Record Information |
---|
Version | 1.0 |
---|
Created at | 2007-01-22 23:51:51 UTC |
---|
Updated at | 2022-09-30 16:07:30 UTC |
---|
NP-MRD ID | NP0001384 |
---|
Secondary Accession Numbers | None |
---|
Natural Product Identification |
---|
Common Name | p-Cymene |
---|
Description | Cymene, or p-cymene also known as p-cymol or isopropyltoluene, is a naturally occurring aromatic organic compound. It is classified as a hydrocarbon related to a monoterpene. Its structure consists of a benzene ring para-substituted with a methyl group and an isopropyl group. It is insoluble in water, but miscible with ethanol and ether. Cymene is a constituent of a number of essential oils, most commonly the oil of cumin and thyme. There are two less common geometric isomers. O-Cymene, in which the alkyl groups are ortho-substituted, and m-cymene, in which they are meta-substituted. P-Cymene is the only natural isomer. Cymene is a common ligand for ruthenium. |
---|
Structure | InChI=1S/C10H14/c1-8(2)10-6-4-9(3)5-7-10/h4-8H,1-3H3 |
---|
Synonyms | Value | Source |
---|
1-Isopropyl-4-methylbenzene | ChEBI | 1-Methyl-4-(1-methylethyl)benzene | ChEBI | 1-Methyl-4-(propan-2-yl)benzene | ChEBI | 1-Methyl-4-isopropylbenzene | ChEBI | 4-Cymene | ChEBI | 4-Isopropyl-1-methylbenzene | ChEBI | 4-Isopropyltoluene | ChEBI | 4-Methyl-1-isopropylbenzene | ChEBI | Cymene | ChEBI | Isopropyltoluene | ChEBI | p-Cimene | ChEBI | p-Cymol | ChEBI | p-Isopropyltoluene | ChEBI | p-Methylcumene | ChEBI | p-Methylisopropylbenzene | ChEBI | Para-cymene | ChEBI | 1-Isopropyl-4-methyl-benzene | HMDB | 1-Methyl-4-(1-methylethyl)-benzene | HMDB | 2-p-Tolylpropane | HMDB | 4-Isopropylbenzyl radical | HMDB | 4-Methyl-1-(propan-2-yl)benzene | HMDB | Camphogen | HMDB | Cymol | HMDB | Dolcymene | HMDB | p- Isopropylmethylbenzene | HMDB | p-Mentha-1,3,5-triene | HMDB | p-Methyl cumene | HMDB | p-Methyl-cumene | HMDB | Paracymene | HMDB | Paracymol | HMDB | 4-Methylisopropylbenzene | HMDB |
|
---|
Chemical Formula | C10H14 |
---|
Average Mass | 134.2220 Da |
---|
Monoisotopic Mass | 134.10955 Da |
---|
IUPAC Name | 1-methyl-4-(propan-2-yl)benzene |
---|
Traditional Name | cymene |
---|
CAS Registry Number | 99-87-6 |
---|
SMILES | CC(C)C1=CC=C(C)C=C1 |
---|
InChI Identifier | InChI=1S/C10H14/c1-8(2)10-6-4-9(3)5-7-10/h4-8H,1-3H3 |
---|
InChI Key | HFPZCAJZSCWRBC-UHFFFAOYSA-N |
---|
Experimental Spectra |
---|
|
| Spectrum Type | Description | Depositor Email | Depositor Organization | Depositor | Deposition Date | View |
---|
| Predicted Spectra |
---|
|
| Spectrum Type | Description | Depositor ID | Depositor Organization | Depositor | Deposition Date | View |
---|
1D NMR | 13C NMR Spectrum (1D, 25 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 100 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 13C NMR Spectrum (1D, 252 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 1000 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 13C NMR Spectrum (1D, 50 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 200 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 13C NMR Spectrum (1D, 75 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 300 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 400 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 13C NMR Spectrum (1D, 101 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 500 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 13C NMR Spectrum (1D, 126 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 13C NMR Spectrum (1D, 151 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 600 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 700 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 13C NMR Spectrum (1D, 176 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 13C NMR Spectrum (1D, 201 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 800 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 1H NMR Spectrum (1D, 900 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum | 1D NMR | 13C NMR Spectrum (1D, 226 MHz, D2O, predicted) | Wishart Lab | Wishart Lab | David Wishart | 2021-06-20 | View Spectrum |
