Showing NP-Card for L-Arginine L-Glutamate (NP0002648)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Created at | 2020-11-23 18:26:02 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Updated at | 2021-08-12 19:51:45 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
NP-MRD ID | NP0002648 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Natural Product Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | L-Arginine L-Glutamate | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Provided By | BMRB | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | It was first documented in 2008 (PMID: 17984079). Based on a literature review very few articles have been published on (2R)-2-aminopentanedioic acid; (2S)-2-amino-5-carbamimidamidopentanoic acid. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for NP0002648 (L-Arginine L-Glutamate)RDKit 2D 45 43 0 0 0 0 0 0 0 0999 V2000 5.1658 -0.7938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.7440 -0.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4470 1.1545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.6191 -1.3081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.1973 -0.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2245 -0.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6463 0.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0681 0.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5901 2.0256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.5461 -0.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6982 -2.0555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0164 -1.1150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1930 8.8283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.6121 7.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1719 6.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2684 6.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7086 6.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0658 4.6739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7917 7.1685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0313 5.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1333 4.7463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4881 5.5907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4628 -2.2641 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2906 0.1986 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0252 1.6325 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5718 2.1469 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7194 -2.2520 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6753 0.5917 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2535 1.0696 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7024 -1.7740 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9986 1.4787 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9474 -1.3437 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4899 1.0817 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5825 3.1504 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1670 2.4995 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4943 -2.5369 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2308 9.9114 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2094 9.3604 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0524 7.8072 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4123 5.4883 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4197 8.3474 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8493 5.1096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6875 7.9901 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2320 6.7493 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9072 4.1504 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 2 0 10 12 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 14 20 1 0 20 21 2 0 20 22 1 0 1 23 1 0 1 24 1 0 3 25 1 0 3 26 1 0 5 27 1 6 5 28 1 0 6 