Showing NP-Card for Silenoside C (NP0337360)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 2.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Created at | 2024-09-11 10:29:57 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
Updated at | 2024-09-11 10:29:58 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||
NP-MRD ID | NP0337360 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||
Natural Product Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Silenoside C | |||||||||||||||||||||||||||||||||||||||||||||||||||
Description | It was first documented in 1999 (PMID: 10346953). Based on a literature review very few articles have been published on Silenoside C. | |||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for NP0337360 (Silenoside C)Mrv2104 05262313022D 107118 0 0 0 0 999 V2000 8.6371 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4950 1.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2489 2.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3095 2.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2069 0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0227 -2.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6432 -0.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3504 -1.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6358 0.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9214 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9214 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7780 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4924 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6358 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4937 1.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4937 0.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0648 1.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0648 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 5.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -5.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7805 4.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2234 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9621 -2.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6372 -1.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7806 1.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3503 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0648 0.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4950 5.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9378 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 4.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -4.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2069 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9214 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7792 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7780 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 -0.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2095 4.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9378 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6372 5.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5089 -4.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9227 4.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5089 -3.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2095 4.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2233 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9227 4.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -2.8698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 2.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7805 2.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -1.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3654 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 2.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3655 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3655 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4950 3.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5089 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 3.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -3.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 1.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9227 0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6510 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4937 0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7792 2.