 -5.7856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5054 -3.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0009 -4.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0422 -4.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8546 -3.2869 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0207 -3.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2583 -4.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0669 -4.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6121 -3.9358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.3306 -5.3366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1376 -0.6946 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7886 1.5227 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9861 -0.2345 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0762 -2.4941 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8884 -3.0563 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4814 -2.1288 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3335 -3.0866 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4904 -4.1526 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6146 -2.5174 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 1 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 2 0 0 0 0 5 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 6 0 0 0 9 11 1 0 0 0 0 11 12 1 6 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 13 15 2 0 0 0 0 11 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 9 18 1 0 0 0 0 18 19 2 0 0 0 0 19 20 1 0 0 0 0 19 21 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 24 25 1 0 0 0 0 25 26 2 0 0 0 0 26 27 1 0 0 0 0 27 28 2 0 0 0 0 28 29 1 0 0 0 0 28 30 1 0 0 0 0 30 31 2 0 0 0 0 31 32 1 0 0 0 0 16 32 1 0 0 0 0 32 33 1 1 0 0 0 32 34 1 0 0 0 0 34 35 1 1 0 0 0 34 36 1 6 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 37 39 2 0 0 0 0 34 40 1 0 0 0 0 30 40 1 0 0 0 0 40 41 1 1 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 43 45 2 0 0 0 0 31 46 1 0 0 0 0 17 46 1 0 0 0 0 22 46 1 0 0 0 0 26 46 1 0 0 0 0 46 47 1 0 0 0 0 46 48 1 0 0 0 0 48 49 2 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 6 0 0 0 52 53 1 0 0 0 0 53 54 1 6 0 0 0 54 55 1 0 0 0 0 53 56 1 0 0 0 0 56 57 1 1 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 58 60 2 0 0 0 0 58 61 1 0 0 0 0 2 61 1 0 0 0 0 56 62 1 0 0 0 0 51 62 1 0 0 0 0 62 63 1 1 0 0 0 50 64 1 0 0 0 0 64 65 2 0 0 0 0 48 65 1 0 0 0 0 65 66 1 0 0 0 0 66 67 2 0 0 0 0 67 68 1 0 0 0 0 67 69 1 0 0 0 0 69 70 1 0 0 0 0 69 71 2 0 0 0 0 64 71 1 0 0 0 0 27 72 1 0 0 0 0 72 73 1 1 0 0 0 72 74 1 6 0 0 0 74 75 1 0 0 0 0 75 76 1 0 0 0 0 75 77 2 0 0 0 0 72 78 1 0 0 0 0 25 78 1 0 0 0 0 78 79 1 1 0 0 0 79 80 1 0 0 0 0 80 81 1 0 0 0 0 81 82 1 0 0 0 0 81 83 2 0 0 0 0 23 84 1 0 0 0 0 84 85 1 0 0 0 0 84 86 1 0 0 0 0 84 87 1 0 0 0 0 21 87 1 0 0 0 0 87 88 1 1 0 0 0 88 89 1 0 0 0 0 89 90 1 0 0 0 0 90 91 1 0 0 0 0 90 92 2 0 0 0 0 2 93 1 1 0 0 0 11 94 1 1 0 0 0 40 95 1 6 0 0 0 51 96 1 6 0 0 0 53 97 1 1 0 0 0 56 98 1 6 0 0 0 62 99 1 6 0 0 0 78100 1 6 0 0 0 87101 1 6 0 0 0 M CHG 1 46 1 M RAD 