| Record Information |
|---|
| Version | 2.0 |
|---|
| Created at | 2021-06-22 17:26:24 UTC |
|---|
| Updated at | 2021-06-22 17:26:25 UTC |
|---|
| NP-MRD ID | NP0043863 |
|---|
| Secondary Accession Numbers | None |
|---|
| Natural Product Identification |
|---|
| Common Name | Delphinidin 3-glucoside |
|---|
| Description | Delphinidin 3-glucoside, also known as myrtillin, belongs to the class of organic compounds known as anthocyanidin-3-o-glycosides. These are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C3-position. Thus, delphinidin 3-glucoside is considered to be a flavonoid. Delphinidin 3-glucoside exists in all eukaryotes, ranging from yeast to plants to humans. Delphinidin 3-glucoside is a primary metabolite. Primary metabolites are metabolically or physiologically essential metabolites. They are directly involved in an organism’s growth, development or reproduction. Delphinidin 3-glucoside is found in Abies spp., Alopecurus spp., Anthoxanthum spp., Anthyllis pyrenaica, Arbutus unedo , Ardisia humilis, Avenula spp., Blighia sieboldii, Bothriochloa spp., Camellia sinensis , Ceratostigma plumbaginoides, Clitoria ternatea , Cornus mas , Cyathodes spp., Dactylis spp., Deschampsia spp., Elymus spp., Empetrum nigrum , Eugenia umbelliflora, Festuca spp., Frankenia grandiflora, Geranium sylvaticum, Hibiscus cannabinus, Hordeum spp., Hydrangea macrophylla , Impatiens balsamina , Limonium spp., Lobostemon spp., Malva sylvestris, Metrosideros spp., Miscanthus spp., Molinia spp., Morus alba , Mucuna sempervirens, Muntingia calabura , Muscari armeniacum , Nymphaea alba , Nymphaea candida , Nymphaea marliacea, Oryza spp., Passiflora suberosa, Pentachondra spp., Phalaris spp., Phleum spp., Picea spp., Pinus banksiana , Plumbago spp., Poa spp., Podocarpus spp., Polygonum spp., Pseudotsuga spp., Salix spp., Sinarundinaria spp., Trochocarpa spp., Tsuga spp., Vaccinium padifolium, Vaccinium spp., Verbena x hybrida, Vigna spp., Visnea mocanera and Vitis vinifera. Delphinidin 3-glucoside was first documented in 2014 (PMID: 24493900). Based on a literature review a significant number of articles have been published on Delphinidin 3-glucoside (PMID: 33353130) (PMID: 34200974) (PMID: 33586559) (PMID: 33465442) (PMID: 33396768) (PMID: 33292939). |
|---|
| Structure | OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@@H]1O InChI=1S/C21H20O12/c22-6-15-17(28)18(29)19(30)21(33-15)32-14-5-9-10(24)3-8(23)4-13(9)31-20(14)7-1-11(25)16(27)12(26)2-7/h1-5,15,17-19,21-22,28-30H,6H2,(H4-,23,24,25,26,27)/p+1/t15-,17-,18+,19-,21-/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| Delfinidin 3-O-beta-D-glucoside | ChEBI | | Delphinidin 3-O-glucoside | ChEBI | | Mirtillin | Kegg | | Delphinidin 3-O-beta-D-glucoside | Kegg | | Delfinidin 3-O-b-D-glucoside | Generator | | Delfinidin 3-O-β-D-glucoside | Generator | | Delphinidin 3-O-b-D-glucoside | Generator | | Delphinidin 3-O-β-D-glucoside | Generator | | Delphinidin 3-monoglucoside | HMDB | | Delphinidin 3-O-beta-D-glucopyranoside | HMDB | | Delphinidol 3-glucoside | HMDB | | Myrtillin | HMDB | | Myrtillin a | HMDB | | Delphinidin 3-O-glucopyranoside | HMDB | | Delphinidin 3-O-beta-glucoside | HMDB | | Delphinidin-3-glucoside | HMDB |
|
|---|
| Chemical Formula | C21H21O12 |
|---|
| Average Mass | 465.3842 Da |
|---|
| Monoisotopic Mass | 465.10330 Da |
|---|
| IUPAC Name | 5,7-dihydroxy-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-(3,4,5-trihydroxyphenyl)-1lambda4-chromen-1-ylium |
|---|
| Traditional Name | 5,7-dihydroxy-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-(3,4,5-trihydroxyphenyl)-1lambda4-chromen-1-ylium |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | OC[C@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@H](O)[C@@H](O)[C@@H]1O |
|---|