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2069 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4925 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6359 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3503 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7793 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 6.2052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -5.7573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2443 -3.4520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4951 6.2051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6523 -0.3948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9634 -1.2198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 -1.2198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9240 5.3802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6523 -2.0448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 6.2052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2233 -4.5198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2082 5.3802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2822 -3.3708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 0.4302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9240 3.7302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2233 -2.8698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2082 3.7301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2793 -2.2023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 3.7302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -0.3948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6510 0.8427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 0.8427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4937 -0.8073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7806 4.1427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5089 -0.8073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9227 -0.8073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 1.2552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 4.1427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -4.1073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0635 -2.0448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4950 2.9052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -2.0449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6510 -0.8074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 2.9052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 1.2552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3654 -2.8698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2082 0.4302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10 9 1 0 0 0 0 13 12 1 0 0 0 0 14 11 1 0 0 0 0 16 15 1 0 0 0 0 24 1 1 0 0 0 0 25 2 1 0 0 0 0 26 9 2 0 0 0 0 27 17 1 0 0 0 0 27 26 1 0 0 0 0 28 21 1 0 0 0 0 29 22 1 0 0 0 0 30 19 1 0 0 0 0 31 20 1 0 0 0 0 32 11 1 0 0 0 0 33 10 1 0 0 0 0 34 18 1 0 0 0 0 35 12 1 0 0 0 0 36 24 1 0 0 0 0 37 28 1 0 0 0 0 38 29 1 0 0 0 0 39 30 1 0 0 0 0 40 31 1 0 0 0 0 41 39 1 0 0 0 0 42 40 1 0 0 0 0 43 36 1 0 0 0 0 44 37 1 0 0 0 0 45 38 1 0 0 0 0 46 41 1 0 0 0 0 47 42 1 0 0 0 0 50 25 1 0 0 0 0 50 48 1 0 0 0 0 51 49 1 0 0 0 0 52 49 1 0 0 0 0 53 43 1 0 0 0 0 54 48 1 0 0 0 0 55 51 1 0 0 0 0 56 52 1 0 0 0 0 57 44 1 0 0 0 0 58 45 1 0 0 0 0 59 46 1 0 0 0 0 60 47 1 0 0 0 0 61 54 1 0 0 0 0 62 53 1 0 0 0 0 63 55 1 0 0 0 0 65 3 1 0 0 0 0 65 4 1 0 0 0 0 65 15 1 0 0 0 0 65 17 1 0 0 0 0 66 5 1 0 0 0 0 66 13 1 0 0 0 0 66 32 1 0 0 0 0 66 33 1 0 0 0 0 67 6 1 0 0 0 0 67 23 1 0 0 0 0 67 32 1 0 0 0 0 67 35 1 0 0 0 0 68 7 1 0 0 0 0 68 14 1 0 0 0 0 68 33 1 0 0 0 0 69 8 1 0 0 0 0 69 18 1 0 0 0 0 69 26 1 0 0 0 0 69 68 1 0 0 0 0 70 16 1 0 0 0 0 70 27 1 0 0 0 0 70 34 1 0 0 0 0 70 64 1 0 0 0 0 71 19 1 0 0 0 0 72 20 1 0 0 0 0 73 23 2 0 0 0 0 74 28 1 0 0 0 0 75 29 1 0 0 0 0 76 34 1 0 0 0 0 77 36 1 0 0 0 0 78 37 1 0 0 0 0 79 38 1 0 0 0 0 80 39 1 0 0 0 0 81 40 1 0 0 0 0 82 41 1 0 0 0 0 83 42 1 0 0 0 0 84 43 1 0 0 0 0 85 44 1 0 0 0 0 86 45 1 0 0 0 0 87 46 1 0 0 0 0 88 47 1 0 0 0 0 89 48 1 0 0 0 0 90 49 1 0 0 0 0 91 56 2 0 0 0 0 92 56 1 0 0 0 0 93 64 2 0 0 0 0 94 21 1 0 0 0 0 94 57 1 0 0 0 0 95 22 1 0 0 0 0 95 58 1 0 0 0 0 96 24 1 0 0 0 0 96 62 1 0 0 0 0 97 25 1 0 0 0 0 97 61 1 0 0 0 0 98 30 1 0 0 0 0 98 59 1 0 0 0 0 99 31 1 0 0 0 0 99 60 1 0 0 0 0 100 35 1 0 0 0 0 100 63 1 0 0 0 0 101 50 1 0 0 0 0 101 57 1 0 0 0 0 102 51 1 0 0 0 0 102 58 1 0 0 0 0 103 52 1 0 0 0 0 103 63 1 0 0 0 0 104 54 1 0 0 0 0 104 59 1 0 0 0 0 105 53 1 0 0 0 0 105 61 1 0 0 0 0 106 55 1 0 0 0 0 106 60 1 0 0 0 0 107 62 1 0 0 0 0 107 64 1 0 0 0 0 M END 3D SDF for NP0337360 (Silenoside C)Mrv2104 05262313022D 107118 0 0 0 0 999 V2000 8.6371 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4950 1.