4 22 2 26 2 31 2 48 2 M END > <DATABASE_ID> NP0087058 > <DATABASE_NAME> NP-MRD > <SMILES> C([C@@]1([H])C2N3[Co+]456([N]7=CN([C@@]8([H])O[C@@]([H])([C@](OP(O[C@](CNC(CC[C@@]1(C)C3=C(C)C1=[N]4C(=CC3=[N]5C(=C(C)C4=[N]6[C@]2(C)[C@@](CC(N)=O)([C@]4([H])CCC(N)=O)C)[C@@](CC(N)=O)([C@]3([H])CCC(N)=O)C)C([C@]1([H])CCC(N)=O)(C)C)=O)([H])C)(O)=O)([H])[C@@]8([H])O)CO)C1=C7C=C(C)C(C)=C1)O)C(N)=O > <INCHI_IDENTIFIER> InChI=1S/C62H89N13O14P.Co.H2O/c1-29-20-39-40(21-30(29)2)75(28-70-39)57-52(84)53(41(27-76)87-57)89-90(85,86)88-31(3)26-69-49(83)18-19-59(8)37(22-46(66)80)56-62(11)61(10,25-48(68)82)36(14-17-45(65)79)51(74-62)33(5)55-60(9,24-47(67)81)34(12-15-43(63)77)38(71-55)23-42-58(6,7)35(13-16-44(64)78)50(72-42)32(4)54(59)73-56;;/h20-21,23,28,31,34-37,41,52-53,56-57,76,84H,12-19,22,24-27H2,1-11H3,(H2,63,77)(H2,64,78)(H2,65,79)(H2,66,80)(H2,67,81)(H2,68,82)(H,69,83)(H,85,86);;1H2/q-1;+3;/p-1/b54-32-;;/t31-,34-,35-,36-,37+,41-,52-,53-,56?,57+,59-,60+,61+,62+;;/m1../s1 > <INCHI_KEY> XVXCLEXSDVMESA-RKRHPEFLSA-M > <FORMULA> C62H90CoN13O15P > <MOLECULAR_WEIGHT> 1347.3631 > <EXACT_MASS> 1346.574895981 > <JCHEM_ACCEPTOR_COUNT> 0 > <JCHEM_AVERAGE_POLARIZABILITY> 135.39604504368805 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 0 > <JCHEM_FORMAL_CHARGE> 1 > <JCHEM_GHOSE_FILTER> 0 > <ALOGPS_LOGP> 1.09 > <ALOGPS_LOGS> -4.90 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 12 > <JCHEM_PHYSIOLOGICAL_CHARGE> 1 > <JCHEM_POLAR_SURFACE_AREA> 496.64000000000004 > <JCHEM_REFRACTIVITY> 352.1363000000001 > <JCHEM_ROTATABLE_BOND_COUNT> 16 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.76e-02 g/l > <JCHEM_VEBER_RULE> 0 $$$$ PDB for NP0087058 (Aquacobalamin)HEADER PROTEIN 25-FEB-12 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 25-FEB-12 0 HETATM 1 C UNK 0 5.253 -4.416 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 5.872 -2.958 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 4.926 -1.743 0.000 0.00 0.00 C+0 HETATM 4 N UNK 0 3.401 -1.955 0.000 0.00 0.00 N+0 HETATM 5 C UNK 0 2.455 -0.740 0.000 0.00 0.00 C+0 HETATM 6 O UNK 0 3.061 0.718 0.000 0.00 0.00 O+0 HETATM 7 C UNK 0 0.930 -0.952 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 -0.016 0.262 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -1.541 0.051 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -0.878 1.542 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -2.609 1.160 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -2.336 2.746 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -3.514 3.794 0.000 0.00 0.00 C+0 HETATM 14 N UNK 0 -4.975 3.309 0.000 0.00 0.00 N+0 HETATM 15 O UNK 0 -3.203 5.302 0.000 0.00 0.00 O+0 HETATM 16 C UNK 0 -3.994 0.487 0.000 0.00 0.00 C+0 HETATM 17 N UNK 0 -3.782 -1.038 0.000 0.00 0.00 N+0 HETATM 18 C UNK 0 -2.266 -1.308 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 -1.693 -3.208 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -0.098 -2.919 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -2.120 -4.688 0.000 0.00 0.00 C+0 HETATM 22 N UNK 0 -3.659 -4.739 0.000 0.00 0.00 N+0 HETATM 23 C UNK 0 -4.086 -6.219 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 -6.035 -6.590 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 -7.462 -6.011 0.000 0.00 0.00 C+0 HETATM 26 N UNK 0 -7.352 -4.475 0.000 0.00 0.00 N+0 HETATM 27 C UNK 0 -8.779 -3.896 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 -8.945 -1.918 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -10.463 -1.572 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 -8.220 -0.560 0.000 0.00 0.00 C+0 HETATM 31 N UNK 0 -6.704 -0.830 0.000 0.00 0.00 N+0 HETATM 32 C UNK 0 -5.979 0.529 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 -4.958 1.727 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 -7.047 1.638 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 -6.287 2.992 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -7.915 3.019 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 -7.240 4.470 0.000 0.00 0.00 C+0 HETATM 38 N UNK 0 -8.124 5.730 0.000 0.00 0.00 N+0 HETATM 39 O UNK 0 -5.706 4.605 0.000 0.00 0.00 O+0 HETATM 40 C UNK 0 -8.432 0.965 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 -9.863 1.701 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 -11.209 0.909 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 -12.549 1.667 0.000 0.00 0.00 C+0 HETATM 44 N UNK 0 -12.562 3.207 0.000 0.00 0.00 N+0 HETATM 45 O UNK 0 -13.876 0.886 0.000 0.00 0.00 O+0 HETATM 46 Co UNK 0 -1.015 -3.853 0.000 0.00 0.00 Co+1 HETATM 47 O UNK 0 -0.481 -5.284 0.000 0.00 0.00 O+0 HETATM 48 N UNK 0 16.421 -8.183 0.000 0.00 0.00 N+0 HETATM 49 C UNK 0 14.882 -8.234 0.000 0.00 0.00 C+0 HETATM 50 N UNK 0 14.358 -6.787 0.000 0.00 0.00 N+0 HETATM 51 C UNK 0 12.878 -6.360 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 11.663 -7.306 0.000 0.00 0.00 O+0 HETATM 53 C UNK 0 10.388 -6.443 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 8.901 -6.939 0.000 0.00 0.00 C+0 HETATM 55 O UNK 0 8.653 -8.587 0.000 0.00 0.00 O+0 HETATM 56 C UNK 0 10.815 -4.964 0.000 0.00 0.00 C+0 HETATM 57 O UNK 0 9.869 -3.749 0.000 0.00 0.00 O+0 HETATM 58 P UNK 0 8.344 -3.961 0.000 0.00 0.00 P+0 HETATM 59 O UNK 0 8.423 -2.555 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 9.025 -2.445 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 7.397 -2.746 0.000 0.00 0.00 O+0 HETATM 62 C UNK 0 12.354 -4.912 0.000 0.00 0.00 C+0 HETATM 63 O UNK 0 13.229 -3.527 0.000 0.00 0.00 O+0 HETATM 64 C UNK 0 15.573 -5.840 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 16.848 -6.704 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 18.233 -6.031 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 18.343 -4.495 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 19.828 -3.801 0.000 0.00 0.00 C+0 HETATM 69 C UNK 0 17.067 -3.632 0.000 0.00 0.00 C+0 HETATM 70 C UNK 0 17.167 -2.051 0.000 0.00 0.00 C+0 HETATM 71 C UNK 0 15.682 -4.305 0.000 0.00 0.00 C+0 HETATM 72 C UNK 0 -9.771 -5.074 0.000 0.00 0.00 C+0 HETATM 73 C UNK 0 -10.922 -4.002 0.000 0.00 0.00 C+0 HETATM 74 C UNK 0 -11.094 -6.052 0.000 0.00 0.00 C+0 HETATM 75 C UNK 0 -12.566 -5.447 0.000 0.00 0.00 C+0 HETATM 76 N