| Chemical Shift Submissions |
---|
|
| Not Available | Species |
---|
Species of Origin | Species Name | Source | Reference |
---|
Abies sachalinensis | LOTUS Database | | Achillea abrotanoides | LOTUS Database | | Achillea ageratum | LOTUS Database | | Achillea asiatica | LOTUS Database | | Achillea grandifolia | LOTUS Database | | Achillea millefolium | KNApSAcK Database | | Achillea nobilis | LOTUS Database | | Achyrospermum africanum | LOTUS Database | | Acorus calamus | LOTUS Database | | Acorus calanus L. | KNApSAcK Database | | Acorus gramineus | LOTUS Database | | Actinidia chinensis | LOTUS Database | | Actinodium cunninghamii | LOTUS Database | | Aegle marmelos | Plant | | Aframomum angustifolium | LOTUS Database | | Aframomum melegueta | LOTUS Database | | Agastache rugosa | LOTUS Database | | Agastache rugosus | KNApSAcK Database | | Agathosma betulina | LOTUS Database | | Ageratina adenophora | Plant | | Ageratum conyzoides | LOTUS Database | | Ajania fastigiata | LOTUS Database | | Allium cepa | FooDB | | Aloysia citrodora | LOTUS Database | | Aloysia gratissima | LOTUS Database | | Aloysia triphylla | LOTUS Database | | Alphinia galanga | - | | Alpinia chinensis | LOTUS Database | | Alpinia conchigera | LOTUS Database | | Alpinia galanga | LOTUS Database | | Alpinia latilabris | LOTUS Database | | Alpinia zerumbet | LOTUS Database | | Ambrosia artemisiifolia | LOTUS Database | | Ambrosia trifida | KNApSAcK Database | | Amomum medium | KNApSAcK Database | | Anethum foeniculum | Plant | | Anethum graveolens | FooDB | | Angelica acutiloba | KNApSAcK Database | | Angelica acutiloba var.sugiyamae | KNApSAcK Database | | Angelica archangelica | LOTUS Database | | Angelica dahurica | Plant | | Angelica gigas | LOTUS Database | | Angelica pubescens f.biserrata | KNApSAcK Database | | Angelica pubescentis | Plant | | Annona reticulata | LOTUS Database | | Anthemis aciphylla | LOTUS Database | | Anthemis aciphylla BOISS.var.discoidea BOISS | KNApSAcK Database | | Apium graveolens | FooDB | | Apium graveolens var. dulce | FooDB | - Alexander J. MacLeod, Glesni MacLeod, G. Subramanian. Volatile aroma constituents of celery. Phyt...
| Apium graveolens var. rapaceum | FooDB | - Glesni MacLeod and Jennifer M. Ames. Volatile components of celery and celeriac. Phytochemistry. ...
| Aristolochia trilobata | KNApSAcK Database | | Artemisia afra | LOTUS Database | | Artemisia alba | LOTUS Database | | Artemisia annua | KNApSAcK Database | | Artemisia arborescens | LOTUS Database | | Artemisia arbuscula | LOTUS Database | | Artemisia capillaris | KNApSAcK Database | | Artemisia dracunculus | FooDB | | Artemisia halophila | LOTUS Database | | Artemisia herba-alba | LOTUS Database | | Artemisia jacutica | LOTUS Database | | Artemisia judaica | LOTUS Database | | Artemisia lagocephala | LOTUS Database | | Artemisia macrocephala | LOTUS Database | | Artemisia molinieri | LOTUS Database | | Artemisia rubripes | LOTUS Database | | Artemisia salsoloides | LOTUS Database | | Artemisia santonicum | LOTUS Database | | Artemisia scoparia. | KNApSAcK Database | | Artemisia sericea | LOTUS Database | | Artemisia thuscula | LOTUS Database | | Artemisia vulgaris | LOTUS Database | | Asarum canadense | LOTUS Database | | Asarum fauriei | LOTUS Database | | Asarum heterotropoides var.mandsuricum | KNApSAcK Database | | Asarum sieboldii | KNApSAcK Database | | Asarum yakusimense | LOTUS Database | | Aster scaber | LOTUS Database | | Athamanta macedonica | LOTUS Database | | Aucoumea klaineana | LOTUS Database | | Austrobaileya