| Description | Docosahexaenoic acid, also known as all-cis-dha or doconexent, belongs to the class of organic compounds known as very long-chain fatty acids. These are fatty acids with an aliphatic tail that contains at least 22 carbon atoms. A docosahexaenoic acid having six cis-double bonds at positions 4, 7, 10, 13, 16 and 19. Docosahexaenoic acid is a drug which is used as a high-docosahexaenoic acid (dha) oral supplement. . Docosahexaenoic acid is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. In humans, docosahexaenoic acid is involved in alpha linolenic acid and linoleic acid metabolism. Outside of the human body, Docosahexaenoic acid is found, on average, in the highest concentration within a few different foods, such as atlantic menhadens, spotted seals, and bearded seals and in a lower concentration in wonton wrappers, sharks, and chickens. Docosahexaenoic acid has also been detected, but not quantified in, several different foods, such as cocktails, italian sweet red peppers, sakes, jicama, and gooseberries. This could make docosahexaenoic acid a potential biomarker for the consumption of these foods. Doconexent is found in Homo sapiens (Serum), Sarcophyton trocheliophorum, Scomber japonicus and Tripneustes ventricosus. Doconexent was first documented in 1988 (PMID: 2975919). Docosahexaenoic acid, with regard to humans, has been found to be associated with several diseases such as hypertension, colorectal cancer, major depressive disorder, and rhizomelic chondrodysplasia punctata; docosahexaenoic acid has also been linked to the inborn metabolic disorder isovaleric acidemia (PMID: 17291553) (PMID: 10319360) (PMID: 10617968) (PMID: 15097041) (PMID: 12482554) (PMID: 16303609). |
|---|
| Structure | CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCC(O)=O InChI=1S/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
|---|
| Synonyms | | Value | Source |
|---|
| (4Z,7Z,10Z,13Z,16Z,19Z)-Docosahexaenoic acid | ChEBI | | 22:6(N-3) | ChEBI | | 22:6-4, 7,10,13,16,19 | ChEBI | | 4,7,10,13,16,19-Docosahexaenoic acid | ChEBI | | all-cis-4,7,10,13,16,19-Docosahexaenoic acid | ChEBI | | all-cis-DHA | ChEBI | | Cervonic acid | ChEBI | | DHA | ChEBI | | Doconexent | ChEBI | | DOCOSA-4,7,10,13,16,19-hexaenoIC ACID | ChEBI | | Docosahexaenoate | Kegg | | 4Z,7Z,10Z,13Z,16Z,19Z-Docosahexaenoic acid | Kegg | | (4Z,7Z,10Z,13Z,16Z,19Z)-Docosa-4,7,10,13,16,19-hexaenoic acid | Kegg | | (4Z,7Z,10Z,13Z,16Z,19Z)-Docosahexaenoate | Generator | | 4,7,10,13,16,19-Docosahexaenoate | Generator | | all-cis-4,7,10,13,16,19-Docosahexaenoate | Generator | | Cervonate | Generator | | DOCOSA-4,7,10,13,16,19-hexaenoate | Generator | | 4Z,7Z,10Z,13Z,16Z,19Z-Docosahexaenoate | Generator | | (4Z,7Z,10Z,13Z,16Z,19Z)-Docosa-4,7,10,13,16,19-hexaenoate | Generator | | all-Z-Docosahexaenoate | HMDB | | all-Z-Docosahexaenoic acid | HMDB | | cis-4,7,10,13,16,19-Docosahexanoate | HMDB | | cis-4,7,10,13,16,19-Docosahexanoic acid | HMDB | | Doconexento | HMDB | | Doconexentum | HMDB | | Doxonexent | HMDB | | Acids, docosahexaenoic | HMDB | | Acids, docosahexenoic | HMDB | | Docosahexaenoic acid, 4,7,10,13,16,19-(all-Z-isomer) | HMDB | | Docosahexaenoic acid (all-Z isomer) | HMDB | | Docosahexaenoic acid, 4,7,10,13,16,19-isomer | HMDB | | Efalex | HMDB | | (4Z,7Z,10Z,13Z,16Z,19Z)-4,7,10,13,16,19-Docosahexaenoic acid | HMDB | | (4Z,7Z,10Z,13Z,16Z,19Z)-Docosahexenoic acid | HMDB | | (all-Z)-4,7,10,13,16,19-Docosahexaenoic acid | HMDB | | 4-cis,7-cis,10-cis,13-cis,16-cis,19-cis-Docosahexaenoic acid | HMDB | | FA(22:6(4Z,7Z,10Z,13Z,16Z,19Z)) | HMDB | | FA(22:6n3) | HMDB | | delta4,7,10,13,16,19-Docosahexaenoic acid | HMDB | | Δ4,7,10,13,16,19-docosahexaenoic acid | HMDB | | Docosahexaenoic acid | HMDB | | Choline docosahexaenoate | HMDB | | Choline docosahexaenoic acid | HMDB | | Docosahexaenoylcholine | HMDB |
|
|---|
| InChI Identifier | InChI=1S/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
|---|