| InChI Identifier | InChI=1S/C21H20O12/c22-6-15-17(28)18(29)19(30)21(33-15)32-14-5-9-10(24)3-8(23)4-13(9)31-20(14)7-1-11(25)16(27)12(26)2-7/h1-5,15,17-19,21-22,28-30H,6H2,(H4-,23,24,25,26,27)/p+1/t15-,17-,18+,19-,21-/m1/s1 |
|---|
| InChI Key | XENHPQQLDPAYIJ-PEVLUNPASA-O |
|---|
| Experimental Spectra |
|---|
|
| | Spectrum Type | Description | Depositor Email | Depositor Organization | Depositor | Deposition Date | View |
|---|
| 1D NMR | 13C NMR Spectrum (1D, 125 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 500 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 50 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 150 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 250 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 175 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 75 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 100 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 225 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 200 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 25 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 300 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 900 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 700 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 400 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 100 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 1000 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 800 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 200 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 600 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 100 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 125 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 150 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 175 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 200 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 225 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 25 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 250 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 50 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 13C NMR Spectrum (1D, 75 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 100 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 1000 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 200 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 300 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 400 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 500 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 600 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 700 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 800 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | | 1D NMR | 1H NMR Spectrum (1D, 900 MHz, Methanol-d4, simulated) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum |
| | Predicted Spectra |
|---|
|
| Not Available | | Chemical Shift Submissions |
|---|
|
| Not Available | | Species |
|---|
| Species of Origin | | Species Name | Source | Reference |
|---|
| Abelmoschus esculentus | FooDB | | | Abies spp. | Plant | | | Actinidia chinensis | FooDB | | | Agaricus bisporus | FooDB | | | Agave | FooDB | | | Allium ampeloprasum | FooDB | | | Allium ascalonicum | FooDB | | | Allium cepa | FooDB | | | Allium cepa L. | FooDB | | | Allium fistulosum | FooDB | | | Allium sativum | FooDB | | | Allium schoenoprasum | FooDB | | | Allium tuberosum | FooDB | | | Alopecurus spp. | Plant | | | Aloysia triphylla | FooDB | | | Amaranthus | FooDB | | | Amelanchier alnifolia | FooDB | | | Anacardium occidentale | FooDB | | | Ananas comosus | FooDB | | | Anethum graveolens | FooDB | | | Angelica keiskei | FooDB | | | Annona cherimola | FooDB | | | Annona muricata | FooDB | | | Annona reticulata | FooDB | | | Annona squamosa | FooDB | | | Anthoxanthum spp. | Plant | | | Anthriscus cerefolium | FooDB | | | Anthyllis pyrenaica | Plant | | | Apium