scandens | LOTUS Database | | Azadirachta indica | KNApSAcK Database | | Baccharis dracunculifolia | LOTUS Database | | Baeckea frutescens | - | | Bellis perennis | LOTUS Database | | Betonica macrantha | LOTUS Database | | Bistorta manshuriensis | LOTUS Database | | Blepharocalyx tweediei | LOTUS Database | | Boronia latipinna | LOTUS Database | | Boswellia sacra | LOTUS Database | | Boswellia serrata | LOTUS Database | | Bothriochloa bladhii | LOTUS Database | | Bunium persicum | LOTUS Database | | Bupleurum fruticescens | LOTUS Database | | Bupleurum fruticosum | LOTUS Database | | Bupleurum gibraltaricum | LOTUS Database | | Caesulia axillaris | LOTUS Database | | Calamintha nepeta subsp. glandulosa | KNApSAcK Database | | Callistemon linearis | LOTUS Database | | Callistemon rigidus | LOTUS Database | | Callitropsis nootkatensis | LOTUS Database | | Calyptranthes spruceana | LOTUS Database | | Canella winterana | LOTUS Database | | Cannabis sativa | CannabisDB | | Capsicum annuum | FooDB | | Carthamus tinctorius | FooDB | | Carum carvi | FooDB | | Carum copticum | KNApSAcK Database | | Centaurea benedicta | LOTUS Database | | Centaurea sessilis | KNApSAcK Database | | Centaurea solstitialis | LOTUS Database | | Centratherum punctatum | LOTUS Database | | Chaerophyllum macrospermum | LOTUS Database | | Chamaecyparis obtusa | LOTUS Database | | Chamaecyparis pisifera | LOTUS Database | | Chamaemelum nobile | FooDB | | Chenopodium ambrosioides | KNApSAcK Database | | Chenopodium multifidum | LOTUS Database | | Chiliadenus lopadusanus | LOTUS Database | | Chromolaena odorata | LOTUS Database | | Chrysanthemum indicum | LOTUS Database | | Cinnamomum aromaticum | FooDB | | Cinnamomum burmanni | LOTUS Database | | Cinnamomum camphora | LOTUS Database | | Cinnamomum illicioides | KNApSAcK Database | | Cinnamomum tamala | LOTUS Database | | Cinnamomum verum | FooDB | | Cistus albidus | KNApSAcK Database | | Cistus incanus | LOTUS Database | | Citrus aurantifolia | KNApSAcK Database | | Citrus aurantiifolia | FooDB | | Citrus aurantium | KNApSAcK Database | | Citrus grandis | KNApSAcK Database | | Citrus hystrix | KNApSAcK Database | | Citrus iyo | LOTUS Database | | Citrus junos | LOTUS Database | | Citrus limon | KNApSAcK Database | | Citrus maxima | FooDB | | Citrus medica | LOTUS Database | | Citrus natsudaidai | LOTUS Database | | Citrus paradisi | KNApSAcK Database | | Citrus reticulata | KNApSAcK Database | | Citrus sinensis | KNApSAcK Database | | Citrus unshiu | LOTUS Database | | Citrus wilsonii | LOTUS Database | | Citrus X sinensis (L.) Osbeck (pro. sp.) | FooDB | | Cleistopholis patens | LOTUS Database | | Cleonia lusitanica | LOTUS Database | | Clinopodium brownei | LOTUS Database | | Clinopodium gilliesii | LOTUS Database | | Clinopodium grandiflorum | LOTUS Database | | Clinopodium serpyllifolium | LOTUS Database | | Clinopodium suaveolens | LOTUS Database | | Coleus aegyptiacus | LOTUS Database | | Coleus amboinicus | LOTUS Database | | Coleus aromaticus | Plant | | Commiphora africana | LOTUS Database | | Commiphora gurreh | LOTUS Database | | Conobea scoparioides | LOTUS Database | | Conyza newii | KNApSAcK Database | | Coriandrum sativum | LOTUS Database | | Coriandrum sativum L. | FooDB | | Coridothymus capitatus | KNApSAcK Database | | Corymbia maculata | LOTUS Database | | Cotinus coggygria | LOTUS Database | | Crithmum maritimum | LOTUS Database | | Crocus sativus | FooDB | | Croton conduplicatus | LOTUS Database | | Croton sarcopetalus | LOTUS Database | | Cryptomeria japonica | LOTUS Database | | Cryptotaenia japonica | LOTUS Database | | Cuminum cyminum | KNApSAcK Database | | Cuminum cyminum L. | KNApSAcK Database | | Cupressus sempervirens | LOTUS Database | | Curcuma amanda Roxb | KNApSAcK Database | | Curcuma longa | FooDB | | Curcuma mangga | KNApSAcK