| Description | (Z)-3-Methyl-2-(2-pentenyl)-2-cyclopenten-1-one, also known as cis-jasmone or (Z)-jasmone, belongs to the class of organic compounds known as cyclic ketones. These are organic compounds containing a ketone that is conjugated to a cyclic moiety. Thus, (Z)-3-methyl-2-(2-pentenyl)-2-cyclopenten-1-one is considered to be an octadecanoid lipid molecule (Z)-3-Methyl-2-(2-pentenyl)-2-cyclopenten-1-one is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral (Z)-3-Methyl-2-(2-pentenyl)-2-cyclopenten-1-one is a celery, floral, and herbal tasting compound. Outside of the human body, (Z)-3-Methyl-2-(2-pentenyl)-2-cyclopenten-1-one is found, on average, in the highest concentration within a few different foods, such as spearmints, tea, and orange mints (Z)-3-Methyl-2-(2-pentenyl)-2-cyclopenten-1-one has also been detected, but not quantified in, several different foods, such as herbs and spices, figs, citrus, sweet oranges, and peppermints. (Z)-3-Methyl-2-(2-pentenyl)-2-cyclopenten-1-one is found in Achillea millefolium, Achillea ptarmica, Agastache rugosa, Ageratum conyzoides, Artemisia annua, Artemisia herba-alba, Artemisia judaica, Artemisia salsoloides, Basella alba, Citrus sinensis, Clinopodium serpyllifolium, Echinophora tenuifolia, Elsholtzia fruticosa, Flourensia cernua, Hypericum perforatum, Lonicera japonica, Monarda fistulosa, Nelumbo lutea, Paeonia lactiflora, Pectis elongata, Pulicaria arabica, Salvia cinnabarina, Salvia syriaca, Tagetes lucida and Vachellia rigidula. This could make (Z)-3-methyl-2-(2-pentenyl)-2-cyclopenten-1-one a potential biomarker for the consumption of these foods. |
|---|
| Structure | InChI=1S/C11H16O/c1-3-4-5-6-10-9(2)7-8-11(10)12/h4-5H,3,6-8H2,1-2H3/b5-4- |
|---|