29 1 6 6 30 1 0 7 31 1 6 7 32 1 0 8 33 1 6 9 34 1 0 9 35 1 0 12 36 1 0 13 37 1 0 13 38 1 0 14 39 1 6 15 40 1 6 15 41 1 0 16 42 1 6 16 43 1 0 19 44 1 0 22 45 1 0 M END 3D MOL for NP0002648 (L-Arginine L-Glutamate)NP0002648 RDKit 3D 45 43 0 0 0 0 0 0 0 0999 V2000 3.6884 0.5357 0.7123 N 0 0 0 0 0 0 0 0 0 0 0 0 3.3787 -0.2542 -0.4152 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3917 -0.8151 -1.2338 N 0 0 0 0 0 0 0 0 0 0 0 0 2.1567 -0.4775 -0.7176 N 0 0 0 0 0 0 0 0 0 0 0 0 1.1132 0.0882 0.1080 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2220 -0.3199 -0.4619 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2896 0.2996 0.4413 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6317 -0.1186 -0.1431 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7112 0.3856 -1.4809 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.7617 0.3132 0.7150 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6716 1.0427 0.2800 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8001 -0.1057 2.0228 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6932 -1.2934 0.4655 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.1497 -0.2696 -0.4268 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2269 0.1638 0.0255 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2102 -0.9602 0.0499 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5295 -0.4618 0.5002 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4715 -1.2987 0.5736 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6596 0.8654 0.8103 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0250 0.9258 -0.3686 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0450 0.9615 0.3574 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7175 2.0401 -1.1329 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6843 0.7235 0.9541 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9691 0.9493 1.3279 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6410 -0.4480 -2.1745 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8996 -1.6456 -0.8403 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2297 1.1908 0.1515 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1971 -0.3144 1.1471 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2692 -1.4302 -0.4053 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3340 0.0117 -1.4990 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2067 1.3896 0.3743 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1864 -0.0696 1.4767 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5997 -1.2377 -0.1928 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4926 -0.1050 -1.9648 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7743 1.4161 -1.5012 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3988 -1.0043 2.2926 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4829 -1.7453 -0.0663 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0591 -0.8332 1.3133 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1601 -0.6468 -1.4668 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1013 0.6285 1.0174 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5362 0.9840 -0.6614 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8736 -1.6802 0.8533 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2619 -1.5312 -0.8848 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4760 1.4289 0.6857 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0143 2.7224 -0.8769 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 2 0 10 12 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 14 20 1 0 20 21 2 0 20 22 1 0 1 23 1 0 1 24 1 0 3 25 1 0 3 26 1 0 5 27 1 0 5 28 1 0 6 29 1 0 6 30 1 0 7 31 1 0 7 32 1 0 8 33 1 6 9 34 1 0 9 35 1 0 12 36 1 0 13 37 1 0 13 38 1 0 14 39 1 6 15 40 1 0 15 41 1 0 16 42 1 0 16 43 1 0 19 44 1 0 22 45 1 0 M END 3D SDF for NP0002648 (L-Arginine L-Glutamate)RDKit 2D 45 43 0 0 0 0 0 0 0 0999 V2000 5.1658 -0.7938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.7440 -0.