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2489 2.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3095 2.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2069 0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0227 -2.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6432 -0.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3504 -1.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6358 0.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9214 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9214 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7780 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4924 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6358 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4937 1.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4937 0.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0648 1.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0648 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 5.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -5.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7805 4.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2234 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9621 -2.6768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6372 -1.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7806 1.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3503 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0648 0.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4950 5.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9378 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 4.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -4.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2069 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9214 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7792 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7780 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 -0.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2095 4.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9378 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6372 5.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5089 -4.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9227 4.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5089 -3.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2095 4.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2233 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9227 4.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -2.8698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 2.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7805 2.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -1.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3654 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 2.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3655 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3655 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4950 3.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5089 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 3.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -3.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 1.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9227 0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6510 -1.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4937 0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7792 2.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2069 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4925 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6359 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3503 -0.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7793 0.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 6.2052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -5.7573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2443 -3.4520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4951 6.2051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6523 -0.3948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9634 -1.2198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 -1.2198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9240 5.3802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6523 -2.0448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 6.2052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2233 -4.5198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2082 5.3802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2822 -3.3708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 0.4302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9240 3.7302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2233 -2.8698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2082 3.7301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2793 -2.2023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 3.7302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -0.3948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6510 0.8427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 0.8427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4937 -0.8073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7806 4.1427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5089 -0.8073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9227 -0.8073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0661 1.2552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3516 4.1427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 -4.1073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0635 -2.0448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4950 2.9052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7944 -2.0449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6510 -0.8074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 2.9052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6371 1.2552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3654 -2.8698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2082 0.4302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10 9 1 0 0 0 0 13 12 1 0 0 0 0 14 11 1 0 0 0 0 16 15 1 0 0 0 0 24 1 1 0 0 0 0 25 2 1 0 0 0 0 26 9 2 0 0 0 0 27 17 1 0 0 0 0 27 26 1 0 0 0 0 28 21 1 0 0 0 0 29 22 1 0 0 0 0 30 19 1 0 0 0 0 31 20 1 0 0 0 0 32 11 1 0 0 0 0 33 10 1 0 0 0 0 34 18 1 0 0 0 0 35 12 1 0 0 0 0 36 24 1 0 0 0 0 37 28 1 0 0 0 0 38 29 1 0 0 0 0 39 30 1 0 0 0 0 40 31 1 0 0 0 0 41 39 1 0 0 0 0 42 40 1 0 0 0 0 43 36 1 0 0 0 0 44 37 1 0 0 0 0 45 38 1 0 0 0 0 46 41 1 0 0 0 0 47 42 1 0 0 0 0 50 25 1 0 0 0 0 50 48 1 0 0 0 0 51 49 1 0 0 0 0 52 49 1 0 0 0 0 53 43 1 0 0 0 0 54 48 1 0 0 0 0 55 51 1 0 0 0 0 56 52 1 0 0 0 0 57 44 1 0 0 0 0 58 45 1 0 0 0 0 59 46 1 0 0 0 0 60 47 1 0 0 0 0 61 54 1 0 0 0 0 62 53 1 0 0 0 0 63 55 1 0 0 0 0 65 3 1 0 0 0 0 65 4 1 0 0 0 0 65 15 1 0 0 0 0 65 17 1 0 0 0 0 66 5 1 0 0 0 0 66 13 1 0 0 0 0 66 32 1 0 0 0 0 66 33 1 0 0 0 0 67 6 1 0 0 0 0 67 23 1 0 0 0 0 67 32 1 0 0 0 0 67 35 1 0 0 0 0 68 7 1 0 0 0 0 68 14 1 0 0 0 0 68 33 1 0 0 0 0 69 8 1 0 0 0 0 69 18 1 0 0 0 0 69 26 1 0 0 0 0 69 68 1 0 0 0 0 70 16 1 0 0 0 0 70 27 1 0 0 0 0 70 34 1 0 0 0 0 70 64 1 0 0 0 0 71 19 1 0 0 0 0 72 20 1 0 0 0 0 73 23 2 0 0 0 0 74 28 1 0 0 0 0 75 29 1 0 0 0 0 76 34 1 0 0 0 0 77 36 1 0 0 0 0 78 37 1 0 0 0 0 79 38 1 0 0 0 0 80 39 1 0 0 0 0 81 40 1 0 0 0 0 82 41 1 0 0 0 0 83 42 1 0 0 0 0 84 43 1 0 0 0 0 85 44 1 0 0 0 0 86 45 1 0 0 0 0 87 46 1 0 0 0 0 88 47 1 0 0 0 0 89 48 1 0 0 0 0 90 49 1 0 0 0 0 91 56 2 0 0 0 0 92 56 1 0 0 0 0 93 64 2 0 0 0 0 94 21 1 0 0 0 0 94 57 1 0 0 0 0 95 22 1 0 0 0 0 95 58 1 0 0 0 0 96 24 1 0 0 0 0 96 62 1 0 0 0 0 97 25 1 0 0 0 0 97 61 1 0 0 0 0 98 30 1 0 0 0 0 98 59 1 0 0 0 0 99 31 1 0 0 0 0 99 60 1 0 0 0 0 100 35 1 0 0 0 0 100 63 1 0 0 0 0 101 50 1 0 0 0 0 101 57 1 0 0 0 0 102 51 1 0 0 0 0 102 58 1 0 0 0 0 103 52 1 0 0 0 0 103 63 1 0 0 0 0 104 54 1 0 0 0 0 104 59 1 0 0 0 0 105 53 1 0 0 0 0 105 61 1 0 0 0 0 106 55 1 0 0 0 0 106 60 1 0 0 0 0 107 62 1 0 0 0 0 107 64 1 0 0 0 0 M END > <DATABASE_ID> NP0337360 > <DATABASE_NAME> NP-MRD > <SMILES> CC1OC(OC(=O)C23CCC(C)(C)CC2C2=CCC4C5(C)CCC(OC6OC(C(O)C(OC7OCC(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(O)=O)C(C)(C=O)C5CCC4(C)C2(C)CC3O)C(OC2OC(C)C(OC3OCC(O)C(O)C3O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O > <INCHI_IDENTIFIER> InChI=1/C70H110O37/c1-24-36(77)43(84)53(105-61-54(104-59-46(87)41(82)39(80)30(19-71)98-59)48(89)50(25(2)97-61)101-57-44(85)37(78)28(74)21-94-57)62(96-24)107-64(93)70-16-15-65(3,4)17-27(70)26-9-10-33-66(5)13-12-35(67(6,23-73)32(66)11-14-68(33,7)69(26,8)18-34(70)76)100-63-55(106-60-47(88)42(83)40(81)31(20-72)99-60)51(49(90)52(103-63)56(91)92)102-58-45(86)38(79)29(75)22-95-58/h9,23-25,27-55,57-63,71-72,74-90H,10-22H2,1-8H3,(H,91,92) > <INCHI_KEY> CXYICQJQCAFDTE-UHFFFAOYNA-N > <FORMULA> C70H110O37 > <MOLECULAR_WEIGHT> 1543.613 > <EXACT_MASS> 1542.672594482 > <JCHEM_ACCEPTOR_COUNT> 36 > <JCHEM_ATOM_COUNT> 217 > <JCHEM_AVERAGE_POLARIZABILITY> 155.82107127645008 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 20 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 6-({8a-[({4,5-dihydroxy-3-[(4-hydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-5-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl)oxy]-6-methyloxan-2-yl}oxy)carbonyl]-4-formyl-8-hydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl}oxy)-3-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxane-2-carboxylic acid > <JCHEM_LOGP> -4.821218899000002 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 12 > <JCHEM_PHYSIOLOGICAL_CHARGE> -1 > <JCHEM_PKA> 11.727291851832353 > <JCHEM_PKA_STRONGEST_ACIDIC> 3.2818261818658985 > <JCHEM_PKA_STRONGEST_BASIC> -3.6902614622956817 > <JCHEM_POLAR_SURFACE_AREA> 585.0300000000003 > <JCHEM_REFRACTIVITY> 347.69779999999963 > <JCHEM_ROTATABLE_BOND_COUNT> 19 > <JCHEM_RULE_OF_FIVE> 0 > <JCHEM_TRADITIONAL_IUPAC> 6-({8a-[({4,5-dihydroxy-3-[(4-hydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-5-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl)oxy]-6-methyloxan-2-yl}oxy)carbonyl]-4-formyl-8-hydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl}oxy)-3-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxane-2-carboxylic acid > <JCHEM_VEBER_RULE> 0 $$$$ PDB for NP0337360 (Silenoside C)HEADER PROTEIN 26-MAY-23 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 26-MAY-23 0 HETATM 1 C UNK 0 16.123 -3.817 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 21.457 2.343 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 9.798 5.063 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 11.778 5.063 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 4.120 0.033 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 3.776 -4.997 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 6.801 -0.022 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 8.121 -2.277 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 6.787 1.573 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 5.453 0.803 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 5.453 -3.817 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 1.452 -1.507 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 2.786 -0.737 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 6.787 -3.047 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 12.122 3.113 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 12.122 1.573 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 9.454 3.113 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 9.454 -1.507 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 18.790 10.043 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -5.216 -9.977 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 20.124 9.273 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 -7.884 -0.737 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 1.796 -4.997 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 16.123 -2.277 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 20.124 3.113 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 8.121 0.803 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 9.454 1.573 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 21.457 10.043 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -9.217 -1.507 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 17.456 9.273 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -5.216 -8.437 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 4.120 -3.047 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 5.453 -0.737 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 10.788 -0.737 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 1.452 -3.047 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 17.456 -1.507 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 22.791 9.273 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 -9.217 -3.047 