Database | | Curcuma pierreana | LOTUS Database | | Curcuma xanthorrhiza | KNApSAcK Database | | Cyclotrichium niveum | LOTUS Database | | Cymbopogon flexuosus | LOTUS Database | | Cymbopogon martinii | LOTUS Database | | Cyperus rotundus | Plant | | Cyperus rotundus L. | KNApSAcK Database | | Daucus carota | KNApSAcK Database | | Daucus carota ssp. sativus | FooDB | | Dicyclophora persica | - | | Diplotaenia cachrydifolia | LOTUS Database | | Dittrichia graveolens | KNApSAcK Database | | Dysphania ambrosioides | Plant | | Echinophora tenuifolia | LOTUS Database | | Echinophora tournefortii | LOTUS Database | | Elettaria cardamomum | FooDB | | Elsholtzia blanda | LOTUS Database | | Elsholtzia ciliata | LOTUS Database | | Elsholtzia fruticosa | LOTUS Database | | Elsholtzia pilosa | LOTUS Database | | Erigeron canadensis | LOTUS Database | | Erigeron philadelphicus | LOTUS Database | | Espeletia timotensis | LOTUS Database | | Etlingera elatior | LOTUS Database | | Eucalyptus aggregata | KNApSAcK Database | | Eucalyptus alba | KNApSAcK Database | | Eucalyptus angulosa | LOTUS Database | | Eucalyptus apodophylla | LOTUS Database | | Eucalyptus brassiana | LOTUS Database | | Eucalyptus bridgesiana | LOTUS Database | | Eucalyptus camaldulensis | KNApSAcK Database | | Eucalyptus citriodora | KNApSAcK Database | | Eucalyptus cloeziana | LOTUS Database | | Eucalyptus crenulata | LOTUS Database | | Eucalyptus cunninghamii | LOTUS Database | | Eucalyptus dealbata | LOTUS Database | | Eucalyptus deglupta | KNApSAcK Database | | Eucalyptus delegatensis | LOTUS Database | | Eucalyptus globulus | KNApSAcK Database | | Eucalyptus gomphocephala | KNApSAcK Database | | Eucalyptus grandis | KNApSAcK Database | | Eucalyptus microtheca | KNApSAcK Database | | Eucalyptus mitchelliana | LOTUS Database | | Eucalyptus nitens | KNApSAcK Database | | Eucalyptus nova-anglica | LOTUS Database | | Eucalyptus porosa | LOTUS Database | | Eucalyptus pulverulenta | LOTUS Database | | Eucalyptus radiata | LOTUS Database | | Eucalyptus robusta | KNApSAcK Database | | Eucalyptus saligna | KNApSAcK Database | | Eucalyptus sideroxylon | LOTUS Database | | Eucalyptus tereticornis | KNApSAcK Database | | Eupatorium cannabinum | LOTUS Database | | Eupatorium capillifolium | LOTUS Database | | Eupatorium fortunei | KNApSAcK Database | | Falcaria vulgaris | KNApSAcK Database | | Ferula jaeschkeana | LOTUS Database | | Ferulago nodosa | LOTUS Database | | Ferulago thirkeana | LOTUS Database | | Ficus carica | FooDB | | Foeniculum vulgare | FooDB | | Forsythia suspensa | KNApSAcK Database | | Geum heterocarpum | LOTUS Database | | Ginkgo biloba | FooDB | | Glycyrrhiza glabra | LOTUS Database | | Grindelia hirsutula | LOTUS Database | | Guatteria hispida | Plant | | Guatteriopsis hispida | KNApSAcK Database | | Hedyosmum mexicanum | LOTUS Database | | Helianthus annuus L. | FooDB | | Helichrysum odoratissimum | LOTUS Database | | Heracleum dissectum | LOTUS Database | | Heracleum persicum | LOTUS Database | | Hesperozygis rhododon | LOTUS Database | | Heterotheca subaxillaris | LOTUS Database | | Houttuynia cordata | KNApSAcK Database | | Hypericum hyssopifolium | LOTUS Database | | Hyptis goyazensis | LOTUS Database | | Hyptis suaveolens | LOTUS Database | | Hyssopus officinalis L. | FooDB | | Hyssopus seravschanicus | LOTUS Database | | Illicium verum | FooDB | | Inula racemosa | LOTUS Database | | Isodon melissoides | LOTUS Database | | Isodon rubescens | Plant | | Juniperus communis | LOTUS Database | | Juniperus drupacea | LOTUS Database | | Juniperus durangensis | LOTUS Database | | Juniperus monticola | LOTUS Database | | Juniperus occidentalis HOOK. | LOTUS Database | | Juniperus oxycedrus | LOTUS Database | | Juniperus rigida | KNApSAcK Database | | Kunzea salina | LOTUS Database | | Kunzea sinclairii | LOTUS