graveolens | FooDB | | | Apium graveolens var. dulce | FooDB | | | Apium graveolens var. rapaceum | FooDB | | | Apium graveolens var. secalinum | FooDB | | | Arachis hypogaea | FooDB | | | Arbutus unedo | Plant | | | Arctium lappa | FooDB | | | Ardisia humilis | Plant | | | Armoracia rusticana | FooDB | | | Artemisia dracunculus | FooDB | | | Artemisia vulgaris | FooDB | | | Artocarpus altilis | FooDB | | | Artocarpus heterophyllus | FooDB | | | Asparagus officinalis | FooDB | | | Attalea speciosa | FooDB | | | Auricularia auricula-judae | FooDB | | | Auricularia polytricha | FooDB | | | Avena sativa L. | FooDB | | | Avenula spp. | Plant | | | Averrhoa carambola | FooDB | | | Basella alba | FooDB | | | Benincasa hispida | FooDB | | | Bertholletia excelsa | FooDB | | | Beta vulgaris | FooDB | | | Beta vulgaris ssp. cicla | FooDB | | | Blighia sieboldii | Plant | | | Borago officinalis | FooDB | | | Bothriochloa spp. | Plant | | | Brassica alboglabra | FooDB | | | Brassica juncea | FooDB | | | Brassica napus | FooDB | | | Brassica napus var. napus | FooDB | | | Brassica oleracea | FooDB | | | Brassica oleracea var. botrytis | FooDB | | | Brassica oleracea var. capitata | FooDB | | | Brassica oleracea var. gemmifera | FooDB | | | Brassica oleracea var. gongylodes | FooDB | | | Brassica oleracea var. italica | FooDB | | | Brassica oleracea var. sabauda | FooDB | | | Brassica oleracea var. viridis | FooDB | | | Brassica rapa | FooDB | | | Brassica rapa ssp. chinensis | FooDB | | | Brassica rapa var. pekinensis | FooDB | | | Brassica rapa var. rapa | FooDB | | | Brassica ruvo | FooDB | | | Brosimum alicastrum | FooDB | | | Byrsonima crassifolia | FooDB | | | Cajanus cajan | FooDB | | | Camellia sinensis | Plant | | | Canarium ovatum | FooDB | | | Cannabis sativa | CannabisDB | | | Cantharellus cibarius | FooDB | | | Capparis spinosa | FooDB | | | Capsicum annuum | FooDB | | | Capsicum annuum L. | FooDB | | | Capsicum annuum var. annuum | FooDB | | | Capsicum chinense | FooDB | | | Capsicum pubescens | FooDB | | | Carica papaya L. | FooDB | | | Carissa macrocarpa | FooDB | | | Carthamus tinctorius | FooDB | | | Carum carvi | FooDB | | | Carya | FooDB | | | Carya illinoinensis | FooDB | | | Castanea | FooDB | | | Castanea crenata | FooDB | | | Castanea mollissima | FooDB | | | Castanea sativa | FooDB | | | Ceratonia siliqua | FooDB | | | Ceratostigma plumbaginoides | Plant | | | Chamaemelum nobile | FooDB | | | Chamerion angustifolium | FooDB | | | Chenopodium album | FooDB | | | Chenopodium quinoa | FooDB | | | Chrysanthemum coronarium | FooDB | | | Cicer arietinum | FooDB | | | Cichorium endivia | FooDB | | | Cichorium intybus | FooDB | | | Cinnamomum | FooDB | | | Cinnamomum aromaticum | FooDB | | | Cinnamomum verum | FooDB | | | Cirsium | FooDB | | | Citrullus lanatus | FooDB | | | Citrus ×limon (L.) Burm. f. (pro sp.) | FooDB | | | Citrus aurantiifolia | FooDB | | | Citrus latifolia | FooDB | | | Citrus limon | FooDB | | | Citrus maxima | FooDB | | | Citrus paradisi | FooDB | | | Citrus reticulata | FooDB | | | Citrus X sinensis (L.) Osbeck (pro. sp.) | FooDB | | | Clitoria ternatea | Plant | | | Cocos nucifera | FooDB | | | Coffea arabica L. | FooDB | | | Coffea canephora | FooDB | | | Colocasia esculenta | FooDB | | | Corchorus olitorius | FooDB | | | Coriandrum sativum L. | FooDB | | | Cornus alba | Linington's dataset npmrd_submissions_20220207 | | | Cornus mas | Plant | | | Corylus | FooDB | | | Corylus avellana | FooDB | | | Crateva religiosa | FooDB | | | Crocus sativus | FooDB | | | Cucumis melo | FooDB | | | Cucumis metuliferus | FooDB | | | Cucumis sativus L. | FooDB | | | Cucurbita | FooDB | | | Cucurbita maxima | FooDB | | | Cucurbita moschata | FooDB | | | Cuminum cyminum | FooDB | | | Curcuma longa | FooDB | | | Cyathodes spp. | Plant | | | Cydonia oblonga | FooDB | | | Cymbopogon