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 16.123 10.043 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 -6.550 -7.667 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 14.789 9.273 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 -6.550 -6.127 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 17.456 0.033 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 22.791 7.733 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 -7.883 -3.817 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 14.789 7.733 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 -5.216 -5.357 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 18.790 5.423 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 -3.882 -1.507 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 20.124 4.653 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -3.882 -3.047 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 -2.549 -0.737 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 16.123 0.803 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 17.456 4.653 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 -2.549 -3.817 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 -2.549 0.803 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 21.457 6.963 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 -6.550 -3.047 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 16.123 6.963 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 -3.882 -6.127 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 17.456 3.113 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 14.789 0.033 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 -1.215 -3.047 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 12.122 0.033 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 10.788 3.883 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 4.120 -1.507 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 2.786 -3.817 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 6.787 -1.507 0.000 0.00 0.00 C+0 HETATM 69 C UNK 0 8.121 -0.737 0.000 0.00 0.00 C+0 HETATM 70 C UNK 0 10.788 0.803 0.000 0.00 0.00 C+0 HETATM 71 O UNK 0 18.790 11.583 0.000 0.00 0.00 O+0 HETATM 72 O UNK 0 -3.882 -10.747 0.000 0.00 0.00 O+0 HETATM 73 O UNK 0 2.323 -6.444 0.000 0.00 0.00 O+0 HETATM 74 O UNK 0 21.458 11.583 0.000 0.00 0.00 O+0 HETATM 75 O UNK 0 -10.551 -0.737 0.000 0.00 0.00 O+0 HETATM 76 O UNK 0 11.132 -2.277 0.000 0.00 0.00 O+0 HETATM 77 O UNK 0 18.790 -2.277 0.000 0.00 0.00 O+0 HETATM 78 O UNK 0 24.125 10.043 0.000 0.00 0.00 O+0 HETATM 79 O UNK 0 -10.551 -3.817 0.000 0.00 0.00 O+0 HETATM 80 O UNK 0 16.123 11.583 0.000 0.00 0.00 O+0 HETATM 81 O UNK 0 -7.883 -8.437 0.000 0.00 0.00 O+0 HETATM 82 O UNK 0 13.455 10.043 0.000 0.00 0.00 O+0 HETATM 83 O UNK 0 -7.993 -6.292 0.000 0.00 0.00 O+0 HETATM 84 O UNK 0 18.790 0.803 0.000 0.00 0.00 O+0 HETATM 85 O UNK 0 24.125 6.963 0.000 0.00 0.00 O+0 HETATM 86 O UNK 0 -7.883 -5.357 0.000 0.00 0.00 O+0 HETATM 87 O UNK 0 13.455 6.963 0.000 0.00 0.00 O+0 HETATM 88 O UNK 0 -6.121 -4.111 0.000 0.00 0.00 O+0 HETATM 89 O UNK 0 18.790 6.963 0.000 0.00 0.00 O+0 HETATM 90 O UNK 0 -5.216 -0.737 0.000 0.00 0.00 O+0 HETATM 91 O UNK 0 -1.215 1.573 0.000 0.00 0.00 O+0 HETATM 92 O UNK 0 -3.882 1.573 0.000 0.00 0.00 O+0 HETATM 93 O UNK 0 12.122 -1.507 0.000 0.00 0.00 O+0 HETATM 94 O UNK 0 20.124 7.733 0.000 0.00 0.00 O+0 HETATM 95 O UNK 0 -6.550 -1.507 0.000 0.00 0.00 O+0 HETATM 96 O UNK 0 14.789 -1.507 0.000 0.00 0.00 O+0 HETATM 97 O UNK 0 18.790 2.343 0.000 0.00 0.00 O+0 HETATM 98 O UNK 0 17.456 7.733 0.000 0.00 0.00 O+0 HETATM 99 O UNK 0 -3.882 -7.667 0.000 0.00 0.00 O+0 HETATM 100 O UNK 0 0.119 -3.817 0.000 0.00 0.00 O+0 HETATM 101 O UNK 0 21.457 5.423 0.000 0.00 0.00 O+0 HETATM 102 O UNK 0 -5.216 -3.817 0.000 0.00 0.00 O+0 HETATM 103 O UNK 0 -1.215 -1.507 0.000 0.00 0.00 O+0 HETATM 104 O UNK 0 16.123 5.423 0.000 0.00 0.00 O+0 HETATM 105 O UNK 0 16.123 2.343 0.000 0.00 0.00 O+0 HETATM 106 O UNK 0 -2.549 -5.357 0.000 0.00 0.00 O+0 HETATM 107 O UNK 0 13.455 0.803 0.000 0.00 0.00 O+0 CONECT 1 24 CONECT 2 25 CONECT 3 65 CONECT 4 65 CONECT 5 66 CONECT 6 67 CONECT 7 68 CONECT 8 69 CONECT 9 10 26 CONECT 10 9 33 CONECT 11 14 32 CONECT 12 13 35 CONECT 13 12 66 CONECT 14 11 68 CONECT 15 16 65 CONECT 16 15 70 CONECT 17 27 65 CONECT 18 34 69 CONECT 19 30 71 CONECT 20 31 72 CONECT 21 28 94 CONECT 22 29 95 CONECT 23 67 73 CONECT 24 1 36 96 CONECT 25 2 50 97 CONECT 