Database | | Laggera alata | LOTUS Database | | Lagoecia cuminoides | LOTUS Database | | Lantana camara | KNApSAcK Database | | Lantana strigocamara | LOTUS Database | | Lantana ukambensis | LOTUS Database | | Larix gmelini | LOTUS Database | | Larix kaempferi | LOTUS Database | | Larix sibirica | LOTUS Database | | Larix sukaczewii | LOTUS Database | | Laurus nobilis | LOTUS Database | | Laurus nobilis L. | FooDB | | Lavandin abrialis | - | | Lavandula angustifolia | KNApSAcK Database | | Lavandula canarien-sis | KNApSAcK Database | | Lavandula gibsoni | KNApSAcK Database | | Lavandula latifolia | KNApSAcK Database | | Lavandula multifida | KNApSAcK Database | | Lavandula stoechas | KNApSAcK Database | | Ledum palustre | LOTUS Database | | Leonotis leonurus | LOTUS Database | | Lepechinia chamaedryoides | LOTUS Database | | Leptospermum scoparium | KNApSAcK Database | | Levisticum officinale | FooDB | | Libocedrus bidwillii | LOTUS Database | | Ligusticum porteri | LOTUS Database | | Lindera aggregata | LOTUS Database | | Lippia chevalieri | KNApSAcK Database | | Lippia graveolens | LOTUS Database | | Lippia multiflora | KNApSAcK Database | | Lippia nodiflora | LOTUS Database | | Lippia origanoides | LOTUS Database | | Lippia rehmannii | LOTUS Database | | Lippia ukambensis | KNApSAcK Database | | Liquidambar styraciflua | LOTUS Database | | Litchi chinensis | LOTUS Database | | Litsea cubeba | KNApSAcK Database | | Litsea glaucescens | LOTUS Database | | Magnolia officinalis | KNApSAcK Database | | Malus domestica | LOTUS Database | | Mangifera indica | KNApSAcK Database | | Marrubium vulgare L. | KNApSAcK Database | | Matricaria chamomilla | LOTUS Database | | Melaleuca alternifolia | LOTUS Database | | Melaleuca leucadendra L. | KNApSAcK Database | | Melaleuca linariifolia | LOTUS Database | | Melia azadirach | KNApSAcK Database | | Melia azedarach | Plant | | Melissa officinalis L. | FooDB | | Mentha aquatica | FooDB | | Mentha arvensis | FooDB | | Mentha arvensis L. | KNApSAcK Database | | Mentha piperita | LOTUS Database | | Mentha piperita L. | KNApSAcK Database | | Mentha rotundifolia | LOTUS Database | | Mentha spicata | FooDB | | Mentha verticillata | LOTUS Database | | Mentha x piperita | FooDB | | Micromeria biflora | LOTUS Database | | Micromeria cristata | LOTUS Database | | Micromeria maderensis | LOTUS Database | | Micromeria myrtifolia | LOTUS Database | | Mikania cordifolia | LOTUS Database | | Minthostachys andina | LOTUS Database | | Molopospermum peloponnesiacum | LOTUS Database | | Momordica charantia | FooDB | | Monarda citriodora | LOTUS Database | | Monarda fistulosa | LOTUS Database | | Monodora myristica | KNApSAcK Database | | Moringa oleifera | Plant | | Moringa peregrina | Plant | | Mosla cavaleriei | LOTUS Database | | Mosla chinensis | LOTUS Database | | Mosla dianthera | KNApSAcK Database | | Myrcianthes fragrans | LOTUS Database | | Myrciaria floribunda | LOTUS Database | | Myristica fragrans | FooDB | | Myrtus communis | KNApSAcK Database | | Narcissus tazetta | LOTUS Database | | Nasutitermes nigriceps | LOTUS Database | | Nepeta crispa | LOTUS Database | | Nepeta nepetella | LOTUS Database | | Nepeta nuda | LOTUS Database | | Nepeta racemosa | LOTUS Database | | Nigella sativa | LOTUS Database | | Nigella sativa L | KNApSAcK Database | | Notopterygium forbesii | KNApSAcK Database | | Ocimum americanum | LOTUS Database | | Ocimum basilicum | FooDB | | Ocimum gratissimum | LOTUS Database | | Ocotea veraguensis | KNApSAcK Database | | Oenanthe aquatica | LOTUS Database | | Origanum acutidens | LOTUS Database | | Origanum adanense | LOTUS Database | | Origanum cordifolium | LOTUS Database | | Origanum dictamnus | LOTUS Database | | Origanum majorana | FooDB | | Origanum majoricum | LOTUS Database | | Origanum minutiflorum | LOTUS Database | | Origanum onites | FooDB | | Origanum sipyleum | LOTUS Database | | Origanum syriacum | LOTUS Database | | Origanum vulgare | FooDB | | Osbornia octodonta | LOTUS Database | | Osmorhiza aristata | LOTUS Database | | Parthenium argentatum | LOTUS Database | | Pastinaca sativa | FooDB | | Pectis elongata | LOTUS Database | | Pelargonium capitatum | KNApSAcK Database | | Pelargonium citronellum | LOTUS Database | | Pelargonium endlicherianum | LOTUS Database | | Pelargonium graveolens | LOTUS Database | | Pelargonium quercifolium | KNApSAcK Database | | Pelargonium tomentosum | KNApSAcK Database | | Pelargonium vitifolium | LOTUS Database | | Perilla frutescens | LOTUS Database | | Perilla frutescens var.arguta | KNApSAcK Database | | Petasites albus | KNApSAcK Database | | Petasites hybridus | KNApSAcK Database | | Petroselinum crispum | FooDB | | Peucedanum zenkeri | LOTUS Database | | Phagnalon sordidum | KNApSAcK Database | | Phaseolus vulgaris | LOTUS Database | | Picea abies | LOTUS Database | | Picea glehnii | LOTUS Database | | Picea koraiensis | LOTUS Database | | Picea obovata | LOTUS Database | | Picea rubens | LOTUS Database | | Pieris napi | LOTUS Database | | Pimenta dioica | FooDB | | Pimenta racemosa | LOTUS Database | | Pimpinella anisum | LOTUS Database | | Pimpinella serbica | LOTUS Database | | Pinus aristata | LOTUS Database | | Pinus cembroides | LOTUS Database | | Pinus flexilis | LOTUS Database | | Pinus halepensis | KNApSAcK Database | | Pinus merkusii | LOTUS Database | | Pinus mugo subsp. Mugo | KNApSAcK Database | | Pinus pumila | LOTUS Database | | Pinus sibirica | KNApSAcK Database | | Pinus sylvestris | LOTUS Database | | Piper arboreum | KNApSAcK Database | | Piper auritum | LOTUS Database | | Piper betle | LOTUS Database | | Piper fimbriulatum | KNApSAcK Database | | Piper gibbilimbum | LOTUS Database | | Piper guineense | LOTUS Database | | Piper marginatum | LOTUS Database | | Piper nigrum | KNApSAcK Database | | Piper nigrum L. | FooDB | | Piper obliquum | KNApSAcK Database | | Piper regnellii | LOTUS Database | | Piper sylvestre | LOTUS Database | | Piper vitaceum | LOTUS Database | | Pistacia integerrima | LOTUS Database | | Pistacia vera | LOTUS Database | | Pittosporum balfourii | LOTUS Database | | Plagiochila rutilans | LOTUS Database | | Plectranthus barbatus | Plant | | Plectranthus marrubioides | KNApSAcK Database | | Poliomintha incana | LOTUS Database | | Polygala senega | LOTUS Database | | Porophyllum ruderale | LOTUS Database | | Prangos uechtritzii | LOTUS Database | | Prangos uloptera | LOTUS Database | | Prostanthera ovalifolia | LOTUS Database | | Protium heptaphyllum | LOTUS Database | | Prunus armeniaca | FooDB | | Prunus armenica | KNApSAcK Database | | Psiadia altissima | LOTUS Database | | Psidium salutare | LOTUS Database | | Pteronia incana | LOTUS Database | | Ptychopetalum olacoides | LOTUS Database | | Pycnanthemum floridanum | LOTUS Database | | Quercus coccifera | KNApSAcK Database | | Quercus ilex | LOTUS Database | | Rabdosia rubescens | KNApSAcK Database | | Rhanterium epapposum | LOTUS Database | | Rhaponticum carthamoides | KNApSAcK Database | | Rhodiola rosea | Plant | | Rhodiola rosea L. | KNApSAcK Database | | Rhododendron dauricum | LOTUS Database | | Rhododendron groenlandicum | LOTUS Database | | Ribes nigrum | FooDB | | Rosmarinus officinalis | KNApSAcK Database | | Ruta angustifolia | LOTUS Database | | Salvia absconditiflora | LOTUS Database | | Salvia africana-lutea | LOTUS Database | | Salvia caespitosa | LOTUS Database | | Salvia cuspidata | LOTUS Database | | Salvia dorisiana | LOTUS Database | | Salvia fruticosa | LOTUS Database | | Salvia hydrangea | LOTUS Database | | Salvia munzii | LOTUS Database | | Salvia officinalis | FooDB | | Salvia rosmarinus | FooDB | | Salvia sclarea | LOTUS Database | | Salvia syriaca | LOTUS Database | | Salvia tomentosa | LOTUS Database | | Santolina chamaecyparissus | LOTUS Database | | Sassafras albidum | LOTUS Database | | Satureja bachtiarica | LOTUS Database | | Satureja cuneifolia | LOTUS Database | | Satureja hortensis L. | FooDB | | Satureja montana | FooDB | | Satureja parnassica | LOTUS Database | | Satureja spicigera | LOTUS Database | | Satureja thymbra | KNApSAcK Database | | Saussurea costus | Plant | | Saussurea lappa | KNApSAcK Database | | Saxifraga stolonifera | LOTUS Database | | Saxifraga stolonifera Meerb. | KNApSAcK Database | | Scalesia aspera | LOTUS Database | | Schinus molle | LOTUS Database | | Schinus terebinthus | KNApSAcK Database | | Schisandra chinensis | KNApSAcK Database | | Schizonepeta tenuifolia | KNApSAcK Database | | Senecio vulgaris | KNApSAcK Database | | Sequoia sempervirens | LOTUS Database | | Sequoiadendron giganteum | LOTUS Database | | Sideritis athoa | LOTUS Database | | Sideritis chamaedrifolia | LOTUS Database | | Sideritis perfoliata | LOTUS Database | | Sideritis romana | LOTUS Database | | Sideritis tragoriganum | LOTUS Database | | Sium latifolium | LOTUS Database | | Smallanthus fruticosus | LOTUS Database | | Solanecio biafrae | LOTUS Database | | Solanum stuckertii | LOTUS Database | | Solidago canadensis | LOTUS Database | | Solidago gigantea | LOTUS Database | | Solidago odora | LOTUS Database | | Steganotaenia araliacea | LOTUS Database | | Stevia rebaudiana | LOTUS Database | | Syzygium nervosum | LOTUS Database | | Syzygium samarangense | LOTUS Database | | Tagetes minuta | LOTUS Database | | Tambourissa leptophylla | LOTUS Database | | Tanacetum macrophyllum | KNApSAcK Database | | Tanacetum millefolium | LOTUS Database | | Tanacetum parthenium | LOTUS Database | | Tanacetum vulgare | KNApSAcK Database | | Tarchonanthus camphoratus | KNApSAcK Database | | Tessaria fastigiata | LOTUS Database | | Tetradenia riparia | KNApSAcK Database | | Teucrium kotschyanum | LOTUS Database | | Teucrium oxylepis | LOTUS Database | | Teucrium polium | LOTUS Database | | Thapsia garganica | LOTUS Database | | Thapsia maxima | LOTUS Database | | Thuja occidentalis | LOTUS Database | | Thuja standishii | LOTUS Database | | Thujopsis dolabrata | LOTUS Database | | Thymbra capitata | LOTUS Database | | Thymbra spicata | LOTUS Database | | Thymus algeriensis | Plant | | Thymus broussonetii | Plant | | Thymus broussonetti | Plant | | Thymus capitatus | KNApSAcK Database | | Thymus caramanicus | Plant | | Thymus cilicicus | LOTUS Database | | Thymus citriodorus | LOTUS Database | | Thymus daenensis | Plant | | Thymus eigii | LOTUS Database | | Thymus kotschyanus | LOTUS Database | | Thymus longicaulis | LOTUS Database | | Thymus magnus | KNApSAcK Database | | Thymus maroccanus | Plant | | Thymus piperella | KNApSAcK Database | | Thymus praecos | Plant | | Thymus pulegioides | LOTUS Database | | Thymus quinquecostatus | KNApSAcK Database | | Thymus revolutus | LOTUS Database | | Thymus satureioides | LOTUS Database | | Thymus sibthorpii | LOTUS Database | | Thymus sipyleus | LOTUS Database | | Thymus vulgaris | KNApSAcK Database | | Thymus zygioides | LOTUS Database | | Toddalia asiatica | LOTUS Database | | Trachyspermum ammi | LOTUS Database | | Trachyspermum anethifolium | LOTUS Database | | Tricholoma matsutake | LOTUS Database | | Trichostema dichotomum | LOTUS Database | | Trichostema lanceolatum | KNApSAcK Database | | Trifolium pratense | Plant | | Trifolium repens | Plant | | Trifolium repens L. | KNApSAcK Database | | Ulva pertusa | - | | Umbellularia californica | LOTUS Database | | Urolepis hecatantha | LOTUS Database | | Uvaria chamae | LOTUS Database | | Vaccinium angustifolium | FooDB | - Lugemwa, F. N., Lwande, W., Bentley, M. D., Mendel, M. J., and Alford, A. R. (1989). Volatiles of...