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4470 1.1545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.6191 -1.3081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.1973 -0.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2245 -0.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6463 0.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0681 0.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5901 2.0256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.5461 -0.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6982 -2.0555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0164 -1.1150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1930 8.8283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.6121 7.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1719 6.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2684 6.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7086 6.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0658 4.6739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7917 7.1685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0313 5.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1333 4.7463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4881 5.5907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4628 -2.2641 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2906 0.1986 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0252 1.6325 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5718 2.1469 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7194 -2.2520 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6753 0.5917 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2535 1.0696 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7024 -1.7740 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9986 1.4787 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9474 -1.3437 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4899 1.0817 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5825 3.1504 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1670 2.4995 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4943 -2.5369 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2308 9.9114 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2094 9.3604 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0524 7.8072 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4123 5.4883 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4197 8.3474 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8493 5.1096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6875 7.9901 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2320 6.7493 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9072 4.1504 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 2 0 10 12 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 14 20 1 0 20 21 2 0 20 22 1 0 1 23 1 0 1 24 1 0 3 25 1 0 3 26 1 0 5 27 1 6 5 28 1 0 6 29 1 6 6 30 1 0 7 31 1 6 7 32 1 0 8 33 1 6 9 34 1 0 9 35 1 0 12 36 1 0 13 37 1 0 13 38 1 0 14 39 1 6 15 40 1 6 15 41 1 0 16 42 1 6 16 43 1 0 19 44 1 0 22 45 1 0 M END > <DATABASE_ID> NP0002648 > <DATABASE_NAME> NP-MRD > <SMILES> [H]OC(=O)C([H])([H])C([H])([H])[C@@]([H])(N([H])[H])C(=O)O[H].[H]OC(=O)[C@@]([H])(N([H])[H])C([H])([H])C([H])([H])C([H])([H])N=C(N([H])[H])N([H])[H] > <INCHI_IDENTIFIER> InChI=1S/C6H14N4O2.C5H9NO4/c7-4(5(11)12)2-1-3-10-6(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2,6H2,(H,7,8)(H,9,10)/t4-;3-/m01/s1 > <INCHI_KEY> RVEWUBJVAHOGKA-JMGQSLMSSA-N > <FORMULA> C11H23N5O6 > <MOLECULAR_WEIGHT> 321.334 > <EXACT_MASS> 321.164833481 > <JCHEM_ACCEPTOR_COUNT> 6 > <JCHEM_ATOM_COUNT> 45 > <JCHEM_AVERAGE_POLARIZABILITY> 17.91760439390998 > <JCHEM_BIOAVAILABILITY> 1 > <JCHEM_DONOR_COUNT> 4 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> (2R)-2-aminopentanedioic acid; (2S)-2-amino-5-[(diaminomethylidene)amino]pentanoic acid > <ALOGPS_LOGP> -3.87 > <JCHEM_LOGP> -3.2397372587565174 > <ALOGPS_LOGS> -1.36 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 0 > <JCHEM_PHYSIOLOGICAL_CHARGE> 1 > <JCHEM_PKA_STRONGEST_ACIDIC> 2.411351670970451 > <JCHEM_PKA_STRONGEST_BASIC> 11.943936621603124 > <JCHEM_POLAR_SURFACE_AREA> 127.72000000000001 > <JCHEM_REFRACTIVITY> 43.630300000000005 > <JCHEM_ROTATABLE_BOND_COUNT> 9 > <JCHEM_RULE_OF_FIVE> 1 > <ALOGPS_SOLUBILITY> 7.59e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> D-glutamic acid; L-arg > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for NP0002648 (L-Arginine L-Glutamate)NP0002648 RDKit 3D 45 43 0 0 0 0 0 0 0 0999 V2000 3.6884 0.5357 0.7123 N 0 0 0 0 0 0 0 0 0 0 0 0 3.3787 -0.2542 -0.4152 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3917 -0.8151 -1.2338 N 0 0 0 0 0 0 0 0 0 0 0 0 2.1567 -0.4775 -0.7176 N 0 0 0 0 0 0 0 0 0 0 0 0 1.1132 0.0882 0.1080 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2220 -0.3199 -0.4619 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2896 0.2996 0.4413 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6317 -0.1186 -0.1431 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7112 0.3856 -1.4809 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.7617 0.3132 0.7150 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6716 1.0427 0.2800 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8001 -0.1057 2.0228 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6932 -1.2934 0.4655 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.1497 -0.2696 -0.4268 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2269 0.1638 0.0255 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2102 -0.9602 0.0499 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5295 -0.4618 0.5002 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4715 -1.2987 0.5736 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6596 0.8654 0.8103 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0250 0.9258 -0.3686 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0450 0.9615 0.3574 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7175 2.0401 -1.1329 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6843 0.7235 0.9541 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9691 0.9493 1.3279 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6410 -0.4480 -2.1745 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8996 -1.6456 -0.8403 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2297 1.1908 0.1515 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1971 -0.3144 1.1471 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2692 -1.4302 -0.4053 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3340 0.0117 -1.4990 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2067 1.3896 0.3743 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1864 -0.0696 1.4767 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5997 -1.2377 -0.1928 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4926 -0.1050 -1.9648 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7743 1.4161 -1.5012 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3988 -1.0043 2.2926 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4829 -1.7453 -0.0663 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0591 -0.8332 1.3133 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1601 -0.6468 -1.4668 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1013 0.6285 1.0174 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5362 0.9840 -0.6614 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8736 -1.6802 0.8533 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2619 -1.5312 -0.8848 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4760 1.4289 0.6857 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0143 2.7224 -0.8769 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 2 3 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 