26 9 27 69 CONECT 27 17 26 70 CONECT 28 21 37 74 CONECT 29 22 38 75 CONECT 30 19 39 98 CONECT 31 20 40 99 CONECT 32 11 66 67 CONECT 33 10 66 68 CONECT 34 18 70 76 CONECT 35 12 67 100 CONECT 36 24 43 77 CONECT 37 28 44 78 CONECT 38 29 45 79 CONECT 39 30 41 80 CONECT 40 31 42 81 CONECT 41 39 46 82 CONECT 42 40 47 83 CONECT 43 36 53 84 CONECT 44 37 57 85 CONECT 45 38 58 86 CONECT 46 41 59 87 CONECT 47 42 60 88 CONECT 48 50 54 89 CONECT 49 51 52 90 CONECT 50 25 48 101 CONECT 51 49 55 102 CONECT 52 49 56 103 CONECT 53 43 62 105 CONECT 54 48 61 104 CONECT 55 51 63 106 CONECT 56 52 91 92 CONECT 57 44 94 101 CONECT 58 45 95 102 CONECT 59 46 98 104 CONECT 60 47 99 106 CONECT 61 54 97 105 CONECT 62 53 96 107 CONECT 63 55 100 103 CONECT 64 70 93 107 CONECT 65 3 4 15 17 CONECT 66 5 13 32 33 CONECT 67 6 23 32 35 CONECT 68 7 14 33 69 CONECT 69 8 18 26 68 CONECT 70 16 27 34 64 CONECT 71 19 CONECT 72 20 CONECT 73 23 CONECT 74 28 CONECT 75 29 CONECT 76 34 CONECT 77 36 CONECT 78 37 CONECT 79 38 CONECT 80 39 CONECT 81 40 CONECT 82 41 CONECT 83 42 CONECT 84 43 CONECT 85 44 CONECT 86 45 CONECT 87 46 CONECT 88 47 CONECT 89 48 CONECT 90 49 CONECT 91 56 CONECT 92 56 CONECT 93 64 CONECT 94 21 57 CONECT 95 22 58 CONECT 96 24 62 CONECT 97 25 61 CONECT 98 30 59 CONECT 99 31 60 CONECT 100 35 63 CONECT 101 50 57 CONECT 102 51 58 CONECT 103 52 63 CONECT 104 54 59 CONECT 105 53 61 CONECT 106 55 60 CONECT 107 62 64 MASTER 0 0 0 0 0 0 0 0 107 0 236 0 END SMILES for NP0337360 (Silenoside C)CC1OC(OC(=O)C23CCC(C)(C)CC2C2=CCC4C5(C)CCC(OC6OC(C(O)C(OC7OCC(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(O)=O)C(C)(C=O)C5CCC4(C)C2(C)CC3O)C(OC2OC(C)C(OC3OCC(O)C(O)C3O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O INCHI for NP0337360 (Silenoside C)InChI=1/C70H110O37/c1-24-36(77)43(84)53(105-61-54(104-59-46(87)41(82)39(80)30(19-71)98-59)48(89)50(25(2)97-61)101-57-44(85)37(78)28(74)21-94-57)62(96-24)107-64(93)70-16-15-65(3,4)17-27(70)26-9-10-33-66(5)13-12-35(67(6,23-73)32(66)11-14-68(33,7)69(26,8)18-34(70)76)100-63-55(106-60-47(88)42(83)40(81)31(20-72)99-60)51(49(90)52(103-63)56(91)92)102-58-45(86)38(79)29(75)22-95-58/h9,23-25,27-55,57-63,71-72,74-90H,10-22H2,1-8H3,(H,91,92) 3D Structure for NP0337360 (Silenoside C) | |||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C70H110O37 | |||||||||||||||||||||||||||||||||||||||||||||||||||
Average Mass | 1543.6130 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Mass | 1542.67259 Da | |||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 6-({8a-[({4,5-dihydroxy-3-[(4-hydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-5-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl)oxy]-6-methyloxan-2-yl}oxy)carbonyl]-4-formyl-8-hydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl}oxy)-3-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxane-2-carboxylic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 6-({8a-[({4,5-dihydroxy-3-[(4-hydroxy-6-methyl-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-5-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxan-2-yl)oxy]-6-methyloxan-2-yl}oxy)carbonyl]-4-formyl-8-hydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl}oxy)-3-hydroxy-5-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4-[(3,4,5-trihydroxyoxan-2-yl)oxy]oxane-2-carboxylic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC1OC(OC(=O)C23CCC(C)(C)CC2C2=CCC4C5(C)CCC(OC6OC(C(O)C(OC7OCC(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(O)=O)C(C)(C=O)C5CCC4(C)C2(C)CC3O)C(OC2OC(C)C(OC3OCC(O)C(O)C3O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1/C70H110O37/c1-24-36(77)43(84)53(105-61-54(104-59-46(87)41(82)39(80)30(19-71)98-59)48(89)50(25(2)97-61)101-57-44(85)37(78)28(74)21-94-57)62(96-24)107-64(93)70-16-15-65(3,4)17-27(70)26-9-10-33-66(5)13-12-35(67(6,23-73)32(66)11-14-68(33,7)69(26,8)18-34(70)76)100-63-55(106-60-47(88)42(83)40(81)31(20-72)99-60)51(49(90)52(103-63)56(91)92)102-58-45(86)38(79)29(75)22-95-58/h9,23-25,27-55,57-63,71-72,74-90H,10-22H2,1-8H3,(H,91,92) | |||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | CXYICQJQCAFDTE-UHFFFAOYNA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Shift Submissions | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Species of Origin | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||
Classification | Not classified | |||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
FoodDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|