| Vaccinium corymbosum | LOTUS Database | | Vaccinium vitis-idaea | LOTUS Database | | Valeriana jatamansi | Plant | | Valeriana jatamansii | KNApSAcK Database | | Valeriana officinalis | LOTUS Database | | Valeriana officinalis var.latifolia | KNApSAcK Database | | Vetiveria zizanioides | LOTUS Database | | Virola surinamensis | LOTUS Database | | Vitex agnus-castus | LOTUS Database | | Vitex negundo | LOTUS Database | | Vitis rotundifolia | LOTUS Database | | Vitis vinifera | LOTUS Database | | Xanthium strumarium | LOTUS Database | | Xenophyllum poposum | LOTUS Database | | Xylopia aethiopica | KNApSAcK Database | | Xylopia aromatica | LOTUS Database | | Xylopia parviflora | KNApSAcK Database | | Zanthoxylum armatum | LOTUS Database | | Zanthoxylum chalybeum | LOTUS Database | | Zanthoxylum schinifolium | LOTUS Database | | Zanthoxylum simulans | LOTUS Database | | Zataria multiflora | LOTUS Database | | Zingiber mioga | LOTUS Database | | Zingiber officinale | KNApSAcK Database | | Zingiber zerumbet | LOTUS Database | | Zinnia elegans | LOTUS Database | |
|
---|
Species Where Detected | |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as aromatic monoterpenoids. These are monoterpenoids containing at least one aromatic ring. |
---|
Kingdom | Organic compounds |
---|
Super Class | Lipids and lipid-like molecules |
---|
Class | Prenol lipids |
---|
Sub Class | Monoterpenoids |
---|
Direct Parent | Aromatic monoterpenoids |
---|
Alternative Parents | |
---|
Substituents | - Monocyclic monoterpenoid
- Aromatic monoterpenoid
- P-cymene
- Phenylpropane
- Cumene
- Toluene
- Benzenoid
- Monocyclic benzene moiety
- Aromatic hydrocarbon
- Unsaturated hydrocarbon
- Hydrocarbon
- Aromatic homomonocyclic compound
|
---|
Molecular Framework | Aromatic homomonocyclic compounds |
---|
External Descriptors | |
---|
Physical Properties |
---|
State | Liquid |
---|
Experimental Properties | Property | Value | Reference |
---|
Melting Point | -68.9 °C | Not Available | Boiling Point | 176.00 to 178.00 °C. @ 760.00 mm Hg | The Good Scents Company Information System | Water Solubility | 0.023 mg/mL at 25 °C | Not Available | LogP | 4.10 | Hansch CH, Leo A and Hoekman DH. "Exploring QSAR: Hydrophobic, Electronic, and Steric Constraints. Volume 1" ACS Publications (1995). |
|
---|
Predicted Properties | |
---|
General References | - Thompson JD, Chalchat JC, Michet A, Linhart YB, Ehlers B: Qualitative and quantitative variation in monoterpene co-occurrence and composition in the essential oil of Thymus vulgaris chemotypes. J Chem Ecol. 2003 Apr;29(4):859-80. [PubMed:12775148 ]
- Nishio T, Patel A, Wang Y, Lau PC: Biotransformations catalyzed by cloned p-cymene monooxygenase from Pseudomonas putida F1. Appl Microbiol Biotechnol. 2001 Apr;55(3):321-5. [PubMed:11341314 ]
- Toso B, Procida G, Stefanon B: Determination of volatile compounds in cows' milk using headspace GC-MS. J Dairy Res. 2002 Nov;69(4):569-77. doi: 10.1017/s0022029902005782. [PubMed:12463694 ]
- Johnson CB, Kazantzis A, Skoula M, Mitteregger U, Novak J: Seasonal, populational and ontogenic variation in the volatile oil content and composition of individuals of Origanum vulgare subsp. Hirtum, assessed by GC headspace analysis and by SPME sampling of individual oil glands. Phytochem Anal. 2004 Sep-Oct;15(5):286-92. doi: 10.1002/pca.780. [PubMed:15508832 ]
- Abu-Lafi S, Odeh I, Dewik H, Qabajah M, Hanus LO, Dembitsky VM: Thymol and carvacrol production from leaves of wild Palestinian Majorana syriaca. Bioresour Technol. 2008 Jun;99(9):3914-8. doi: 10.1016/j.biortech.2007.07.042. Epub 2007 Sep 10. [PubMed:17826989 ]
|
---|