citratus | FooDB | | | Cynara cardunculus | FooDB | | | Cynara scolymus | FooDB | | | Dactylis spp. | Plant | | | Daucus carota | FooDB | | | Daucus carota ssp. sativus | FooDB | | | Deschampsia spp. | Plant | | | Dimocarpus longan | FooDB | | | Dioscorea | FooDB | | | Dioscorea pentaphylla | FooDB | | | Diospyros | FooDB | | | Diospyros kaki | FooDB | | | Diospyros virginiana | FooDB | | | Durio zibethinus | FooDB | | | Dysphania ambrosioides | FooDB | | | Elaeis | FooDB | | | Eleocharis dulcis | FooDB | | | Elettaria cardamomum | FooDB | | | Elymus spp. | Plant | | | Empetrum nigrum | Plant | | | Eragrostis tef | FooDB | | | Eriobotrya japonica | FooDB | | | Eruca vesicaria subsp. Sativa | FooDB | | | Eugenia javanica | FooDB | | | Eugenia umbelliflora | Plant | | | Eugenia uniflora | FooDB | | | Eutrema japonicum | FooDB | | | Fagopyrum esculentum | FooDB | | | Fagopyrum tataricum | FooDB | | | Fagus | FooDB | | | Feijoa sellowiana | FooDB | | | Festuca spp. | Plant | | | Ficus carica | FooDB | | | Flammulina velutipes | FooDB | | | Foeniculum vulgare | FooDB | | | Fragaria x ananassa | FooDB | | | Frankenia grandiflora | Plant | | | Garcinia mangostana | FooDB | | | Gaylussacia baccata | FooDB | | | Gentiana makinoi | KNApSAcK Database | | | Gentiana triflora | KNApSAcK Database | | | Geranium sylvaticum | Plant | | | Ginkgo biloba | FooDB | | | Glycine max | FooDB | | | Gossypium | FooDB | | | Grifola frondosa | FooDB | | | Hedysarum alpinum | FooDB | | | Helianthus annuus L. | FooDB | | | Helianthus tuberosus | FooDB | | | Hibiscus cannabinus | LOTUS Database | | | Hibiscus sabbariffa | FooDB | | | Hippophae rhamnoides | FooDB | | | Hordeum spp. | Plant | | | Hordeum vulgare | FooDB | | | Hydrangea macrophylla | Plant | | | Hyssopus officinalis L. | FooDB | | | Illicium verum | FooDB | | | Impatiens balsamina | Plant | | | Ipomoea aquatica | FooDB | | | Ipomoea batatas | FooDB | | | Juglans | FooDB | | | Juglans ailanthifolia | FooDB | | | Juglans cinerea | FooDB | | | Juglans nigra L. | FooDB | | | Juglans regia | FooDB | | | Lablab purpureus | FooDB | | | Lactuca sativa | FooDB | | | Lagenaria siceraria | FooDB | | | Lathyrus sativus | FooDB | | | Laurus nobilis L. | FooDB | | | Lens culinaris | FooDB | | | Lentinus edodes | FooDB | | | Lepidium sativum | FooDB | | | Levisticum officinale | FooDB | | | Limonium spp. | Plant | | | Linum usitatissimum | FooDB | | | Litchi chinensis | FooDB | | | Lobostemon spp. | Plant | | | Luffa aegyptiaca | FooDB | | | Lupinus | FooDB | | | Lupinus albus | FooDB | | | Macadamia | FooDB | | | Macadamia tetraphylla | FooDB | | | Malpighia emarginata | FooDB | | | Malus | FooDB | | | Malus pumila | FooDB | | | Malva sylvestris | LOTUS Database | | | Mammea americana | FooDB | | | Mangifera indica | FooDB | | | Manihot esculenta | FooDB | | | Manilkara zapota | FooDB | | | Maranta arundinacea | FooDB | | | Matricaria recutita | FooDB | | | Matteuccia struthiopteris | FooDB | | | Medicago sativa | FooDB | | | Melissa officinalis L. | FooDB | | | Mentha | FooDB | | | Mentha aquatica | FooDB | | | Mentha arvensis | FooDB | | | Mentha spicata | FooDB | | | Mentha x piperita | FooDB | | | Mespilus germanica | FooDB | | | Metrosideros spp. | Plant | | | Metroxylon sagu | FooDB | | | Miscanthus spp. | Plant | | | Molinia spp. | Plant | | | Momordica charantia | FooDB | | | Morchellaceae | FooDB | | | Morella rubra | FooDB | | | Moringa oleifera | FooDB | | | Morus | FooDB | | | Morus alba | Plant | | | Morus nigra | FooDB | | | Mucuna sempervirens | Plant | | | Muntingia calabura | Plant | | | Musa acuminata | FooDB | | | Musa x paradisiaca | FooDB | | | Muscari armeniacum | Plant | | | Myrica | FooDB | | | Myristica fragrans | FooDB | | | Nelumbo | FooDB | | | Nelumbo nucifera | FooDB | | | Nephelium lappaceum | FooDB | | | Nuphar lutea | FooDB | | | Nymphaea alba | Plant | | | Nymphaea candida | Plant | | | Nymphaea marliacea | Plant | | | Ocimum basilicum | FooDB | | | Oenothera biennis | FooDB | | | Olea europaea | FooDB | | | Opuntia | FooDB | | | Opuntia cochenillifera | FooDB | | | Opuntia macrorhiza | FooDB | | | Origanum majorana | FooDB | | | Origanum onites | FooDB | | | Origanum vulgare | FooDB | | | Origanum X majoricum | FooDB | | | Oryza rufipogon | FooDB | | | Oryza sativa | FooDB | | | Oryza spp. | Plant | | | Pachyrhizus erosus | FooDB | | | Panax ginseng | FooDB | | | Pangium edule | FooDB | | | Panicum miliaceum | FooDB | | | Passiflora edulis | FooDB | | | Passiflora suberosa | Plant | | | Pastinaca sativa | FooDB | | | Pediomelum esculentum | FooDB | | | Pentachondra spp. | Plant | | | Perideridia oregana | FooDB | | | Persea americana | FooDB | | | Petasites japonicus | FooDB | | | Petroselinum crispum | FooDB | | | Phalaris spp. | Plant | | | Phaseolus coccineus | FooDB | | | Phaseolus lunatus | FooDB | | | Phaseolus vulgaris | FooDB | | | Phleum spp. | Plant | | | Phoenix dactylifera | FooDB | | | Photinia melanocarpa | FooDB | | | Phyllostachys edulis | FooDB | | | Physalis | FooDB | | | Physalis philadelphica var. immaculata | FooDB | | | Phytolacca americana | FooDB | | | Picea spp. | Plant | | | Pimenta dioica | FooDB | | | Pimpinella anisum | FooDB | | | Pinus | FooDB | | | Pinus banksiana | Plant | | | Pinus edulis | FooDB | | | Piper nigrum L. | FooDB | | | Pistacia vera | FooDB | | | Pisum sativum | FooDB | | | Pleurotus ostreatus | FooDB | | | Plumbago spp. | Plant | | | Poa spp. | Plant | | | Podocarpus spp. | Plant | | | Polygonum alpinum | FooDB | | | Polygonum spp. | Plant | | | Portulaca oleracea | FooDB | | | Pouteria sapota | FooDB | | | Prunus armeniaca | FooDB | | | Prunus avium | FooDB | - L. Gao, and G. Mazza. Characterization, Quantitation, and Distribution of Anthocyanins and Colorl...
| | Prunus avium L. | FooDB | | | Prunus cerasus | FooDB | | | Prunus domestica | FooDB | | | Prunus dulcis | FooDB | | | Prunus persica | FooDB | | | Prunus persica var. nucipersica | FooDB | | | Prunus persica var. persica | FooDB | | | Prunus tomentosa | FooDB | | | Prunus virginiana | FooDB | | | Pseudotsuga spp. | Plant | | | Psidium cattleianum | FooDB | | | Psidium guajava | FooDB | | | Psophocarpus tetragonolobus | FooDB | | | Punica granatum | FooDB | | | Pyrus communis | FooDB | | | Pyrus pyrifolia | FooDB | | | Quercus | FooDB | | | Raphanus sativus | FooDB | | | Raphanus sativus var. longipinnatus | FooDB | | | Raphanus sativus var. sativus | FooDB | | | Rheum rhabarbarum | FooDB | | | Ribes aureum | FooDB | | | Ribes glandulosum | FooDB | | | Ribes nigrum | FooDB | | | Ribes rubrum | FooDB | | | Ribes uva-crispa | FooDB | | | Rosa | FooDB | | | Rubus arcticus | FooDB | | | Rubus chamaemorus | FooDB | | | Rubus idaeus | FooDB | | | Rubus occidentalis | FooDB | | | Rubus spectabilis | FooDB | | | Rumex | FooDB | | | Rumex acetosa | FooDB | | | Rumex articus | FooDB | | | Sagittaria latifolia | FooDB | | | Salix pulchra | FooDB | | | Salix spp. | Plant | | | Salvia elegans | FooDB | | | Salvia hispanica | FooDB | | | Salvia officinalis | FooDB | | | Salvia rosmarinus | FooDB | | | Sambucus nigra | FooDB | | | Sambucus nigra L. | FooDB | | | Satureja hortensis L. | FooDB | | | Satureja montana | FooDB | | | Scorzonera hispanica | FooDB | | | Secale cereale | FooDB | | | Sechium edule | FooDB | | | Sesamum indicum | FooDB | | | Sesbania bispinosa | FooDB | | | Sinapis alba | FooDB | | | Sinarundinaria spp. | Plant | | | Sisymbrium | FooDB | | | Solanum lycopersicum | FooDB | | | Solanum lycopersicum var. cerasiforme | FooDB | | | Solanum lycopersicum var. lycopersicum | FooDB | | | Solanum melongena | FooDB | - Keiko Azuma, Akio Ohyama, Katsunari Ippoushi, Takashi Ichiyanagi, Atsuko Takeuchi, Takeo Saito an...
| | Solanum quitoense | FooDB | | | Solanum tuberosum | FooDB | | | Sorbus aucuparia | FooDB | | | Sorghum bicolor | FooDB | | | Spinacia oleracea | FooDB | | | Syzygium aromaticum | FooDB | | | Syzygium cumini | FooDB | | | Syzygium jambos | FooDB | | | Tamarindus indica | FooDB | | | Taraxacum officinale | FooDB | | | Tetragonia tetragonioides | FooDB | | | Thelesperma | FooDB | | | Thymus pulegioides | FooDB | | | Thymus vulgaris | FooDB | | | Tilia cordata | FooDB | | | Tilia L. | FooDB | | | Tragopogon porrifolius | FooDB | | | Trigonella foenum-graecum | FooDB | | | Triticum | FooDB | | | Triticum aestivum | FooDB | | | Triticum durum | FooDB | | | Triticum spelta | FooDB | | | Triticum turanicum | FooDB | | | Trochocarpa spp. | Plant | | | Tsuga spp. | Plant | | | Typha angustifolia | FooDB | | | Vaccinium | FooDB | | | Vaccinium angustifolium | FooDB | | | Vaccinium angustifolium X Vaccinium corymbosum | FooDB | | | Vaccinium arboreum | FooDB | | | Vaccinium corymbosum | FooDB | - Kader, F., Rove, B., Girardin, M., and Metche, M. (1996). Fractionation and identification of the...
| | Vaccinium deliciosum | FooDB | | | Vaccinium elliottii | FooDB | | | Vaccinium macrocarpon | FooDB | | | Vaccinium myrtilloides | FooDB | | | Vaccinium myrtillus | FooDB | | | Vaccinium ovalifolium | FooDB | | | Vaccinium ovatum | FooDB | | | Vaccinium oxycoccos | FooDB | | | Vaccinium padifolium | Plant | | | Vaccinium parvifolium | FooDB | | | Vaccinium reticulatum | FooDB | | | Vaccinium spp. | Plant | | | Vaccinium stamineum | FooDB | | | Vaccinium uliginosum | FooDB | | | Vaccinium vitis-idaea | FooDB | | | Valerianella locusta | FooDB | | | Vanilla | FooDB | | | Verbena hybrida | Plant | | | Verbena officinalis | FooDB | | | Viburnum edule | FooDB | | | Vicia faba | FooDB | | | Vigna aconitifolia | FooDB | | | Vigna angularis | FooDB | | | Vigna mungo | FooDB | | | Vigna radiata | FooDB | | | Vigna spp. | Plant | | | Vigna umbellata | FooDB | | | Vigna unguiculata | FooDB | | | Vigna unguiculata ssp. cylindrica | FooDB | | | Vigna unguiculata ssp. unguiculata | FooDB | | | Vigna unguiculata var. sesquipedalis | FooDB | | | Visnea mocanera | Plant | | | Vitis | FooDB | | | Vitis aestivalis | FooDB | | | Vitis labrusca | FooDB | | | Vitis rotundifolia | FooDB | | | Vitis vinifera | LOTUS Database | | | Vitis vinifera L. | FooDB | | | Xanthosoma sagittifolium | FooDB | | | Zea mays L. | FooDB | | | Zingiber officinale | FooDB | | | Zizania | FooDB | | | Zizania aquatica | FooDB | | | Ziziphus zizyphus | FooDB | |
|
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as anthocyanidin-3-o-glycosides. These are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C3-position. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Flavonoids |
|---|
| Sub Class | Flavonoid glycosides |
|---|
| Direct Parent | Anthocyanidin-3-O-glycosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Anthocyanidin-3-o-glycoside
- Flavonoid-3-o-glycoside
- Hydroxyflavonoid
- 7-hydroxyflavonoid
- 5-hydroxyflavonoid
- 4'-hydroxyflavonoid
- 3'-hydroxyflavonoid
- Anthocyanidin
- Hexose monosaccharide
- Glycosyl compound
- O-glycosyl compound
- Benzopyran
- 1-benzopyran
- Benzenetriol
- Pyrogallol derivative
- Phenol
- 1-hydroxy-2-unsubstituted benzenoid
- 1-hydroxy-4-unsubstituted benzenoid
- Oxane
- Benzenoid
- Monosaccharide
- Monocyclic benzene moiety
- Heteroaromatic compound
- Secondary alcohol
- Acetal
- Organoheterocyclic compound
- Oxacycle
- Polyol
- Organic oxygen compound
- Hydrocarbon derivative
- Alcohol
- Organooxygen compound
- Primary alcohol
- Organic cation
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| General References | - Mirsaeedghazi H, Emam-Djomeh Z, Ahmadkhaniha R: Effect of frozen storage on the anthocyanins and phenolic components of pomegranate juice. J Food Sci Technol. 2014 Feb;51(2):382-6. doi: 10.1007/s13197-011-0504-z. Epub 2011 Aug 24. [PubMed:24493900 ]
- Cosme F, Vilela A, Moreira L, Moura C, Enriquez JAP, Filipe-Ribeiro L, Nunes FM: Terroir Effect on the Phenolic Composition and Chromatic Characteristics of Mencia/Jaen Monovarietal Wines: Bierzo D.O. (Spain) and Dao D.O. (Portugal). Molecules. 2020 Dec 18;25(24). pii: molecules25246008. doi: 10.3390/molecules25246008. [PubMed:33353130 ]
- Saenjum C, Pattananandecha T, Nakagawa K: Antioxidative and Anti-Inflammatory Phytochemicals and Related Stable Paramagnetic Species in Different Parts of Dragon Fruit. Molecules. 2021 Jun 10;26(12). pii: molecules26123565. doi: 10.3390/molecules26123565. [PubMed:34200974 ]
- Alshamar HA, Dapson RW: Molecular stabilization and complexation: the secrets of making a nuclear-selective histological stain from naturally occurring anthocyanins without oxidation. Biotech Histochem. 2021 Apr;96(3):161-170. doi: 10.1080/10520295.2021.1881617. Epub 2021 Feb 15. [PubMed:33586559 ]
- Qamar M, Akhtar S, Ismail T, Yuan Y, Ahmad N, Tawab A, Ismail A, Barnard RT, Cooper MA, Blaskovich MAT, Ziora ZM: Syzygium cumini(L.),Skeels fruit extracts: In vitro and in vivo anti-inflammatory properties. J Ethnopharmacol. 2021 May 10;271:113805. doi: 10.1016/j.jep.2021.113805. Epub 2021 Jan 16. [PubMed:33465442 ]
- Aksornchu P, Chamnansilpa N, Adisakwattana S, Thilavech T, Choosak C, Marnpae M, Makynen K, Dahlan W, Ngamukote S: Inhibitory Effect of Antidesma bunius Fruit Extract on Carbohydrate Digestive Enzymes Activity and Protein Glycation In Vitro. Antioxidants (Basel). 2020 Dec 30;10(1). pii: antiox10010032. doi: 10.3390/antiox10010032. [PubMed:33396768 ]
- Hui X, Wu G, Han D, Stipkovits L, Wu X, Tang S, Brennan MA, Brennan CS: The effects of bioactive compounds from blueberry and blackcurrant powders on the inhibitory activities of oat bran pastes against alpha-amylase and alpha-glucosidase linked to type 2 diabetes. Food Res Int. 2020 Dec;138(Pt A):109756. doi: 10.1016/j.foodres.2020.109756. Epub 2020 Oct 8. [PubMed:33292939 ]
- Ramos-Bell S, Calderon-Santoyo M, Barros-Castillo JC, Ragazzo-Sanchez JA: Characterization of submicron emulsion processed by ultrasound homogenization to protect a bioactive extract from sea grape (Coccoloba uvifera L.). Food Sci Biotechnol. 2020 Jun 6;29(10):1365-1372. doi: 10.1007/s10068-020-00780-0. eCollection 2020 Oct. [PubMed:32999743 ]
- Liu C, Yu Q, Li Z, Jin X, Xing W: Metabolic and transcriptomic analysis related to flavonoid biosynthesis during the color formation of Michelia crassipes tepal. Plant Physiol Biochem. 2020 Oct;155:938-951. doi: 10.1016/j.plaphy.2020.06.050. Epub 2020 Jul 29. [PubMed:32961471 ]
|
|---|