2 0 10 12 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 14 20 1 0 20 21 2 0 20 22 1 0 1 23 1 0 1 24 1 0 3 25 1 0 3 26 1 0 5 27 1 0 5 28 1 0 6 29 1 0 6 30 1 0 7 31 1 0 7 32 1 0 8 33 1 6 9 34 1 0 9 35 1 0 12 36 1 0 13 37 1 0 13 38 1 0 14 39 1 6 15 40 1 0 15 41 1 0 16 42 1 0 16 43 1 0 19 44 1 0 22 45 1 0 M END PDB for NP0002648 (L-Arginine L-Glutamate)HEADER PROTEIN 12-NOV-20 NONE TITLE NULL COMPND MOLECULE: 20317 SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 12-NOV-20 0 HETATM 1 C UNK 0 -0.304 -0.500 -0.167 0.00 0.00 C+0 HETATM 2 C UNK 0 1.246 -0.582 -0.139 0.00 0.00 C+0 HETATM 3 C UNK 0 -0.796 0.966 -0.214 0.00 0.00 C+0 HETATM 4 C UNK 0 1.866 -2.008 -0.104 0.00 0.00 C+0 HETATM 5 C UNK 0 3.320 -2.046 -0.123 0.00 0.00 C+0 HETATM 6 C UNK 0 -2.913 2.122 -0.103 0.00 0.00 C+0 HETATM 7 N UNK 0 1.369 -2.735 1.075 0.00 0.00 N+0 HETATM 8 N UNK 0 -4.171 1.967 0.064 0.00 0.00 N+0 HETATM 9 N UNK 0 -2.456 3.314 -0.256 0.00 0.00 N+0 HETATM 10 N UNK 0 -2.178 1.070 -0.097 0.00 0.00 N+0 HETATM 11 O UNK 0 3.910 -3.117 -0.166 0.00 0.00 O+0 HETATM 12 O UNK 0 4.019 -1.036 -0.108 0.00 0.00 O+0 HETATM 13 H UNK 0 -0.684 -1.038 -1.040 0.00 0.00 H+0 HETATM 14 H UNK 0 -0.710 -0.985 0.725 0.00 0.00 H+0 HETATM 15 H UNK 0 1.624 -0.067 -1.028 0.00 0.00 H+0 HETATM 16 H UNK 0 1.604 -0.029 0.735 0.00 0.00 H+0 HETATM 17 H UNK 0 -0.346 1.518 0.617 0.00 0.00 H+0 HETATM 18 H UNK 0 -0.468 1.424 -1.151 0.00 0.00 H+0 HETATM 19 H UNK 0 1.511 -2.545 -0.988 0.00 0.00 H+0 HETATM 20 H UNK 0 1.775 -3.673 1.064 0.00 0.00 H+0 HETATM 21 H UNK 0 1.722 -2.259 1.908 0.00 0.00 H+0 HETATM 22 H UNK 0 -4.539 1.108 0.097 0.00 0.00 H+0 HETATM 23 H UNK 0 -4.728 2.712 0.159 0.00 0.00 H+0 HETATM 24 H UNK 0 -3.021 4.055 -0.184 0.00 0.00 H+0 HETATM 25 H UNK 0 -1.550 3.445 -0.448 0.00 0.00 H+0 HETATM 26 H UNK 0 4.898 -1.082 -0.128 0.00 0.00 H+0 HETATM 27 C UNK 0 12.037 -0.106 -0.181 0.00 0.00 C+0 HETATM 28 C UNK 0 11.412 1.315 -0.197 0.00 0.00 C+0 HETATM 29 C UNK 0 13.588 -0.200 -0.158 0.00 0.00 C+0 HETATM 30 C UNK 0 9.961 1.349 -0.200 0.00 0.00 C+0 HETATM 31 C UNK 0 14.106 -1.561 -0.176 0.00 0.00 C+0 HETATM 32 N UNK 0 14.102 0.521 1.018 0.00 0.00 N+0 HETATM 33 O UNK 0 9.376 2.422 -0.202 0.00 0.00 O+0 HETATM 34 O UNK 0 9.274 0.331 -0.194 0.00 0.00 O+0 HETATM 35 O UNK 0 15.312 -1.766 -0.210 0.00 0.00 O+0 HETATM 36 O UNK 0 13.378 -2.551 -0.169 0.00 0.00 O+0 HETATM 37 H UNK 0 11.680 -0.633 -1.072 0.00 0.00 H+0 HETATM 38 H UNK 0 11.650 -0.637 0.695 0.00 0.00 H+0 HETATM 39 H UNK 0 11.775 1.848 -1.081 0.00 0.00 H+0 HETATM 40 H UNK 0 11.756 1.865 0.683 0.00 0.00 H+0 HETATM 41 H UNK 0 13.971 0.314 -1.044 0.00 0.00 H+0 HETATM 42 H UNK 0 15.123 0.465 1.012 0.00 0.00 H+0 HETATM 43 H UNK 0 13.772 0.031 1.853 0.00 0.00 H+0 HETATM 44 H UNK 0 8.395 0.363 -0.189 0.00 0.00 H+0 HETATM 45 H UNK 0 13.701 -3.369 -0.189 0.00 0.00 H+0 CONECT 1 2 3 13 14 CONECT 2 1 4 15 16 CONECT 3 1 10 17 18 CONECT 4 2 5 7 19 CONECT 5 4 11 12 CONECT 6 8 9 10 CONECT 7 4 20 21 CONECT 8 6 22 23 CONECT 9 6 24 25 CONECT 10 3 6 CONECT 11 5 CONECT 12 5 26 CONECT 13 1 CONECT 14 1 CONECT 15 2 CONECT 16 2 CONECT 17 3 CONECT 18 3 CONECT 19 4 CONECT 20 7 CONECT 21 7 CONECT 22 8 CONECT 23 8 CONECT 24 9 CONECT 25 9 CONECT 26 12 CONECT 27 28 29 37 38 CONECT 28 27 30 39 40 CONECT 29 27 31 32 41 CONECT 30 28 33 34 CONECT 31 29 35 36 CONECT 32 29 42 43 CONECT 33 30 CONECT 34 30 44 CONECT 35 31 CONECT 36 31 45 CONECT 37 27 CONECT 38 27 CONECT 39 28 CONECT 40 28 CONECT 41 29 CONECT 42 32 CONECT 43 32 CONECT 44 34 CONECT 45 36 MASTER 0 0 0 0 0 0 0 0 45 0 86 0 END 3D PDB for NP0002648 (L-Arginine L-Glutamate)COMPND NP0002648 HETATM 1 N1 UNL 1 3.688 0.536 0.712 1.00 0.00 N HETATM 2 C1 UNL 1 3.379 -0.254 -0.415 1.00 0.00 C HETATM 3 N2 UNL 1 4.392 -0.815 -1.234 1.00 0.00 N HETATM 4 N3 UNL 1 2.157 -0.477 -0.718 1.00 0.00 N HETATM 5 C2 UNL 1 1.113 0.088 0.108 1.00 0.00 C HETATM 6 C3 UNL 1 -0.222 -0.320 -0.462 1.00 0.00 C HETATM 7 C4 UNL 1 -1.290 0.300 0.441 1.00 0.00 C HETATM 8 C5 UNL 1 -2.632 -0.119 -0.143 1.00 0.00 C HETATM 9 N4 UNL 1 -2.711 0.386 -1.481 1.00 0.00 N HETATM 10 C6 UNL 1 -3.762 0.313 0.715 1.00 0.00 C HETATM 11 O1 UNL 1 -4.672 1.043 0.280 1.00 0.00 O HETATM 12 O2 UNL 1 -3.800 -0.106 2.023 1.00 0.00 O HETATM 13 N5 UNL 1 -1.693 -1.293 0.466 1.00 0.00 N HETATM 14 C7 UNL 1 -1.150 -0.270 -0.427 1.00 0.00 C HETATM 15 C8 UNL 1 0.227 0.164 0.026 1.00 0.00 C HETATM 16 C9 UNL 1 1.210 -0.960 0.050 1.00 0.00 C HETATM 17 C10 UNL 1 2.530 -0.462 0.500 1.00 0.00 C HETATM 18 O3 UNL 1 3.472 -1.299 0.574 1.00 0.00 O HETATM 19 O4 UNL 1 2.660 0.865 0.810 1.00 0.00 O HETATM 20 C11 UNL 1 -2.025 0.926 -0.369 1.00 0.00 C HETATM 21 O5 UNL 1 -3.045 0.961 0.357 1.00 0.00 O HETATM 22 O6 UNL 1 -1.718 2.040 -1.133 1.00 0.00 O HETATM 23 H1 UNL 1 4.684 0.723 0.954 1.00 0.00 H HETATM 24 H2 UNL 1 2.969 0.949 1.328 1.00 0.00 H HETATM 25 H3 UNL 1 4.641 -0.448 -2.175 1.00 0.00 H HETATM 26 H4 UNL 1 4.900 -1.646 -0.840 1.00 0.00 H HETATM 27 H5 UNL 1 1.230 1.191 0.151 1.00 0.00 H HETATM 28 H6 UNL 1 1.197 -0.314 1.147 1.00 0.00 H HETATM 29 H7 UNL 1 -0.269 -1.430 -0.405 1.00 0.00 H HETATM 30 H8 UNL 1 -0.334 0.012 -1.499 1.00 0.00 H HETATM 31 H9 UNL 1 -1.207 1.390 0.374 1.00 0.00 H HETATM 32 H10 UNL 1 -1.186 -0.070 1.477 1.00 0.00 H HETATM 33 H11 UNL 1 -2.600 -1.238 -0.193 1.00 0.00 H HETATM 34 H12 UNL 1 -3.493 -0.105 -1.965 1.00 0.00 H HETATM 35 H13 UNL 1 -2.774 1.416 -1.501 1.00 0.00 H HETATM 36 H14 UNL 1 -3.399 -1.004 2.293 1.00 0.00 H HETATM 37 H15 UNL 1 -2.483 -1.745 -0.066 1.00 0.00 H HETATM 38 H16 UNL 1 -2.059 -0.833 1.313 1.00 0.00 H HETATM 39 H17 UNL 1 -1.160 -0.647 -1.467 1.00 0.00 H HETATM 40 H18 UNL 1 0.101 0.629 1.017 1.00 0.00 H HETATM 41 H19 UNL 1 0.536 0.984 -0.661 1.00 0.00 H HETATM 42 H20 UNL 1 0.874 -1.680 0.853 1.00 0.00 H HETATM 43 H21 UNL 1 1.262 -1.531 -0.885 1.00 0.00 H HETATM 44 H22 UNL 1 3.476 1.429 0.686 1.00 0.00 H HETATM 45 H23 UNL 1 -1.014 2.722 -0.877 1.00 0.00 H CONECT 1 2 23 24 CONECT 2 3 4 4 CONECT 3 25 26 CONECT 4 5 CONECT 5 6 27 28 CONECT 6 7 29 30 CONECT 7 8 31 32 CONECT 8 9 10 33 CONECT 9 34 35 CONECT 10 11 11 12 CONECT 12 36 CONECT 13 14 37 38 CONECT 14 15 20 39 CONECT 15 16 40 41 CONECT 16 17 42 43 CONECT 17 18 18 19 CONECT 19 44 CONECT 20 21 21 22 CONECT 22 45 END SMILES for NP0002648 (L-Arginine L-Glutamate)[H]OC(=O)C([H])([H])C([H])([H])[C@@]([H])(N([H])[H])C(=O)O[H].[H]OC(=O)[C@@]([H])(N([H])[H])C([H])([H])C([H])([H])C([H])([H])N=C(N([H])[H])N([H])[H] INCHI for NP0002648 (L-Arginine L-Glutamate)InChI=1S/C6H14N4O2.C5H9NO4/c7-4(5(11)12)2-1-3-10-6(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2,6H2,(H,7,8)(H,9,10)/t4-;3-/m01/s1 3D Structure for NP0002648 (L-Arginine L-Glutamate) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C11H23N5O6 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 321.3340 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 321.16483 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | (2R)-2-aminopentanedioic acid; (2S)-2-amino-5-[(diaminomethylidene)amino]pentanoic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | D-glutamic acid; L-arg | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | [H]OC(=O)C([H])([H])C([H])([H])[C@@]([H])(N([H])[H])C(=O)O[H].[H]OC(=O)[C@@]([H])(N([H])[H])C([H])([H])C([H])([H])C([H])([H])N=C(N([H])[H])N([H])[H] | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C6H14N4O2.C5H9NO4/c7-4(5(11)12)2-1-3-10-6(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2,6H2,(H,7,8)(H,9,10)/t4-;3-/m01/s1 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | RVEWUBJVAHOGKA-JMGQSLMSSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Shift Submissions | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Species | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Species of Origin | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FoodDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 58830811 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|