UNK 0 -13.785 -6.387 0.000 0.00 0.00 N+0 HETATM 77 O UNK 0 -12.771 -3.921 0.000 0.00 0.00 O+0 HETATM 78 C UNK 0 -8.957 -6.381 0.000 0.00 0.00 C+0 HETATM 79 C UNK 0 -9.581 -7.829 0.000 0.00 0.00 C+0 HETATM 80 C UNK 0 -8.538 -9.137 0.000 0.00 0.00 C+0 HETATM 81 C UNK 0 -9.101 -10.571 0.000 0.00 0.00 C+0 HETATM 82 N UNK 0 -8.141 -11.775 0.000 0.00 0.00 N+0 HETATM 83 O UNK 0 -10.623 -10.800 0.000 0.00 0.00 O+0 HETATM 84 C UNK 0 -2.810 -7.082 0.000 0.00 0.00 C+0 HETATM 85 C UNK 0 -1.868 -8.349 0.000 0.00 0.00 C+0 HETATM 86 C UNK 0 -3.812 -8.338 0.000 0.00 0.00 C+0 HETATM 87 C UNK 0 -1.595 -6.135 0.000 0.00 0.00 C+0 HETATM 88 C UNK 0 -0.039 -6.656 0.000 0.00 0.00 C+0 HETATM 89 C UNK 0 0.482 -8.199 0.000 0.00 0.00 C+0 HETATM 90 C UNK 0 1.992 -8.503 0.000 0.00 0.00 C+0 HETATM 91 N UNK 0 3.009 -7.347 0.000 0.00 0.00 N+0 HETATM 92 O UNK 0 2.484 -9.962 0.000 0.00 0.00 O+0 HETATM 93 H UNK 0 5.857 -1.297 0.000 0.00 0.00 H+0 HETATM 94 H UNK 0 -1.472 2.842 0.000 0.00 0.00 H+0 HETATM 95 H UNK 0 -9.307 -0.438 0.000 0.00 0.00 H+0 HETATM 96 H UNK 0 13.209 -4.656 0.000 0.00 0.00 H+0 HETATM 97 H UNK 0 9.125 -5.705 0.000 0.00 0.00 H+0 HETATM 98 H UNK 0 12.099 -3.974 0.000 0.00 0.00 H+0 HETATM 99 H UNK 0 13.689 -5.762 0.000 0.00 0.00 H+0 HETATM 100 H UNK 0 -8.382 -7.752 0.000 0.00 0.00 H+0 HETATM 101 H UNK 0 -1.147 -4.699 0.000 0.00 0.00 H+0 CONECT 1 2 CONECT 2 1 3 61 93 CONECT 3 2 4 CONECT 4 3 5 CONECT 5 4 6 7 CONECT 6 5 CONECT 7 5 8 CONECT 8 7 9 CONECT 9 8 10 11 18 CONECT 10 9 CONECT 11 9 12 16 94 CONECT 12 11 13 CONECT 13 12 14 15 CONECT 14 13 CONECT 15 13 CONECT 16 11 17 32 CONECT 17 16 18 46 CONECT 18 17 9 19 CONECT 19 18 20 21 CONECT 20 19 CONECT 21 19 22 87 CONECT 22 21 23 46 CONECT 23 22 24 84 CONECT 24 23 25 CONECT 25 24 26 78 CONECT 26 25 27 46 CONECT 27 26 28 72 CONECT 28 27 29 30 CONECT 29 28 CONECT 30 28 31 40 CONECT 31 30 32 46 CONECT 32 31 16 33 34 CONECT 33 32 CONECT 34 32 35 36 40 CONECT 35 34 CONECT 36 34 37 CONECT 37 36 38 39 CONECT 38 37 CONECT 39 37 CONECT 40 34 30 41 95 CONECT 41 40 42 CONECT 42 41 43 CONECT 43 42 44 45 CONECT 44 43 CONECT 45 43 CONECT 46 31 17 22 26 CONECT 46 47 48 CONECT 47 46 CONECT 48 46 49 65 CONECT 49 48 50 CONECT 50 49 51 64 CONECT 51 50 52 62 96 CONECT 52 51 53 CONECT 53 52 54 56 97 CONECT 54 53 55 CONECT 55 54 CONECT 56 53 57 62 98 CONECT 57 56 58 CONECT 58 57 59 60 61 CONECT 59 58 CONECT 60 58 CONECT 61 58 2 CONECT 62 56 51 63 99 CONECT 63 62 CONECT 64 50 65 71 CONECT 65 64 48 66 CONECT 66 65 67 CONECT 67 66 68 69 CONECT 68 67 CONECT 69 67 70 71 CONECT 70 69 CONECT 71 69 64 CONECT 72 27 73 74 78 CONECT 73 72 CONECT 74 72 75 CONECT 75 74 76 77 CONECT 76 75 CONECT 77 75 CONECT 78 72 25 79 100 CONECT 79 78 80 CONECT 80 79 81 CONECT 81 80 82 83 CONECT 82 81 CONECT 83 81 CONECT 84 23 85 86 87 CONECT 85 84 CONECT 86 84 CONECT 87 84 21 88 101 CONECT 88 87 89 CONECT 89 88 90 CONECT 90 89 91 92 CONECT 91 90 CONECT 92 90 CONECT 93 2 CONECT 94 11 CONECT 95 40 CONECT 96 51 CONECT 97 53 CONECT 98 56 CONECT 99 62 CONECT 100 78 CONECT 101 87 MASTER 0 0 0 0 0 0 0 0 101 0 224 0 END SMILES for NP0087058 (Aquacobalamin)C([C@@]1([H])C2N3[Co+]456([N]7=CN([C@@]8([H])O[C@@]([H])([C@](OP(O[C@](CNC(CC[C@@]1(C)C3=C(C)C1=[N]4C(=CC3=[N]5C(=C(C)C4=[N]6[C@]2(C)[C@@](CC(N)=O)([C@]4([H])CCC(N)=O)C)[C@@](CC(N)=O)([C@]3([H])CCC(N)=O)C)C([C@]1([H])CCC(N)=O)(C)C)=O)([H])C)(O)=O)([H])[C@@]8([H])O)CO)C1=C7C=C(C)C(C)=C1)O)C(N)=O INCHI for NP0087058 (Aquacobalamin)InChI=1S/C62H89N13O14P.Co.H2O/c1-29-20-39-40(21-30(29)2)75(28-70-39)57-52(84)53(41(27-76)87-57)89-90(85,86)88-31(3)26-69-49(83)18-19-59(8)37(22-46(66)80)56-62(11)61(10,25-48(68)82)36(14-17-45(65)79)51(74-62)33(5)55-60(9,24-47(67)81)34(12-15-43(63)77)38(71-55)23-42-58(6,7)35(13-16-44(64)78)50(72-42)32(4)54(59)73-56;;/h20-21,23,28,31,34-37,41,52-53,56-57,76,84H,12-19,22,24-27H2,1-11H3,(H2,63,77)(H2,64,78)(H2,65,79)(H2,66,80)(H2,67,81)(H2,68,82)(H,69,83)(H,85,86);;1H2/q-1;+3;/p-1/b54-32-;;/t31-,34-,35-,36-,37+,41-,52-,53-,56?,57+,59-,60+,61+,62+;;/m1../s1 3D Structure for NP0087058 (Aquacobalamin) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C62H90CoN13O15P | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 1347.3631 Da | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 1346.57490 Da | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | C([C@@]1([H])C2N3[Co+]456([N]7=CN([C@@]8([H])O[C@@]([H])([C@](OP(O[C@](CNC(CC[C@@]1(C)C3=C(C)C1=[N]4C(=CC3=[N]5C(=C(C)C4=[N]6[C@]2(C)[C@@](CC(N)=O)([C@]4([H])CCC(N)=O)C)[C@@](CC(N)=O)([C@]3([H])CCC(N)=O)C)C([C@]1([H])CCC(N)=O)(C)C)=O)([H])C)(O)=O)([H])[C@@]8([H])O)CO)C1=C7C=C(C)C(C)=C1)O)C(N)=O | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C62H89N13O14P.Co.H2O/c1-29-20-39-40(21-30(29)2)75(28-70-39)57-52(84)53(41(27-76)87-57)89-90(85,86)88-31(3)26-69-49(83)18-19-59(8)37(22-46(66)80)56-62(11)61(10,25-48(68)82)36(14-17-45(65)79)51(74-62)33(5)55-60(9,24-47(67)81)34(12-15-43(63)77)38(71-55)23-42-58(6,7)35(13-16-44(64)78)50(72-42)32(4)54(59)73-56;;/h20-21,23,28,31,34-37,41,52-53,56-57,76,84H,12-19,22,24-27H2,1-11H3,(H2,63,77)(H2,64,78)(H2,65,79)(H2,66,80)(H2,67,81)(H2,68,82)(H,69,83)(H,85,86);;1H2/q-1;+3;/p-1/b54-32-;;/t31-,34-,35-,36-,37+,41-,52-,53-,56?,57+,59-,60+,61+,62+;;/m1../s1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | XVXCLEXSDVMESA-RKRHPEFLSA-M | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Shift Submissions | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Species | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Species of Origin |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as lineolic acids and derivatives. These are derivatives of lineolic acid. Lineolic acid is a polyunsaturated omega-6 18 carbon long fatty acid, with two CC double bonds at the 9- and 12-positions. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Fatty Acyls | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Lineolic acids and derivatives | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Lineolic acids and derivatives | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic acyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FoodDB ID | FDB023178 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |